Compare commits
13 Commits
embassy-ti
...
comment-me
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
c7803bb8f4 | ||
|
|
683d5c3066 | ||
|
|
a3574e519a | ||
|
|
3e3317e8bd | ||
|
|
e7aeb9b29f | ||
|
|
7fd868ade9 | ||
|
|
6e6df22979 | ||
|
|
f7980885a5 | ||
|
|
5a1393aa0b | ||
|
|
40e4ca4751 | ||
|
|
31d4516516 | ||
|
|
66e62e9994 | ||
|
|
eeedaf2e76 |
@@ -14,7 +14,7 @@ firmware-logs = []
|
||||
embassy-time = { version = "0.1.5", path = "../embassy-time"}
|
||||
embassy-sync = { version = "0.3.0", path = "../embassy-sync"}
|
||||
embassy-futures = { version = "0.1.0", path = "../embassy-futures"}
|
||||
embassy-net-driver-channel = { version = "0.1.0", path = "../embassy-net-driver-channel"}
|
||||
embassy-net-driver-channel = { version = "0.2.0", path = "../embassy-net-driver-channel"}
|
||||
|
||||
defmt = { version = "0.3", optional = true }
|
||||
log = { version = "0.4.17", optional = true }
|
||||
|
||||
@@ -16,7 +16,7 @@ log = { version = "0.4", default-features = false, optional = true }
|
||||
embedded-hal-1 = { package = "embedded-hal", version = "=1.0.0-rc.1" }
|
||||
embedded-hal-async = { version = "=1.0.0-rc.1" }
|
||||
embedded-hal-bus = { version = "=0.1.0-rc.1", features = ["async"] }
|
||||
embassy-net-driver-channel = { version = "0.1.0", path = "../embassy-net-driver-channel" }
|
||||
embassy-net-driver-channel = { version = "0.2.0", path = "../embassy-net-driver-channel" }
|
||||
embassy-time = { version = "0.1.5", path = "../embassy-time" }
|
||||
embassy-futures = { version = "0.1.0", path = "../embassy-futures" }
|
||||
bitfield = "0.14.0"
|
||||
|
||||
18
embassy-net-driver-channel/CHANGELOG.md
Normal file
18
embassy-net-driver-channel/CHANGELOG.md
Normal file
@@ -0,0 +1,18 @@
|
||||
# Changelog
|
||||
|
||||
All notable changes to this project will be documented in this file.
|
||||
|
||||
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
||||
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
||||
|
||||
## 0.2.0 - 2023-10-15
|
||||
|
||||
- Update embassy-net-driver
|
||||
- `Runner::new` now takes an `embassy_net_driver::HardwareAddress` parameter
|
||||
- Added `Runner::set_ieee802154_address`, `Runner::ieee802154_address`
|
||||
|
||||
## 0.1.0 - 2023-06-29
|
||||
|
||||
- First release
|
||||
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
[package]
|
||||
name = "embassy-net-driver-channel"
|
||||
version = "0.1.0"
|
||||
version = "0.2.0"
|
||||
edition = "2021"
|
||||
license = "MIT OR Apache-2.0"
|
||||
description = "High-level channel-based driver for the `embassy-net` async TCP/IP network stack."
|
||||
@@ -26,4 +26,4 @@ log = { version = "0.4.14", optional = true }
|
||||
|
||||
embassy-sync = { version = "0.3.0", path = "../embassy-sync" }
|
||||
embassy-futures = { version = "0.1.0", path = "../embassy-futures" }
|
||||
embassy-net-driver = { version = "0.1.0", path = "../embassy-net-driver" }
|
||||
embassy-net-driver = { version = "0.2.0", path = "../embassy-net-driver" }
|
||||
|
||||
17
embassy-net-driver/CHANGELOG.md
Normal file
17
embassy-net-driver/CHANGELOG.md
Normal file
@@ -0,0 +1,17 @@
|
||||
# Changelog
|
||||
|
||||
All notable changes to this project will be documented in this file.
|
||||
|
||||
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
||||
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
||||
|
||||
## 0.2.0 - 2023-10-15
|
||||
|
||||
- Added `Driver::ieee802154_address`
|
||||
- Added `Medium::Ieee802154`
|
||||
|
||||
## 0.1.0 - 2023-06-29
|
||||
|
||||
- First release
|
||||
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
[package]
|
||||
name = "embassy-net-driver"
|
||||
version = "0.1.0"
|
||||
version = "0.2.0"
|
||||
edition = "2021"
|
||||
license = "MIT OR Apache-2.0"
|
||||
description = "Driver trait for the `embassy-net` async TCP/IP network stack."
|
||||
|
||||
@@ -10,7 +10,7 @@ edition = "2021"
|
||||
[dependencies]
|
||||
embedded-hal = { version = "1.0.0-rc.1" }
|
||||
embedded-hal-async = { version = "=1.0.0-rc.1" }
|
||||
embassy-net-driver = { version = "0.1.0", path = "../embassy-net-driver" }
|
||||
embassy-net-driver = { version = "0.2.0", path = "../embassy-net-driver" }
|
||||
embassy-time = { version = "0.1.5", path = "../embassy-time" }
|
||||
embassy-futures = { version = "0.1.0", path = "../embassy-futures" }
|
||||
|
||||
|
||||
@@ -10,7 +10,7 @@ log = { version = "0.4.14", optional = true }
|
||||
embassy-time = { version = "0.1.5", path = "../embassy-time" }
|
||||
embassy-sync = { version = "0.3.0", path = "../embassy-sync"}
|
||||
embassy-futures = { version = "0.1.0", path = "../embassy-futures"}
|
||||
embassy-net-driver-channel = { version = "0.1.0", path = "../embassy-net-driver-channel"}
|
||||
embassy-net-driver-channel = { version = "0.2.0", path = "../embassy-net-driver-channel"}
|
||||
|
||||
embedded-hal = { version = "1.0.0-rc.1" }
|
||||
embedded-hal-async = { version = "=1.0.0-rc.1" }
|
||||
|
||||
@@ -16,7 +16,7 @@ defmt = { version = "0.3", optional = true }
|
||||
log = { version = "0.4.14", optional = true }
|
||||
|
||||
embedded-io-async = { version = "0.6.0" }
|
||||
embassy-net-driver-channel = { version = "0.1.0", path = "../embassy-net-driver-channel" }
|
||||
embassy-net-driver-channel = { version = "0.2.0", path = "../embassy-net-driver-channel" }
|
||||
embassy-futures = { version = "0.1.0", path = "../embassy-futures" }
|
||||
ppproto = { version = "0.1.2"}
|
||||
embassy-sync = { version = "0.3.0", path = "../embassy-sync" }
|
||||
|
||||
@@ -8,7 +8,7 @@ license = "MIT OR Apache-2.0"
|
||||
edition = "2021"
|
||||
|
||||
[dependencies]
|
||||
embassy-net-driver = { version = "0.1.0", path = "../embassy-net-driver" }
|
||||
embassy-net-driver = { version = "0.2.0", path = "../embassy-net-driver" }
|
||||
async-io = "1.6.0"
|
||||
log = "0.4.14"
|
||||
libc = "0.2.101"
|
||||
|
||||
@@ -10,7 +10,7 @@ edition = "2021"
|
||||
[dependencies]
|
||||
embedded-hal = { version = "1.0.0-rc.1" }
|
||||
embedded-hal-async = { version = "=1.0.0-rc.1" }
|
||||
embassy-net-driver-channel = { version = "0.1.0", path = "../embassy-net-driver-channel" }
|
||||
embassy-net-driver-channel = { version = "0.2.0", path = "../embassy-net-driver-channel" }
|
||||
embassy-time = { version = "0.1.5", path = "../embassy-time" }
|
||||
embassy-futures = { version = "0.1.0", path = "../embassy-futures" }
|
||||
defmt = { version = "0.3", optional = true }
|
||||
|
||||
31
embassy-net/CHANGELOG.md
Normal file
31
embassy-net/CHANGELOG.md
Normal file
@@ -0,0 +1,31 @@
|
||||
# Changelog
|
||||
|
||||
All notable changes to this project will be documented in this file.
|
||||
|
||||
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
||||
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
||||
|
||||
## 0.2.0 - 2023-10-15
|
||||
|
||||
- Re-export `smoltcp::wire::IpEndpoint`
|
||||
- Add poll functions on UdpSocket
|
||||
- Make dual-stack work in embassy-net
|
||||
- Fix multicast support
|
||||
- Allow ethernet and 802.15.4 to coexist
|
||||
- Add IEEE802.15.4 address to embassy net Stack
|
||||
- Use HardwareAddress in Driver
|
||||
- Add async versions of smoltcp's `send` and `recv` closure based API
|
||||
- add error translation to tcp errors
|
||||
- Forward TCP/UDP socket capacity impls
|
||||
- allow changing IP config at runtime
|
||||
- allow non-'static drivers
|
||||
- Remove impl_trait_projections
|
||||
- update embedded-io, embedded-nal-async
|
||||
- add support for dhcp hostname option
|
||||
- Wake stack's task after queueing a DNS query
|
||||
|
||||
## 0.1.0 - 2023-06-29
|
||||
|
||||
- First release
|
||||
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
[package]
|
||||
name = "embassy-net"
|
||||
version = "0.1.0"
|
||||
version = "0.2.0"
|
||||
edition = "2021"
|
||||
license = "MIT OR Apache-2.0"
|
||||
description = "Async TCP/IP network stack for embedded systems"
|
||||
@@ -51,7 +51,7 @@ smoltcp = { version = "0.10.0", default-features = false, features = [
|
||||
"async",
|
||||
] }
|
||||
|
||||
embassy-net-driver = { version = "0.1.0", path = "../embassy-net-driver" }
|
||||
embassy-net-driver = { version = "0.2.0", path = "../embassy-net-driver" }
|
||||
embassy-time = { version = "0.1.5", path = "../embassy-time" }
|
||||
embassy-sync = { version = "0.3.0", path = "../embassy-sync" }
|
||||
embedded-io-async = { version = "0.6.0", optional = true }
|
||||
|
||||
@@ -17,7 +17,7 @@ embassy-time = { version = "0.1.5", path = "../embassy-time", optional = true }
|
||||
embassy-futures = { version = "0.1.0", path = "../embassy-futures" }
|
||||
embassy-hal-internal = { version = "0.1.0", path = "../embassy-hal-internal" }
|
||||
embassy-embedded-hal = { version = "0.1.0", path = "../embassy-embedded-hal" }
|
||||
embassy-net-driver = { version = "0.1.0", path = "../embassy-net-driver", optional=true }
|
||||
embassy-net-driver = { version = "0.2.0", path = "../embassy-net-driver", optional=true }
|
||||
|
||||
defmt = { version = "0.3", optional = true }
|
||||
cortex-m = "0.7.6"
|
||||
|
||||
@@ -37,7 +37,7 @@ embassy-time = { version = "0.1.5", path = "../embassy-time", optional = true }
|
||||
embassy-futures = { version = "0.1.0", path = "../embassy-futures" }
|
||||
embassy-hal-internal = {version = "0.1.0", path = "../embassy-hal-internal", features = ["cortex-m", "prio-bits-4"] }
|
||||
embassy-embedded-hal = {version = "0.1.0", path = "../embassy-embedded-hal" }
|
||||
embassy-net-driver = { version = "0.1.0", path = "../embassy-net-driver" }
|
||||
embassy-net-driver = { version = "0.2.0", path = "../embassy-net-driver" }
|
||||
embassy-usb-driver = {version = "0.1.0", path = "../embassy-usb-driver", optional = true }
|
||||
embassy-executor = { version = "0.3.0", path = "../embassy-executor", optional = true }
|
||||
|
||||
@@ -58,7 +58,7 @@ rand_core = "0.6.3"
|
||||
sdio-host = "0.5.0"
|
||||
embedded-sdmmc = { git = "https://github.com/embassy-rs/embedded-sdmmc-rs", rev = "a4f293d3a6f72158385f79c98634cb8a14d0d2fc", optional = true }
|
||||
critical-section = "1.1"
|
||||
stm32-metapac = { git = "https://github.com/embassy-rs/stm32-data-generated", tag = "stm32-data-9330e31117668350a62572fdcd2598ec17d08042" }
|
||||
stm32-metapac = { git = "https://github.com/embassy-rs/stm32-data-generated", tag = "stm32-data-c20cbde88fdfaef4645361d09df0cb63a4dc6462" }
|
||||
vcell = "0.1.3"
|
||||
bxcan = "0.7.0"
|
||||
nb = "1.0.0"
|
||||
@@ -76,7 +76,7 @@ critical-section = { version = "1.1", features = ["std"] }
|
||||
[build-dependencies]
|
||||
proc-macro2 = "1.0.36"
|
||||
quote = "1.0.15"
|
||||
stm32-metapac = { git = "https://github.com/embassy-rs/stm32-data-generated", tag = "stm32-data-9330e31117668350a62572fdcd2598ec17d08042", default-features = false, features = ["metadata"]}
|
||||
stm32-metapac = { git = "https://github.com/embassy-rs/stm32-data-generated", tag = "stm32-data-c20cbde88fdfaef4645361d09df0cb63a4dc6462", default-features = false, features = ["metadata"]}
|
||||
|
||||
|
||||
[features]
|
||||
|
||||
@@ -466,15 +466,9 @@ fn main() {
|
||||
|
||||
let ptype = if let Some(reg) = &p.registers { reg.kind } else { "" };
|
||||
let pname = format_ident!("{}", p.name);
|
||||
let clk = format_ident!(
|
||||
"{}",
|
||||
rcc.clock
|
||||
.to_ascii_lowercase()
|
||||
.replace("ahb", "hclk")
|
||||
.replace("apb", "pclk")
|
||||
);
|
||||
let en_reg = format_ident!("{}", en.register.to_ascii_lowercase());
|
||||
let set_en_field = format_ident!("set_{}", en.field.to_ascii_lowercase());
|
||||
let clk = format_ident!("{}", rcc.clock);
|
||||
let en_reg = format_ident!("{}", en.register);
|
||||
let set_en_field = format_ident!("set_{}", en.field);
|
||||
|
||||
let (before_enable, before_disable) = if refcounted_peripherals.contains(ptype) {
|
||||
let refcount_static =
|
||||
@@ -500,11 +494,11 @@ fn main() {
|
||||
(TokenStream::new(), TokenStream::new())
|
||||
};
|
||||
|
||||
let mux_supported = HashSet::from(["c0", "h5", "h50", "h7", "h7ab", "h7rm0433", "g4", "l4"])
|
||||
.contains(rcc_registers.version);
|
||||
let mux_for = |mux: Option<&'static PeripheralRccRegister>| {
|
||||
let checked_rccs = HashSet::from(["h5", "h50", "h7", "h7ab", "h7rm0433", "g4"]);
|
||||
|
||||
// restrict mux implementation to supported versions
|
||||
if !checked_rccs.contains(rcc_registers.version) {
|
||||
if !mux_supported {
|
||||
return None;
|
||||
}
|
||||
|
||||
|
||||
@@ -134,6 +134,8 @@ pub(crate) unsafe fn init(config: Config) {
|
||||
};
|
||||
|
||||
set_freqs(Clocks {
|
||||
hsi: None,
|
||||
lse: None,
|
||||
sys: sys_clk,
|
||||
hclk1: ahb_freq,
|
||||
pclk1: apb_freq,
|
||||
|
||||
@@ -102,7 +102,6 @@ pub(crate) unsafe fn init(config: Config) {
|
||||
|
||||
assert!(pclk2 <= 72_000_000);
|
||||
|
||||
// Only needed for stm32f103?
|
||||
FLASH.acr().write(|w| {
|
||||
w.set_latency(if real_sysclk <= 24_000_000 {
|
||||
Latency::WS0
|
||||
@@ -111,6 +110,8 @@ pub(crate) unsafe fn init(config: Config) {
|
||||
} else {
|
||||
Latency::WS2
|
||||
});
|
||||
// the prefetch buffer is enabled by default, let's keep it enabled
|
||||
w.set_prftbe(true);
|
||||
});
|
||||
|
||||
// the USB clock is only valid if an external crystal is used, the PLL is enabled, and the
|
||||
|
||||
@@ -31,7 +31,7 @@ pub enum PLLSource {
|
||||
impl From<PLLSource> for Pllsrc {
|
||||
fn from(val: PLLSource) -> Pllsrc {
|
||||
match val {
|
||||
PLLSource::HSI16 => Pllsrc::HSI16,
|
||||
PLLSource::HSI16 => Pllsrc::HSI,
|
||||
PLLSource::HSE(_) => Pllsrc::HSE,
|
||||
}
|
||||
}
|
||||
@@ -88,7 +88,7 @@ pub(crate) unsafe fn init(config: Config) {
|
||||
RCC.cr().write(|w| w.set_hsi16on(true));
|
||||
while !RCC.cr().read().hsi16rdy() {}
|
||||
|
||||
(HSI_FREQ, Sw::HSI16)
|
||||
(HSI_FREQ, Sw::HSI)
|
||||
}
|
||||
ClockSrc::HSE(freq) => {
|
||||
// Enable HSE
|
||||
|
||||
@@ -187,7 +187,10 @@ pub(crate) unsafe fn init(config: Config) {
|
||||
|
||||
let sys_clk = match config.mux {
|
||||
ClockSrc::HSE => hse.unwrap(),
|
||||
#[cfg(rcc_l5)]
|
||||
ClockSrc::HSI16 => hsi16.unwrap(),
|
||||
#[cfg(not(rcc_l5))]
|
||||
ClockSrc::HSI => hsi16.unwrap(),
|
||||
ClockSrc::MSI => msi.unwrap(),
|
||||
ClockSrc::PLL => pll._r.unwrap(),
|
||||
};
|
||||
@@ -200,7 +203,10 @@ pub(crate) unsafe fn init(config: Config) {
|
||||
Clk48Src::HSI48 => hsi48,
|
||||
Clk48Src::MSI => msi,
|
||||
Clk48Src::PLLSAI1_Q => pllsai1._q,
|
||||
#[cfg(rcc_l5)]
|
||||
Clk48Src::PLL_Q => pll._q,
|
||||
#[cfg(not(rcc_l5))]
|
||||
Clk48Src::PLL1_Q => pll._q,
|
||||
};
|
||||
|
||||
#[cfg(rcc_l4plus)]
|
||||
@@ -266,6 +272,22 @@ pub(crate) unsafe fn init(config: Config) {
|
||||
pclk2: apb2_freq,
|
||||
pclk1_tim: apb1_tim_freq,
|
||||
pclk2_tim: apb2_tim_freq,
|
||||
#[cfg(rcc_l4)]
|
||||
hsi: None,
|
||||
#[cfg(rcc_l4)]
|
||||
lse: None,
|
||||
#[cfg(rcc_l4)]
|
||||
pllsai1_p: None,
|
||||
#[cfg(rcc_l4)]
|
||||
pllsai2_p: None,
|
||||
#[cfg(rcc_l4)]
|
||||
pll1_p: None,
|
||||
#[cfg(rcc_l4)]
|
||||
pll1_q: None,
|
||||
#[cfg(rcc_l4)]
|
||||
sai1_extclk: None,
|
||||
#[cfg(rcc_l4)]
|
||||
sai2_extclk: None,
|
||||
rtc,
|
||||
});
|
||||
}
|
||||
@@ -341,7 +363,10 @@ fn init_pll(instance: PllInstance, config: Option<Pll>, input: &PllInput) -> Pll
|
||||
let pll_src = match pll.source {
|
||||
PLLSource::NONE => panic!("must not select PLL source as NONE"),
|
||||
PLLSource::HSE => input.hse,
|
||||
#[cfg(rcc_l5)]
|
||||
PLLSource::HSI16 => input.hsi16,
|
||||
#[cfg(not(rcc_l5))]
|
||||
PLLSource::HSI => input.hsi16,
|
||||
PLLSource::MSI => input.msi,
|
||||
};
|
||||
|
||||
|
||||
@@ -110,14 +110,18 @@ pub struct Clocks {
|
||||
#[cfg(all(rcc_f4, not(stm32f410)))]
|
||||
pub plli2s1_r: Option<Hertz>,
|
||||
|
||||
#[cfg(rcc_l4)]
|
||||
pub pllsai1_p: Option<Hertz>,
|
||||
#[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))]
|
||||
pub pllsai1_q: Option<Hertz>,
|
||||
#[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))]
|
||||
pub pllsai1_r: Option<Hertz>,
|
||||
#[cfg(rcc_l4)]
|
||||
pub pllsai2_p: Option<Hertz>,
|
||||
|
||||
#[cfg(stm32g4)]
|
||||
#[cfg(any(stm32g4, rcc_l4))]
|
||||
pub pll1_p: Option<Hertz>,
|
||||
#[cfg(any(stm32h5, stm32h7, rcc_f2, rcc_f4, rcc_f410, rcc_f7))]
|
||||
#[cfg(any(stm32h5, stm32h7, rcc_f2, rcc_f4, rcc_f410, rcc_f7, rcc_l4))]
|
||||
pub pll1_q: Option<Hertz>,
|
||||
#[cfg(any(stm32h5, stm32h7))]
|
||||
pub pll2_p: Option<Hertz>,
|
||||
@@ -154,7 +158,7 @@ pub struct Clocks {
|
||||
|
||||
pub rtc: Option<Hertz>,
|
||||
|
||||
#[cfg(any(stm32h5, stm32h7))]
|
||||
#[cfg(any(stm32h5, stm32h7, rcc_l4, rcc_c0))]
|
||||
pub hsi: Option<Hertz>,
|
||||
#[cfg(stm32h5)]
|
||||
pub hsi48: Option<Hertz>,
|
||||
@@ -163,7 +167,7 @@ pub struct Clocks {
|
||||
#[cfg(any(stm32h5, stm32h7))]
|
||||
pub csi: Option<Hertz>,
|
||||
|
||||
#[cfg(any(stm32h5, stm32h7))]
|
||||
#[cfg(any(stm32h5, stm32h7, rcc_l4, rcc_c0))]
|
||||
pub lse: Option<Hertz>,
|
||||
#[cfg(any(stm32h5, stm32h7))]
|
||||
pub hse: Option<Hertz>,
|
||||
@@ -175,6 +179,10 @@ pub struct Clocks {
|
||||
|
||||
#[cfg(stm32h7)]
|
||||
pub rcc_pclk_d3: Option<Hertz>,
|
||||
#[cfg(rcc_l4)]
|
||||
pub sai1_extclk: Option<Hertz>,
|
||||
#[cfg(rcc_l4)]
|
||||
pub sai2_extclk: Option<Hertz>,
|
||||
}
|
||||
|
||||
#[cfg(feature = "low-power")]
|
||||
|
||||
@@ -42,7 +42,7 @@ max-handler-count-8 = []
|
||||
embassy-futures = { version = "0.1.0", path = "../embassy-futures" }
|
||||
embassy-usb-driver = { version = "0.1.0", path = "../embassy-usb-driver" }
|
||||
embassy-sync = { version = "0.3.0", path = "../embassy-sync" }
|
||||
embassy-net-driver-channel = { version = "0.1.0", path = "../embassy-net-driver-channel" }
|
||||
embassy-net-driver-channel = { version = "0.2.0", path = "../embassy-net-driver-channel" }
|
||||
|
||||
defmt = { version = "0.3", optional = true }
|
||||
log = { version = "0.4.14", optional = true }
|
||||
|
||||
@@ -70,9 +70,11 @@ fn main() {
|
||||
|
||||
// envvars take priority.
|
||||
if !cfg.seen_env {
|
||||
if cfg.seen_feature {
|
||||
panic!("multiple values set for feature {}: {} and {}", name, cfg.value, value);
|
||||
}
|
||||
assert!(
|
||||
!cfg.seen_feature,
|
||||
"multiple values set for feature {}: {} and {}",
|
||||
name, cfg.value, value
|
||||
);
|
||||
|
||||
cfg.value = value;
|
||||
cfg.seen_feature = true;
|
||||
|
||||
@@ -1,17 +1,17 @@
|
||||
use heapless::Vec;
|
||||
|
||||
use crate::config::*;
|
||||
use crate::config::MAX_HANDLER_COUNT;
|
||||
use crate::descriptor::{BosWriter, DescriptorWriter};
|
||||
use crate::driver::{Driver, Endpoint, EndpointType};
|
||||
#[cfg(feature = "msos-descriptor")]
|
||||
use crate::msos::{DeviceLevelDescriptor, FunctionLevelDescriptor, MsOsDescriptorWriter};
|
||||
use crate::types::*;
|
||||
use crate::types::{InterfaceNumber, StringIndex};
|
||||
use crate::{Handler, Interface, UsbDevice, MAX_INTERFACE_COUNT, STRING_INDEX_CUSTOM_START};
|
||||
|
||||
#[derive(Debug, Copy, Clone)]
|
||||
#[cfg_attr(feature = "defmt", derive(defmt::Format))]
|
||||
#[non_exhaustive]
|
||||
/// Configuration used when creating [UsbDevice].
|
||||
/// Configuration used when creating [`UsbDevice`].
|
||||
pub struct Config<'a> {
|
||||
pub(crate) vendor_id: u16,
|
||||
pub(crate) product_id: u16,
|
||||
@@ -99,7 +99,7 @@ pub struct Config<'a> {
|
||||
|
||||
impl<'a> Config<'a> {
|
||||
/// Create default configuration with the provided vid and pid values.
|
||||
pub fn new(vid: u16, pid: u16) -> Self {
|
||||
pub const fn new(vid: u16, pid: u16) -> Self {
|
||||
Self {
|
||||
device_class: 0x00,
|
||||
device_sub_class: 0x00,
|
||||
@@ -159,9 +159,10 @@ impl<'d, D: Driver<'d>> Builder<'d, D> {
|
||||
panic!("if composite_with_iads is set, you must set device_class = 0xEF, device_sub_class = 0x02, device_protocol = 0x01");
|
||||
}
|
||||
|
||||
if config.max_power > 500 {
|
||||
panic!("The maximum allowed value for `max_power` is 500mA");
|
||||
}
|
||||
assert!(
|
||||
config.max_power <= 500,
|
||||
"The maximum allowed value for `max_power` is 500mA"
|
||||
);
|
||||
|
||||
match config.max_packet_size_0 {
|
||||
8 | 16 | 32 | 64 => {}
|
||||
@@ -260,12 +261,11 @@ impl<'d, D: Driver<'d>> Builder<'d, D> {
|
||||
/// The Handler is called on some USB bus events, and to handle all control requests not already
|
||||
/// handled by the USB stack.
|
||||
pub fn handler(&mut self, handler: &'d mut dyn Handler) {
|
||||
if self.handlers.push(handler).is_err() {
|
||||
panic!(
|
||||
assert!(
|
||||
self.handlers.push(handler).is_ok(),
|
||||
"embassy-usb: handler list full. Increase the `max_handler_count` compile-time setting. Current value: {}",
|
||||
MAX_HANDLER_COUNT
|
||||
)
|
||||
}
|
||||
);
|
||||
}
|
||||
|
||||
/// Allocates a new string index.
|
||||
@@ -332,12 +332,10 @@ impl<'a, 'd, D: Driver<'d>> FunctionBuilder<'a, 'd, D> {
|
||||
num_alt_settings: 0,
|
||||
};
|
||||
|
||||
if self.builder.interfaces.push(iface).is_err() {
|
||||
panic!(
|
||||
assert!(self.builder.interfaces.push(iface).is_ok(),
|
||||
"embassy-usb: interface list full. Increase the `max_interface_count` compile-time setting. Current value: {}",
|
||||
MAX_INTERFACE_COUNT
|
||||
)
|
||||
}
|
||||
);
|
||||
|
||||
InterfaceBuilder {
|
||||
builder: self.builder,
|
||||
@@ -371,7 +369,7 @@ pub struct InterfaceBuilder<'a, 'd, D: Driver<'d>> {
|
||||
|
||||
impl<'a, 'd, D: Driver<'d>> InterfaceBuilder<'a, 'd, D> {
|
||||
/// Get the interface number.
|
||||
pub fn interface_number(&self) -> InterfaceNumber {
|
||||
pub const fn interface_number(&self) -> InterfaceNumber {
|
||||
self.interface_number
|
||||
}
|
||||
|
||||
@@ -422,12 +420,12 @@ pub struct InterfaceAltBuilder<'a, 'd, D: Driver<'d>> {
|
||||
|
||||
impl<'a, 'd, D: Driver<'d>> InterfaceAltBuilder<'a, 'd, D> {
|
||||
/// Get the interface number.
|
||||
pub fn interface_number(&self) -> InterfaceNumber {
|
||||
pub const fn interface_number(&self) -> InterfaceNumber {
|
||||
self.interface_number
|
||||
}
|
||||
|
||||
/// Get the alternate setting number.
|
||||
pub fn alt_setting_number(&self) -> u8 {
|
||||
pub const fn alt_setting_number(&self) -> u8 {
|
||||
self.alt_setting_number
|
||||
}
|
||||
|
||||
@@ -436,7 +434,7 @@ impl<'a, 'd, D: Driver<'d>> InterfaceAltBuilder<'a, 'd, D> {
|
||||
/// Descriptors are written in the order builder functions are called. Note that some
|
||||
/// classes care about the order.
|
||||
pub fn descriptor(&mut self, descriptor_type: u8, descriptor: &[u8]) {
|
||||
self.builder.config_descriptor.write(descriptor_type, descriptor)
|
||||
self.builder.config_descriptor.write(descriptor_type, descriptor);
|
||||
}
|
||||
|
||||
fn endpoint_in(&mut self, ep_type: EndpointType, max_packet_size: u16, interval_ms: u8) -> D::EndpointIn {
|
||||
|
||||
@@ -11,7 +11,7 @@ use embassy_sync::waitqueue::WakerRegistration;
|
||||
|
||||
use crate::control::{self, InResponse, OutResponse, Recipient, Request, RequestType};
|
||||
use crate::driver::{Driver, Endpoint, EndpointError, EndpointIn, EndpointOut};
|
||||
use crate::types::*;
|
||||
use crate::types::InterfaceNumber;
|
||||
use crate::{Builder, Handler};
|
||||
|
||||
/// This should be used as `device_class` when building the `UsbDevice`.
|
||||
@@ -39,12 +39,18 @@ pub struct State<'a> {
|
||||
shared: ControlShared,
|
||||
}
|
||||
|
||||
impl<'a> Default for State<'a> {
|
||||
fn default() -> Self {
|
||||
Self::new()
|
||||
}
|
||||
}
|
||||
|
||||
impl<'a> State<'a> {
|
||||
/// Create a new `State`.
|
||||
pub fn new() -> Self {
|
||||
Self {
|
||||
control: MaybeUninit::uninit(),
|
||||
shared: Default::default(),
|
||||
shared: ControlShared::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -55,9 +61,9 @@ impl<'a> State<'a> {
|
||||
/// writing USB packets with no intermediate buffers, but it will not act like a stream-like serial
|
||||
/// port. The following constraints must be followed if you use this class directly:
|
||||
///
|
||||
/// - `read_packet` must be called with a buffer large enough to hold max_packet_size bytes.
|
||||
/// - `write_packet` must not be called with a buffer larger than max_packet_size bytes.
|
||||
/// - If you write a packet that is exactly max_packet_size bytes long, it won't be processed by the
|
||||
/// - `read_packet` must be called with a buffer large enough to hold `max_packet_size` bytes.
|
||||
/// - `write_packet` must not be called with a buffer larger than `max_packet_size` bytes.
|
||||
/// - If you write a packet that is exactly `max_packet_size` bytes long, it won't be processed by the
|
||||
/// host operating system until a subsequent shorter packet is sent. A zero-length packet (ZLP)
|
||||
/// can be sent if there is no other data to send. This is because USB bulk transactions must be
|
||||
/// terminated with a short packet, even if the bulk endpoint is used for stream-like data.
|
||||
@@ -103,17 +109,16 @@ impl Default for ControlShared {
|
||||
|
||||
impl ControlShared {
|
||||
async fn changed(&self) {
|
||||
poll_fn(|cx| match self.changed.load(Ordering::Relaxed) {
|
||||
true => {
|
||||
poll_fn(|cx| {
|
||||
if self.changed.load(Ordering::Relaxed) {
|
||||
self.changed.store(false, Ordering::Relaxed);
|
||||
Poll::Ready(())
|
||||
}
|
||||
false => {
|
||||
} else {
|
||||
self.waker.borrow_mut().register(cx.waker());
|
||||
Poll::Pending
|
||||
}
|
||||
})
|
||||
.await
|
||||
.await;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -192,7 +197,7 @@ impl<'d> Handler for Control<'d> {
|
||||
// REQ_GET_ENCAPSULATED_COMMAND is not really supported - it will be rejected below.
|
||||
REQ_GET_LINE_CODING if req.length == 7 => {
|
||||
debug!("Sending line coding");
|
||||
let coding = self.shared().line_coding.lock(|x| x.get());
|
||||
let coding = self.shared().line_coding.lock(Cell::get);
|
||||
assert!(buf.len() >= 7);
|
||||
buf[0..4].copy_from_slice(&coding.data_rate.to_le_bytes());
|
||||
buf[4] = coding.stop_bits as u8;
|
||||
@@ -206,8 +211,8 @@ impl<'d> Handler for Control<'d> {
|
||||
}
|
||||
|
||||
impl<'d, D: Driver<'d>> CdcAcmClass<'d, D> {
|
||||
/// Creates a new CdcAcmClass with the provided UsbBus and max_packet_size in bytes. For
|
||||
/// full-speed devices, max_packet_size has to be one of 8, 16, 32 or 64.
|
||||
/// Creates a new CdcAcmClass with the provided UsbBus and `max_packet_size` in bytes. For
|
||||
/// full-speed devices, `max_packet_size` has to be one of 8, 16, 32 or 64.
|
||||
pub fn new(builder: &mut Builder<'d, D>, state: &'d mut State<'d>, max_packet_size: u16) -> Self {
|
||||
assert!(builder.control_buf_len() >= 7);
|
||||
|
||||
@@ -242,7 +247,7 @@ impl<'d, D: Driver<'d>> CdcAcmClass<'d, D> {
|
||||
&[
|
||||
CDC_TYPE_UNION, // bDescriptorSubtype
|
||||
comm_if.into(), // bControlInterface
|
||||
data_if.into(), // bSubordinateInterface
|
||||
data_if, // bSubordinateInterface
|
||||
],
|
||||
);
|
||||
|
||||
@@ -283,7 +288,7 @@ impl<'d, D: Driver<'d>> CdcAcmClass<'d, D> {
|
||||
/// Gets the current line coding. The line coding contains information that's mainly relevant
|
||||
/// for USB to UART serial port emulators, and can be ignored if not relevant.
|
||||
pub fn line_coding(&self) -> LineCoding {
|
||||
self.control.line_coding.lock(|x| x.get())
|
||||
self.control.line_coding.lock(Cell::get)
|
||||
}
|
||||
|
||||
/// Gets the DTR (data terminal ready) state
|
||||
@@ -308,7 +313,7 @@ impl<'d, D: Driver<'d>> CdcAcmClass<'d, D> {
|
||||
|
||||
/// Waits for the USB host to enable this interface
|
||||
pub async fn wait_connection(&mut self) {
|
||||
self.read_ep.wait_enabled().await
|
||||
self.read_ep.wait_enabled().await;
|
||||
}
|
||||
|
||||
/// Split the class into a sender and receiver.
|
||||
@@ -356,7 +361,7 @@ pub struct ControlChanged<'d> {
|
||||
impl<'d> ControlChanged<'d> {
|
||||
/// Return a future for when the control settings change
|
||||
pub async fn control_changed(&self) {
|
||||
self.control.changed().await
|
||||
self.control.changed().await;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -378,7 +383,7 @@ impl<'d, D: Driver<'d>> Sender<'d, D> {
|
||||
/// Gets the current line coding. The line coding contains information that's mainly relevant
|
||||
/// for USB to UART serial port emulators, and can be ignored if not relevant.
|
||||
pub fn line_coding(&self) -> LineCoding {
|
||||
self.control.line_coding.lock(|x| x.get())
|
||||
self.control.line_coding.lock(Cell::get)
|
||||
}
|
||||
|
||||
/// Gets the DTR (data terminal ready) state
|
||||
@@ -398,7 +403,7 @@ impl<'d, D: Driver<'d>> Sender<'d, D> {
|
||||
|
||||
/// Waits for the USB host to enable this interface
|
||||
pub async fn wait_connection(&mut self) {
|
||||
self.write_ep.wait_enabled().await
|
||||
self.write_ep.wait_enabled().await;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -420,7 +425,7 @@ impl<'d, D: Driver<'d>> Receiver<'d, D> {
|
||||
/// Gets the current line coding. The line coding contains information that's mainly relevant
|
||||
/// for USB to UART serial port emulators, and can be ignored if not relevant.
|
||||
pub fn line_coding(&self) -> LineCoding {
|
||||
self.control.line_coding.lock(|x| x.get())
|
||||
self.control.line_coding.lock(Cell::get)
|
||||
}
|
||||
|
||||
/// Gets the DTR (data terminal ready) state
|
||||
@@ -440,7 +445,7 @@ impl<'d, D: Driver<'d>> Receiver<'d, D> {
|
||||
|
||||
/// Waits for the USB host to enable this interface
|
||||
pub async fn wait_connection(&mut self) {
|
||||
self.read_ep.wait_enabled().await
|
||||
self.read_ep.wait_enabled().await;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -514,17 +519,17 @@ impl LineCoding {
|
||||
}
|
||||
|
||||
/// Gets the number of data bits for UART communication.
|
||||
pub fn data_bits(&self) -> u8 {
|
||||
pub const fn data_bits(&self) -> u8 {
|
||||
self.data_bits
|
||||
}
|
||||
|
||||
/// Gets the parity type for UART communication.
|
||||
pub fn parity_type(&self) -> ParityType {
|
||||
pub const fn parity_type(&self) -> ParityType {
|
||||
self.parity_type
|
||||
}
|
||||
|
||||
/// Gets the data rate in bits per second for UART communication.
|
||||
pub fn data_rate(&self) -> u32 {
|
||||
pub const fn data_rate(&self) -> u32 {
|
||||
self.data_rate
|
||||
}
|
||||
}
|
||||
|
||||
@@ -16,10 +16,11 @@
|
||||
|
||||
use core::intrinsics::copy_nonoverlapping;
|
||||
use core::mem::{size_of, MaybeUninit};
|
||||
use core::ptr::addr_of;
|
||||
|
||||
use crate::control::{self, InResponse, OutResponse, Recipient, Request, RequestType};
|
||||
use crate::driver::{Driver, Endpoint, EndpointError, EndpointIn, EndpointOut};
|
||||
use crate::types::*;
|
||||
use crate::types::{InterfaceNumber, StringIndex};
|
||||
use crate::{Builder, Handler};
|
||||
|
||||
pub mod embassy_net;
|
||||
@@ -62,9 +63,9 @@ const REQ_SET_NTB_INPUT_SIZE: u8 = 0x86;
|
||||
//const NOTIF_POLL_INTERVAL: u8 = 20;
|
||||
|
||||
const NTB_MAX_SIZE: usize = 2048;
|
||||
const SIG_NTH: u32 = 0x484d434e;
|
||||
const SIG_NDP_NO_FCS: u32 = 0x304d434e;
|
||||
const SIG_NDP_WITH_FCS: u32 = 0x314d434e;
|
||||
const SIG_NTH: u32 = 0x484d_434e;
|
||||
const SIG_NDP_NO_FCS: u32 = 0x304d_434e;
|
||||
const SIG_NDP_WITH_FCS: u32 = 0x314d_434e;
|
||||
|
||||
const ALTERNATE_SETTING_DISABLED: u8 = 0x00;
|
||||
const ALTERNATE_SETTING_ENABLED: u8 = 0x01;
|
||||
@@ -111,7 +112,7 @@ struct NtbParametersDir {
|
||||
|
||||
fn byteify<T>(buf: &mut [u8], data: T) -> &[u8] {
|
||||
let len = size_of::<T>();
|
||||
unsafe { copy_nonoverlapping(&data as *const _ as *const u8, buf.as_mut_ptr(), len) }
|
||||
unsafe { copy_nonoverlapping(addr_of!(data).cast(), buf.as_mut_ptr(), len) }
|
||||
&buf[..len]
|
||||
}
|
||||
|
||||
@@ -121,27 +122,28 @@ pub struct State<'a> {
|
||||
shared: ControlShared,
|
||||
}
|
||||
|
||||
impl<'a> Default for State<'a> {
|
||||
fn default() -> Self {
|
||||
Self::new()
|
||||
}
|
||||
}
|
||||
|
||||
impl<'a> State<'a> {
|
||||
/// Create a new `State`.
|
||||
pub fn new() -> Self {
|
||||
Self {
|
||||
control: MaybeUninit::uninit(),
|
||||
shared: Default::default(),
|
||||
shared: ControlShared::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Shared data between Control and CdcAcmClass
|
||||
/// Shared data between Control and `CdcAcmClass`
|
||||
#[derive(Default)]
|
||||
struct ControlShared {
|
||||
mac_addr: [u8; 6],
|
||||
}
|
||||
|
||||
impl Default for ControlShared {
|
||||
fn default() -> Self {
|
||||
ControlShared { mac_addr: [0; 6] }
|
||||
}
|
||||
}
|
||||
|
||||
struct Control<'a> {
|
||||
mac_addr_string: StringIndex,
|
||||
shared: &'a ControlShared,
|
||||
@@ -377,12 +379,12 @@ impl<'d, D: Driver<'d>> Sender<'d, D> {
|
||||
///
|
||||
/// This waits until the packet is successfully stored in the CDC-NCM endpoint buffers.
|
||||
pub async fn write_packet(&mut self, data: &[u8]) -> Result<(), EndpointError> {
|
||||
let seq = self.seq;
|
||||
self.seq = self.seq.wrapping_add(1);
|
||||
|
||||
const OUT_HEADER_LEN: usize = 28;
|
||||
const ABS_MAX_PACKET_SIZE: usize = 512;
|
||||
|
||||
let seq = self.seq;
|
||||
self.seq = self.seq.wrapping_add(1);
|
||||
|
||||
let header = NtbOutHeader {
|
||||
nth_sig: SIG_NTH,
|
||||
nth_len: 0x0c,
|
||||
@@ -416,7 +418,7 @@ impl<'d, D: Driver<'d>> Sender<'d, D> {
|
||||
self.write_ep.write(&buf[..self.max_packet_size]).await?;
|
||||
|
||||
for chunk in d2.chunks(self.max_packet_size) {
|
||||
self.write_ep.write(&chunk).await?;
|
||||
self.write_ep.write(chunk).await?;
|
||||
}
|
||||
|
||||
// Send ZLP if needed.
|
||||
@@ -459,12 +461,9 @@ impl<'d, D: Driver<'d>> Receiver<'d, D> {
|
||||
let ntb = &ntb[..pos];
|
||||
|
||||
// Process NTB header (NTH)
|
||||
let nth = match ntb.get(..12) {
|
||||
Some(x) => x,
|
||||
None => {
|
||||
let Some(nth) = ntb.get(..12) else {
|
||||
warn!("Received too short NTB");
|
||||
continue;
|
||||
}
|
||||
};
|
||||
let sig = u32::from_le_bytes(nth[0..4].try_into().unwrap());
|
||||
if sig != SIG_NTH {
|
||||
@@ -474,12 +473,9 @@ impl<'d, D: Driver<'d>> Receiver<'d, D> {
|
||||
let ndp_idx = u16::from_le_bytes(nth[10..12].try_into().unwrap()) as usize;
|
||||
|
||||
// Process NTB Datagram Pointer (NDP)
|
||||
let ndp = match ntb.get(ndp_idx..ndp_idx + 12) {
|
||||
Some(x) => x,
|
||||
None => {
|
||||
let Some(ndp) = ntb.get(ndp_idx..ndp_idx + 12) else {
|
||||
warn!("NTH has an NDP pointer out of range.");
|
||||
continue;
|
||||
}
|
||||
};
|
||||
let sig = u32::from_le_bytes(ndp[0..4].try_into().unwrap());
|
||||
if sig != SIG_NDP_NO_FCS && sig != SIG_NDP_WITH_FCS {
|
||||
@@ -495,12 +491,9 @@ impl<'d, D: Driver<'d>> Receiver<'d, D> {
|
||||
}
|
||||
|
||||
// Process actual datagram, finally.
|
||||
let datagram = match ntb.get(datagram_index..datagram_index + datagram_len) {
|
||||
Some(x) => x,
|
||||
None => {
|
||||
let Some(datagram) = ntb.get(datagram_index..datagram_index + datagram_len) else {
|
||||
warn!("NDP has a datagram pointer out of range.");
|
||||
continue;
|
||||
}
|
||||
};
|
||||
buf[..datagram_len].copy_from_slice(datagram);
|
||||
|
||||
|
||||
@@ -63,7 +63,7 @@ pub enum ReportId {
|
||||
}
|
||||
|
||||
impl ReportId {
|
||||
fn try_from(value: u16) -> Result<Self, ()> {
|
||||
const fn try_from(value: u16) -> Result<Self, ()> {
|
||||
match value >> 8 {
|
||||
1 => Ok(ReportId::In(value as u8)),
|
||||
2 => Ok(ReportId::Out(value as u8)),
|
||||
@@ -79,9 +79,15 @@ pub struct State<'d> {
|
||||
out_report_offset: AtomicUsize,
|
||||
}
|
||||
|
||||
impl<'d> Default for State<'d> {
|
||||
fn default() -> Self {
|
||||
Self::new()
|
||||
}
|
||||
}
|
||||
|
||||
impl<'d> State<'d> {
|
||||
/// Create a new `State`.
|
||||
pub fn new() -> Self {
|
||||
pub const fn new() -> Self {
|
||||
State {
|
||||
control: MaybeUninit::uninit(),
|
||||
out_report_offset: AtomicUsize::new(0),
|
||||
@@ -148,7 +154,7 @@ fn build<'d, D: Driver<'d>>(
|
||||
}
|
||||
|
||||
impl<'d, D: Driver<'d>, const READ_N: usize, const WRITE_N: usize> HidReaderWriter<'d, D, READ_N, WRITE_N> {
|
||||
/// Creates a new HidReaderWriter.
|
||||
/// Creates a new `HidReaderWriter`.
|
||||
///
|
||||
/// This will allocate one IN and one OUT endpoints. If you only need writing (sending)
|
||||
/// HID reports, consider using [`HidWriter::new`] instead, which allocates an IN endpoint only.
|
||||
@@ -171,7 +177,7 @@ impl<'d, D: Driver<'d>, const READ_N: usize, const WRITE_N: usize> HidReaderWrit
|
||||
}
|
||||
|
||||
/// Waits for both IN and OUT endpoints to be enabled.
|
||||
pub async fn ready(&mut self) -> () {
|
||||
pub async fn ready(&mut self) {
|
||||
self.reader.ready().await;
|
||||
self.writer.ready().await;
|
||||
}
|
||||
@@ -224,7 +230,7 @@ pub enum ReadError {
|
||||
|
||||
impl From<EndpointError> for ReadError {
|
||||
fn from(val: EndpointError) -> Self {
|
||||
use EndpointError::*;
|
||||
use EndpointError::{BufferOverflow, Disabled};
|
||||
match val {
|
||||
BufferOverflow => ReadError::BufferOverflow,
|
||||
Disabled => ReadError::Disabled,
|
||||
@@ -251,17 +257,16 @@ impl<'d, D: Driver<'d>, const N: usize> HidWriter<'d, D, N> {
|
||||
}
|
||||
|
||||
/// Waits for the interrupt in endpoint to be enabled.
|
||||
pub async fn ready(&mut self) -> () {
|
||||
self.ep_in.wait_enabled().await
|
||||
pub async fn ready(&mut self) {
|
||||
self.ep_in.wait_enabled().await;
|
||||
}
|
||||
|
||||
/// Writes an input report by serializing the given report structure.
|
||||
#[cfg(feature = "usbd-hid")]
|
||||
pub async fn write_serialize<IR: AsInputReport>(&mut self, r: &IR) -> Result<(), EndpointError> {
|
||||
let mut buf: [u8; N] = [0; N];
|
||||
let size = match serialize(&mut buf, r) {
|
||||
Ok(size) => size,
|
||||
Err(_) => return Err(EndpointError::BufferOverflow),
|
||||
let Ok(size) = serialize(&mut buf, r) else {
|
||||
return Err(EndpointError::BufferOverflow);
|
||||
};
|
||||
self.write(&buf[0..size]).await
|
||||
}
|
||||
@@ -286,8 +291,8 @@ impl<'d, D: Driver<'d>, const N: usize> HidWriter<'d, D, N> {
|
||||
|
||||
impl<'d, D: Driver<'d>, const N: usize> HidReader<'d, D, N> {
|
||||
/// Waits for the interrupt out endpoint to be enabled.
|
||||
pub async fn ready(&mut self) -> () {
|
||||
self.ep_out.wait_enabled().await
|
||||
pub async fn ready(&mut self) {
|
||||
self.ep_out.wait_enabled().await;
|
||||
}
|
||||
|
||||
/// Delivers output reports from the Interrupt Out pipe to `handler`.
|
||||
@@ -344,9 +349,8 @@ impl<'d, D: Driver<'d>, const N: usize> HidReader<'d, D, N> {
|
||||
if size < max_packet_size || total == N {
|
||||
self.offset.store(0, Ordering::Release);
|
||||
break;
|
||||
} else {
|
||||
self.offset.store(total, Ordering::Release);
|
||||
}
|
||||
self.offset.store(total, Ordering::Release);
|
||||
}
|
||||
Err(err) => {
|
||||
self.offset.store(0, Ordering::Release);
|
||||
@@ -466,7 +470,7 @@ impl<'d> Handler for Control<'d> {
|
||||
HID_REQ_SET_IDLE => {
|
||||
if let Some(handler) = self.request_handler {
|
||||
let id = req.value as u8;
|
||||
let id = (id != 0).then(|| ReportId::In(id));
|
||||
let id = (id != 0).then_some(ReportId::In(id));
|
||||
let dur = u32::from(req.value >> 8);
|
||||
let dur = if dur == 0 { u32::MAX } else { 4 * dur };
|
||||
handler.set_idle_ms(id, dur);
|
||||
@@ -522,7 +526,7 @@ impl<'d> Handler for Control<'d> {
|
||||
HID_REQ_GET_IDLE => {
|
||||
if let Some(handler) = self.request_handler {
|
||||
let id = req.value as u8;
|
||||
let id = (id != 0).then(|| ReportId::In(id));
|
||||
let id = (id != 0).then_some(ReportId::In(id));
|
||||
if let Some(dur) = handler.get_idle_ms(id) {
|
||||
let dur = u8::try_from(dur / 4).unwrap_or(0);
|
||||
buf[0] = dur;
|
||||
|
||||
@@ -27,9 +27,9 @@ const MIDI_OUT_SIZE: u8 = 0x09;
|
||||
/// writing USB packets with no intermediate buffers, but it will not act like a stream-like port.
|
||||
/// The following constraints must be followed if you use this class directly:
|
||||
///
|
||||
/// - `read_packet` must be called with a buffer large enough to hold max_packet_size bytes.
|
||||
/// - `write_packet` must not be called with a buffer larger than max_packet_size bytes.
|
||||
/// - If you write a packet that is exactly max_packet_size bytes long, it won't be processed by the
|
||||
/// - `read_packet` must be called with a buffer large enough to hold `max_packet_size` bytes.
|
||||
/// - `write_packet` must not be called with a buffer larger than `max_packet_size` bytes.
|
||||
/// - If you write a packet that is exactly `max_packet_size` bytes long, it won't be processed by the
|
||||
/// host operating system until a subsequent shorter packet is sent. A zero-length packet (ZLP)
|
||||
/// can be sent if there is no other data to send. This is because USB bulk transactions must be
|
||||
/// terminated with a short packet, even if the bulk endpoint is used for stream-like data.
|
||||
@@ -39,8 +39,8 @@ pub struct MidiClass<'d, D: Driver<'d>> {
|
||||
}
|
||||
|
||||
impl<'d, D: Driver<'d>> MidiClass<'d, D> {
|
||||
/// Creates a new MidiClass with the provided UsbBus, number of input and output jacks and max_packet_size in bytes.
|
||||
/// For full-speed devices, max_packet_size has to be one of 8, 16, 32 or 64.
|
||||
/// Creates a new `MidiClass` with the provided UsbBus, number of input and output jacks and `max_packet_size` in bytes.
|
||||
/// For full-speed devices, `max_packet_size` has to be one of 8, 16, 32 or 64.
|
||||
pub fn new(builder: &mut Builder<'d, D>, n_in_jacks: u8, n_out_jacks: u8, max_packet_size: u16) -> Self {
|
||||
let mut func = builder.function(USB_AUDIO_CLASS, USB_AUDIOCONTROL_SUBCLASS, PROTOCOL_NONE);
|
||||
|
||||
@@ -160,7 +160,7 @@ impl<'d, D: Driver<'d>> MidiClass<'d, D> {
|
||||
|
||||
/// Waits for the USB host to enable this interface
|
||||
pub async fn wait_connection(&mut self) {
|
||||
self.read_ep.wait_enabled().await
|
||||
self.read_ep.wait_enabled().await;
|
||||
}
|
||||
|
||||
/// Split the class into a sender and receiver.
|
||||
@@ -197,7 +197,7 @@ impl<'d, D: Driver<'d>> Sender<'d, D> {
|
||||
|
||||
/// Waits for the USB host to enable this interface
|
||||
pub async fn wait_connection(&mut self) {
|
||||
self.write_ep.wait_enabled().await
|
||||
self.write_ep.wait_enabled().await;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -222,6 +222,6 @@ impl<'d, D: Driver<'d>> Receiver<'d, D> {
|
||||
|
||||
/// Waits for the USB host to enable this interface
|
||||
pub async fn wait_connection(&mut self) {
|
||||
self.read_ep.wait_enabled().await
|
||||
self.read_ep.wait_enabled().await;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -120,7 +120,7 @@ impl Request {
|
||||
}
|
||||
|
||||
/// Gets the descriptor type and index from the value field of a GET_DESCRIPTOR request.
|
||||
pub fn descriptor_type_index(&self) -> (u8, u8) {
|
||||
pub const fn descriptor_type_index(&self) -> (u8, u8) {
|
||||
((self.value >> 8) as u8, self.value as u8)
|
||||
}
|
||||
}
|
||||
|
||||
@@ -2,7 +2,7 @@
|
||||
|
||||
use crate::builder::Config;
|
||||
use crate::driver::EndpointInfo;
|
||||
use crate::types::*;
|
||||
use crate::types::{InterfaceNumber, StringIndex};
|
||||
use crate::CONFIGURATION_VALUE;
|
||||
|
||||
/// Standard descriptor types
|
||||
@@ -59,7 +59,7 @@ impl<'a> DescriptorWriter<'a> {
|
||||
}
|
||||
|
||||
/// Gets the current position in the buffer, i.e. the number of bytes written so far.
|
||||
pub fn position(&self) -> usize {
|
||||
pub const fn position(&self) -> usize {
|
||||
self.position
|
||||
}
|
||||
|
||||
@@ -67,9 +67,10 @@ impl<'a> DescriptorWriter<'a> {
|
||||
pub fn write(&mut self, descriptor_type: u8, descriptor: &[u8]) {
|
||||
let length = descriptor.len();
|
||||
|
||||
if (self.position + 2 + length) > self.buf.len() || (length + 2) > 255 {
|
||||
panic!("Descriptor buffer full");
|
||||
}
|
||||
assert!(
|
||||
(self.position + 2 + length) <= self.buf.len() && (length + 2) <= 255,
|
||||
"Descriptor buffer full"
|
||||
);
|
||||
|
||||
self.buf[self.position] = (length + 2) as u8;
|
||||
self.buf[self.position + 1] = descriptor_type;
|
||||
@@ -102,7 +103,7 @@ impl<'a> DescriptorWriter<'a> {
|
||||
config.serial_number.map_or(0, |_| 3), // iSerialNumber
|
||||
1, // bNumConfigurations
|
||||
],
|
||||
)
|
||||
);
|
||||
}
|
||||
|
||||
pub(crate) fn configuration(&mut self, config: &Config) {
|
||||
@@ -120,7 +121,7 @@ impl<'a> DescriptorWriter<'a> {
|
||||
| if config.supports_remote_wakeup { 0x20 } else { 0x00 }, // bmAttributes
|
||||
(config.max_power / 2) as u8, // bMaxPower
|
||||
],
|
||||
)
|
||||
);
|
||||
}
|
||||
|
||||
#[allow(unused)]
|
||||
@@ -248,9 +249,7 @@ impl<'a> DescriptorWriter<'a> {
|
||||
pub(crate) fn string(&mut self, string: &str) {
|
||||
let mut pos = self.position;
|
||||
|
||||
if pos + 2 > self.buf.len() {
|
||||
panic!("Descriptor buffer full");
|
||||
}
|
||||
assert!(pos + 2 <= self.buf.len(), "Descriptor buffer full");
|
||||
|
||||
self.buf[pos] = 0; // length placeholder
|
||||
self.buf[pos + 1] = descriptor_type::STRING;
|
||||
@@ -258,9 +257,7 @@ impl<'a> DescriptorWriter<'a> {
|
||||
pos += 2;
|
||||
|
||||
for c in string.encode_utf16() {
|
||||
if pos >= self.buf.len() {
|
||||
panic!("Descriptor buffer full");
|
||||
}
|
||||
assert!(pos < self.buf.len(), "Descriptor buffer full");
|
||||
|
||||
self.buf[pos..pos + 2].copy_from_slice(&c.to_le_bytes());
|
||||
pos += 2;
|
||||
@@ -279,9 +276,9 @@ pub struct BosWriter<'a> {
|
||||
}
|
||||
|
||||
impl<'a> BosWriter<'a> {
|
||||
pub(crate) fn new(writer: DescriptorWriter<'a>) -> Self {
|
||||
pub(crate) const fn new(writer: DescriptorWriter<'a>) -> Self {
|
||||
Self {
|
||||
writer: writer,
|
||||
writer,
|
||||
num_caps_mark: None,
|
||||
}
|
||||
}
|
||||
@@ -314,9 +311,10 @@ impl<'a> BosWriter<'a> {
|
||||
let mut start = self.writer.position;
|
||||
let blen = data.len();
|
||||
|
||||
if (start + blen + 3) > self.writer.buf.len() || (blen + 3) > 255 {
|
||||
panic!("Descriptor buffer full");
|
||||
}
|
||||
assert!(
|
||||
(start + blen + 3) <= self.writer.buf.len() && (blen + 3) <= 255,
|
||||
"Descriptor buffer full"
|
||||
);
|
||||
|
||||
self.writer.buf[start] = (blen + 3) as u8;
|
||||
self.writer.buf[start + 1] = descriptor_type::CAPABILITY;
|
||||
|
||||
@@ -11,11 +11,11 @@ pub struct Reader<'a> {
|
||||
}
|
||||
|
||||
impl<'a> Reader<'a> {
|
||||
pub fn new(data: &'a [u8]) -> Self {
|
||||
pub const fn new(data: &'a [u8]) -> Self {
|
||||
Self { data }
|
||||
}
|
||||
|
||||
pub fn eof(&self) -> bool {
|
||||
pub const fn eof(&self) -> bool {
|
||||
self.data.is_empty()
|
||||
}
|
||||
|
||||
@@ -102,7 +102,7 @@ pub fn foreach_endpoint(data: &[u8], mut f: impl FnMut(EndpointInfo)) -> Result<
|
||||
}
|
||||
descriptor_type::ENDPOINT => {
|
||||
ep.ep_address = EndpointAddress::from(r.read_u8()?);
|
||||
f(ep)
|
||||
f(ep);
|
||||
}
|
||||
_ => {}
|
||||
}
|
||||
|
||||
@@ -24,12 +24,12 @@ use embassy_futures::select::{select, Either};
|
||||
use heapless::Vec;
|
||||
|
||||
pub use crate::builder::{Builder, Config, FunctionBuilder, InterfaceAltBuilder, InterfaceBuilder};
|
||||
use crate::config::*;
|
||||
use crate::control::*;
|
||||
use crate::descriptor::*;
|
||||
use crate::config::{MAX_HANDLER_COUNT, MAX_INTERFACE_COUNT};
|
||||
use crate::control::{InResponse, OutResponse, Recipient, Request, RequestType};
|
||||
use crate::descriptor::{descriptor_type, lang_id};
|
||||
use crate::descriptor_reader::foreach_endpoint;
|
||||
use crate::driver::{Bus, ControlPipe, Direction, Driver, EndpointAddress, Event};
|
||||
use crate::types::*;
|
||||
use crate::types::{InterfaceNumber, StringIndex};
|
||||
|
||||
/// The global state of the USB device.
|
||||
///
|
||||
@@ -294,7 +294,7 @@ impl<'d, D: Driver<'d>> UsbDevice<'d, D> {
|
||||
/// After dropping the future, [`UsbDevice::disable()`] should be called
|
||||
/// before calling any other `UsbDevice` methods to fully reset the
|
||||
/// peripheral.
|
||||
pub async fn run_until_suspend(&mut self) -> () {
|
||||
pub async fn run_until_suspend(&mut self) {
|
||||
while !self.inner.suspended {
|
||||
let control_fut = self.control.setup();
|
||||
let bus_fut = self.inner.bus.poll();
|
||||
@@ -364,6 +364,8 @@ impl<'d, D: Driver<'d>> UsbDevice<'d, D> {
|
||||
}
|
||||
|
||||
async fn handle_control_in(&mut self, req: Request) {
|
||||
const DEVICE_DESCRIPTOR_LEN: usize = 18;
|
||||
|
||||
let mut resp_length = req.length as usize;
|
||||
let max_packet_size = self.control.max_packet_size();
|
||||
|
||||
@@ -371,19 +373,15 @@ impl<'d, D: Driver<'d>> UsbDevice<'d, D> {
|
||||
// The host doesn't know our EP0 max packet size yet, and might assume
|
||||
// a full-length packet is a short packet, thinking we're done sending data.
|
||||
// See https://github.com/hathach/tinyusb/issues/184
|
||||
const DEVICE_DESCRIPTOR_LEN: usize = 18;
|
||||
if self.inner.address == 0
|
||||
&& max_packet_size < DEVICE_DESCRIPTOR_LEN
|
||||
&& (max_packet_size as usize) < resp_length
|
||||
{
|
||||
if self.inner.address == 0 && max_packet_size < DEVICE_DESCRIPTOR_LEN && max_packet_size < resp_length {
|
||||
trace!("received control req while not addressed: capping response to 1 packet.");
|
||||
resp_length = max_packet_size;
|
||||
}
|
||||
|
||||
match self.inner.handle_control_in(req, &mut self.control_buf) {
|
||||
match self.inner.handle_control_in(req, self.control_buf) {
|
||||
InResponse::Accepted(data) => {
|
||||
let len = data.len().min(resp_length);
|
||||
let need_zlp = len != resp_length && (len % usize::from(max_packet_size)) == 0;
|
||||
let need_zlp = len != resp_length && (len % max_packet_size) == 0;
|
||||
|
||||
let chunks = data[0..len]
|
||||
.chunks(max_packet_size)
|
||||
@@ -435,7 +433,7 @@ impl<'d, D: Driver<'d>> UsbDevice<'d, D> {
|
||||
self.control.accept_set_address(self.inner.address).await;
|
||||
self.inner.set_address_pending = false;
|
||||
} else {
|
||||
self.control.accept().await
|
||||
self.control.accept().await;
|
||||
}
|
||||
}
|
||||
OutResponse::Rejected => self.control.reject().await,
|
||||
@@ -548,9 +546,8 @@ impl<'d, D: Driver<'d>> Inner<'d, D> {
|
||||
|
||||
OutResponse::Accepted
|
||||
}
|
||||
(Request::SET_CONFIGURATION, CONFIGURATION_NONE_U16) => match self.device_state {
|
||||
UsbDeviceState::Default => OutResponse::Accepted,
|
||||
_ => {
|
||||
(Request::SET_CONFIGURATION, CONFIGURATION_NONE_U16) => {
|
||||
if self.device_state != UsbDeviceState::Default {
|
||||
debug!("SET_CONFIGURATION: unconfigured");
|
||||
self.device_state = UsbDeviceState::Addressed;
|
||||
|
||||
@@ -564,17 +561,15 @@ impl<'d, D: Driver<'d>> Inner<'d, D> {
|
||||
for h in &mut self.handlers {
|
||||
h.configured(false);
|
||||
}
|
||||
|
||||
}
|
||||
OutResponse::Accepted
|
||||
}
|
||||
},
|
||||
_ => OutResponse::Rejected,
|
||||
},
|
||||
(RequestType::Standard, Recipient::Interface) => {
|
||||
let iface_num = InterfaceNumber::new(req.index as _);
|
||||
let iface = match self.interfaces.get_mut(iface_num.0 as usize) {
|
||||
Some(iface) => iface,
|
||||
None => return OutResponse::Rejected,
|
||||
let Some(iface) = self.interfaces.get_mut(iface_num.0 as usize) else {
|
||||
return OutResponse::Rejected;
|
||||
};
|
||||
|
||||
match req.request {
|
||||
@@ -650,9 +645,8 @@ impl<'d, D: Driver<'d>> Inner<'d, D> {
|
||||
_ => InResponse::Rejected,
|
||||
},
|
||||
(RequestType::Standard, Recipient::Interface) => {
|
||||
let iface = match self.interfaces.get_mut(req.index as usize) {
|
||||
Some(iface) => iface,
|
||||
None => return InResponse::Rejected,
|
||||
let Some(iface) = self.interfaces.get_mut(req.index as usize) else {
|
||||
return InResponse::Rejected;
|
||||
};
|
||||
|
||||
match req.request {
|
||||
@@ -706,7 +700,7 @@ impl<'d, D: Driver<'d>> Inner<'d, D> {
|
||||
}
|
||||
|
||||
fn handle_control_in_delegated<'a>(&'a mut self, req: Request, buf: &'a mut [u8]) -> InResponse<'a> {
|
||||
unsafe fn extend_lifetime<'x, 'y>(r: InResponse<'x>) -> InResponse<'y> {
|
||||
unsafe fn extend_lifetime<'y>(r: InResponse<'_>) -> InResponse<'y> {
|
||||
core::mem::transmute(r)
|
||||
}
|
||||
|
||||
@@ -756,16 +750,12 @@ impl<'d, D: Driver<'d>> Inner<'d, D> {
|
||||
};
|
||||
|
||||
if let Some(s) = s {
|
||||
if buf.len() < 2 {
|
||||
panic!("control buffer too small");
|
||||
}
|
||||
assert!(buf.len() >= 2, "control buffer too small");
|
||||
|
||||
buf[1] = descriptor_type::STRING;
|
||||
let mut pos = 2;
|
||||
for c in s.encode_utf16() {
|
||||
if pos + 2 >= buf.len() {
|
||||
panic!("control buffer too small");
|
||||
}
|
||||
assert!(pos + 2 < buf.len(), "control buffer too small");
|
||||
|
||||
buf[pos..pos + 2].copy_from_slice(&c.to_le_bytes());
|
||||
pos += 2;
|
||||
|
||||
@@ -6,7 +6,7 @@
|
||||
|
||||
use core::mem::size_of;
|
||||
|
||||
use super::{capability_type, BosWriter};
|
||||
use crate::descriptor::{capability_type, BosWriter};
|
||||
use crate::types::InterfaceNumber;
|
||||
|
||||
/// A serialized Microsoft OS 2.0 Descriptor set.
|
||||
|
||||
@@ -7,7 +7,7 @@
|
||||
pub struct InterfaceNumber(pub u8);
|
||||
|
||||
impl InterfaceNumber {
|
||||
pub(crate) fn new(index: u8) -> InterfaceNumber {
|
||||
pub(crate) const fn new(index: u8) -> InterfaceNumber {
|
||||
InterfaceNumber(index)
|
||||
}
|
||||
}
|
||||
@@ -25,7 +25,7 @@ impl From<InterfaceNumber> for u8 {
|
||||
pub struct StringIndex(pub u8);
|
||||
|
||||
impl StringIndex {
|
||||
pub(crate) fn new(index: u8) -> StringIndex {
|
||||
pub(crate) const fn new(index: u8) -> StringIndex {
|
||||
StringIndex(index)
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,7 +1,12 @@
|
||||
MEMORY
|
||||
{
|
||||
/* NOTE 1 K = 1 KiBi = 1024 bytes */
|
||||
/* These values correspond to the NRF52840 with Softdevices S140 7.0.1 */
|
||||
FLASH : ORIGIN = 0x00000000, LENGTH = 1024K
|
||||
RAM : ORIGIN = 0x20000000, LENGTH = 256K
|
||||
|
||||
/* These values correspond to the NRF52840 with Softdevices S140 7.3.0 */
|
||||
/*
|
||||
FLASH : ORIGIN = 0x00027000, LENGTH = 868K
|
||||
RAM : ORIGIN = 0x20020000, LENGTH = 128K
|
||||
*/
|
||||
}
|
||||
|
||||
@@ -33,7 +33,7 @@ embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["de
|
||||
embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "executor-interrupt", "defmt", "integrated-timers"] }
|
||||
embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime"] }
|
||||
embassy-nrf = { version = "0.1.0", path = "../../embassy-nrf", features = ["defmt", "nrf52840", "time-driver-rtc1", "gpiote", "unstable-pac", "time"] }
|
||||
embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "tcp", "dhcpv4", "medium-ethernet"], optional = true }
|
||||
embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "tcp", "dhcpv4", "medium-ethernet"], optional = true }
|
||||
embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt", "msos-descriptor",], optional = true }
|
||||
embedded-io = { version = "0.6.0", features = ["defmt-03"] }
|
||||
embedded-io-async = { version = "0.6.0", optional = true, features = ["defmt-03"] }
|
||||
|
||||
@@ -1,7 +1,12 @@
|
||||
MEMORY
|
||||
{
|
||||
/* NOTE 1 K = 1 KiBi = 1024 bytes */
|
||||
/* These values correspond to the NRF52840 with Softdevices S140 7.0.1 */
|
||||
FLASH : ORIGIN = 0x00000000, LENGTH = 1024K
|
||||
RAM : ORIGIN = 0x20000000, LENGTH = 256K
|
||||
|
||||
/* These values correspond to the NRF52840 with Softdevices S140 7.3.0 */
|
||||
/*
|
||||
FLASH : ORIGIN = 0x00027000, LENGTH = 868K
|
||||
RAM : ORIGIN = 0x20020000, LENGTH = 128K
|
||||
*/
|
||||
}
|
||||
|
||||
@@ -27,7 +27,7 @@ embassy-nrf = { version = "0.1.0", path = "../../embassy-nrf", features = [
|
||||
"gpiote",
|
||||
"unstable-pac",
|
||||
] }
|
||||
embassy-net = { version = "0.1.0", path = "../../embassy-net", features = [
|
||||
embassy-net = { version = "0.2.0", path = "../../embassy-net", features = [
|
||||
"nightly",
|
||||
"defmt",
|
||||
"tcp",
|
||||
|
||||
@@ -12,7 +12,7 @@ embassy-executor = { version = "0.3.0", path = "../../embassy-executor", feature
|
||||
embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["nightly", "unstable-traits", "defmt", "defmt-timestamp-uptime"] }
|
||||
embassy-rp = { version = "0.1.0", path = "../../embassy-rp", features = ["defmt", "unstable-traits", "nightly", "unstable-pac", "time-driver", "critical-section-impl"] }
|
||||
embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] }
|
||||
embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "udp", "dhcpv4", "medium-ethernet"] }
|
||||
embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "udp", "dhcpv4", "medium-ethernet"] }
|
||||
embassy-net-wiznet = { version = "0.1.0", path = "../../embassy-net-wiznet", features = ["defmt"] }
|
||||
embassy-futures = { version = "0.1.0", path = "../../embassy-futures" }
|
||||
embassy-usb-logger = { version = "0.1.0", path = "../../embassy-usb-logger" }
|
||||
|
||||
32
examples/rp/src/bin/rosc.rs
Normal file
32
examples/rp/src/bin/rosc.rs
Normal file
@@ -0,0 +1,32 @@
|
||||
//! This example test the RP Pico on board LED.
|
||||
//!
|
||||
//! It does not work with the RP Pico W board. See wifi_blinky.rs.
|
||||
|
||||
#![no_std]
|
||||
#![no_main]
|
||||
#![feature(type_alias_impl_trait)]
|
||||
|
||||
use defmt::*;
|
||||
use embassy_executor::Spawner;
|
||||
use embassy_rp::{clocks, gpio};
|
||||
use embassy_time::Timer;
|
||||
use gpio::{Level, Output};
|
||||
use {defmt_rtt as _, panic_probe as _};
|
||||
|
||||
#[embassy_executor::main]
|
||||
async fn main(_spawner: Spawner) {
|
||||
let mut config = embassy_rp::config::Config::default();
|
||||
config.clocks = clocks::ClockConfig::rosc();
|
||||
let p = embassy_rp::init(config);
|
||||
let mut led = Output::new(p.PIN_25, Level::Low);
|
||||
|
||||
loop {
|
||||
info!("led on!");
|
||||
led.set_high();
|
||||
Timer::after_secs(1).await;
|
||||
|
||||
info!("led off!");
|
||||
led.set_low();
|
||||
Timer::after_secs(1).await;
|
||||
}
|
||||
}
|
||||
@@ -8,7 +8,7 @@ license = "MIT OR Apache-2.0"
|
||||
embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["log"] }
|
||||
embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["arch-std", "executor-thread", "log", "nightly", "integrated-timers"] }
|
||||
embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["log", "std", "nightly"] }
|
||||
embassy-net = { version = "0.1.0", path = "../../embassy-net", features=[ "std", "nightly", "log", "medium-ethernet", "medium-ip", "tcp", "udp", "dns", "dhcpv4", "proto-ipv6"] }
|
||||
embassy-net = { version = "0.2.0", path = "../../embassy-net", features=[ "std", "nightly", "log", "medium-ethernet", "medium-ip", "tcp", "udp", "dns", "dhcpv4", "proto-ipv6"] }
|
||||
embassy-net-tuntap = { version = "0.1.0", path = "../../embassy-net-tuntap" }
|
||||
embassy-net-ppp = { version = "0.1.0", path = "../../embassy-net-ppp", features = ["log"]}
|
||||
embedded-io-async = { version = "0.6.0" }
|
||||
|
||||
@@ -11,7 +11,7 @@ embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["de
|
||||
embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "executor-interrupt", "defmt", "integrated-timers"] }
|
||||
embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "unstable-traits", "tick-hz-32_768"] }
|
||||
embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] }
|
||||
embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "tcp", "dhcpv4", "medium-ethernet", "nightly"] }
|
||||
embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "tcp", "dhcpv4", "medium-ethernet", "nightly"] }
|
||||
|
||||
defmt = "0.3"
|
||||
defmt-rtt = "0.4"
|
||||
|
||||
@@ -10,7 +10,7 @@ embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["
|
||||
embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] }
|
||||
embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] }
|
||||
embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] }
|
||||
embassy-net = { path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "dhcpv4", "medium-ethernet"] }
|
||||
embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "dhcpv4", "medium-ethernet"] }
|
||||
embedded-io-async = { version = "0.6.0" }
|
||||
embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] }
|
||||
|
||||
|
||||
@@ -10,7 +10,7 @@ embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["
|
||||
embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] }
|
||||
embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] }
|
||||
embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "unstable-traits", "tick-hz-32_768"] }
|
||||
embassy-net = { path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "dhcpv4", "medium-ethernet", "proto-ipv6"] }
|
||||
embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "dhcpv4", "medium-ethernet", "proto-ipv6"] }
|
||||
embedded-io-async = { version = "0.6.0" }
|
||||
embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] }
|
||||
|
||||
|
||||
@@ -10,7 +10,7 @@ embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["
|
||||
embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] }
|
||||
embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] }
|
||||
embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "unstable-traits", "tick-hz-32_768"] }
|
||||
embassy-net = { path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "dhcpv4", "medium-ethernet", "proto-ipv6"] }
|
||||
embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "dhcpv4", "medium-ethernet", "proto-ipv6"] }
|
||||
embedded-io-async = { version = "0.6.0" }
|
||||
embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] }
|
||||
|
||||
|
||||
@@ -13,7 +13,7 @@ embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["de
|
||||
embassy-embedded-hal = { version = "0.1.0", path = "../../embassy-embedded-hal" }
|
||||
embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] }
|
||||
embassy-net-adin1110 = { version = "0.2.0", path = "../../embassy-net-adin1110" }
|
||||
embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "nightly", "udp", "tcp", "dhcpv4", "medium-ethernet"] }
|
||||
embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "nightly", "udp", "tcp", "dhcpv4", "medium-ethernet"] }
|
||||
embassy-futures = { version = "0.1.0", path = "../../embassy-futures" }
|
||||
embedded-io-async = { version = "0.6.0", features = ["defmt-03"] }
|
||||
embedded-io = { version = "0.6.0", features = ["defmt-03"] }
|
||||
|
||||
@@ -13,7 +13,7 @@ fn main() -> ! {
|
||||
info!("Hello World!");
|
||||
|
||||
pac::RCC.ccipr().modify(|w| {
|
||||
w.set_adcsel(pac::rcc::vals::Adcsel::SYSCLK);
|
||||
w.set_adcsel(pac::rcc::vals::Adcsel::SYS);
|
||||
});
|
||||
pac::RCC.ahb2enr().modify(|w| w.set_adcen(true));
|
||||
|
||||
|
||||
@@ -14,7 +14,7 @@ async fn main(_spawner: Spawner) {
|
||||
let p = embassy_stm32::init(Default::default());
|
||||
info!("Hello World!");
|
||||
|
||||
let _mco = Mco::new(p.MCO, p.PA8, McoSource::HSI16, McoPrescaler::DIV1);
|
||||
let _mco = Mco::new(p.MCO, p.PA8, McoSource::HSI, McoPrescaler::DIV1);
|
||||
|
||||
let mut led = Output::new(p.PB14, Level::High, Speed::Low);
|
||||
|
||||
|
||||
@@ -19,7 +19,7 @@ async fn main(_spawner: Spawner) {
|
||||
config.rcc.mux = ClockSrc::PLL;
|
||||
config.rcc.hsi16 = true;
|
||||
config.rcc.pll = Some(Pll {
|
||||
source: PLLSource::HSI16,
|
||||
source: PLLSource::HSI,
|
||||
prediv: PllPreDiv::DIV1,
|
||||
mul: PllMul::MUL18,
|
||||
divp: None,
|
||||
|
||||
@@ -27,7 +27,7 @@ async fn main(_spawner: Spawner) {
|
||||
config.rcc.mux = ClockSrc::PLL;
|
||||
config.rcc.hsi16 = true;
|
||||
config.rcc.pll = Some(Pll {
|
||||
source: PLLSource::HSI16,
|
||||
source: PLLSource::HSI,
|
||||
prediv: PllPreDiv::DIV1,
|
||||
mul: PllMul::MUL10,
|
||||
divp: None,
|
||||
|
||||
@@ -11,7 +11,7 @@ embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["de
|
||||
embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] }
|
||||
embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] }
|
||||
embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] }
|
||||
embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "dhcpv4", "medium-ethernet"] }
|
||||
embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "dhcpv4", "medium-ethernet"] }
|
||||
embassy-futures = { version = "0.1.0", path = "../../embassy-futures" }
|
||||
usbd-hid = "0.6.0"
|
||||
|
||||
|
||||
@@ -11,7 +11,7 @@ embassy-stm32-wpan = { version = "0.1.0", path = "../../embassy-stm32-wpan", fea
|
||||
embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] }
|
||||
embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] }
|
||||
embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] }
|
||||
embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "udp", "proto-ipv6", "medium-ieee802154", "nightly"], optional=true }
|
||||
embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "udp", "proto-ipv6", "medium-ieee802154", "nightly"], optional=true }
|
||||
|
||||
defmt = "0.3"
|
||||
defmt-rtt = "0.4"
|
||||
|
||||
@@ -9,7 +9,7 @@ embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["
|
||||
embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] }
|
||||
embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] }
|
||||
embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] }
|
||||
embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "udp", "proto-ipv6", "medium-ieee802154", "nightly"], optional=true }
|
||||
embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "udp", "proto-ipv6", "medium-ieee802154", "nightly"], optional=true }
|
||||
|
||||
defmt = "0.3"
|
||||
defmt-rtt = "0.4"
|
||||
|
||||
@@ -13,7 +13,7 @@ embassy-executor = { version = "0.3.0", path = "../../embassy-executor", feature
|
||||
embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "nightly", "unstable-traits", "defmt-timestamp-uptime"] }
|
||||
embassy-nrf = { version = "0.1.0", path = "../../embassy-nrf", features = ["defmt", "nightly", "unstable-traits", "nrf52840", "time-driver-rtc1", "gpiote", "unstable-pac"] }
|
||||
embedded-io-async = { version = "0.6.0" }
|
||||
embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "tcp", "dhcpv4", "medium-ethernet", "nightly"] }
|
||||
embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "tcp", "dhcpv4", "medium-ethernet", "nightly"] }
|
||||
embassy-net-esp-hosted = { version = "0.1.0", path = "../../embassy-net-esp-hosted", features = ["defmt"] }
|
||||
embassy-net-enc28j60 = { version = "0.1.0", path = "../../embassy-net-enc28j60", features = ["defmt"] }
|
||||
embedded-hal-async = { version = "1.0.0-rc.1" }
|
||||
|
||||
@@ -6,7 +6,7 @@ edition = "2021"
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
|
||||
[dependencies]
|
||||
embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "tcp", "dhcpv4"] }
|
||||
embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "tcp", "dhcpv4"] }
|
||||
embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "nightly", "unstable-traits"] }
|
||||
embassy-futures = { version = "0.1.0", path = "../../embassy-futures" }
|
||||
defmt = "0.3.0"
|
||||
|
||||
@@ -12,7 +12,7 @@ embassy-executor = { version = "0.3.0", path = "../../embassy-executor", feature
|
||||
embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "nightly", "unstable-traits"] }
|
||||
embassy-rp = { version = "0.1.0", path = "../../embassy-rp", features = ["nightly", "defmt", "unstable-pac", "unstable-traits", "time-driver", "critical-section-impl", "intrinsics", "rom-v2-intrinsics", "run-from-ram"] }
|
||||
embassy-futures = { version = "0.1.0", path = "../../embassy-futures" }
|
||||
embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "udp", "dhcpv4", "medium-ethernet"] }
|
||||
embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "udp", "dhcpv4", "medium-ethernet"] }
|
||||
embassy-net-wiznet = { version = "0.1.0", path = "../../embassy-net-wiznet", features = ["defmt"] }
|
||||
cyw43 = { path = "../../cyw43", features = ["defmt", "firmware-logs"] }
|
||||
cyw43-pio = { path = "../../cyw43-pio", features = ["defmt", "overclock"] }
|
||||
|
||||
@@ -46,7 +46,7 @@ embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["de
|
||||
embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "unstable-pac", "memory-x", "time-driver-any"] }
|
||||
embassy-futures = { version = "0.1.0", path = "../../embassy-futures" }
|
||||
embassy-stm32-wpan = { version = "0.1.0", path = "../../embassy-stm32-wpan", optional = true, features = ["defmt", "stm32wb55rg", "ble"] }
|
||||
embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "udp", "dhcpv4", "medium-ethernet"] }
|
||||
embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "udp", "dhcpv4", "medium-ethernet"] }
|
||||
perf-client = { path = "../perf-client" }
|
||||
|
||||
defmt = "0.3.0"
|
||||
|
||||
@@ -290,7 +290,7 @@ pub fn config() -> Config {
|
||||
config.rcc.mux = ClockSrc::PLL;
|
||||
config.rcc.hsi16 = true;
|
||||
config.rcc.pll = Some(Pll {
|
||||
source: PLLSource::HSI16,
|
||||
source: PLLSource::HSI,
|
||||
prediv: PllPreDiv::DIV1,
|
||||
mul: PllMul::MUL18,
|
||||
divp: None,
|
||||
|
||||
Reference in New Issue
Block a user