Compare commits

..

85 Commits

Author SHA1 Message Date
Dario Nieuwenhuis
0bae4629fd test ci 2023-10-30 03:21:07 +01:00
xoviat
b6fc682117 Merge pull request #2117 from xoviat/rtc-3
stm32/rtc: more rtc cleanup
2023-10-26 00:55:32 +00:00
xoviat
0beb84768e stm32/rtc: more rtc cleanup 2023-10-25 19:50:30 -05:00
xoviat
b98a279367 Merge pull request #2116 from xoviat/rtc-2
stm32/low-power: refactor refcount
2023-10-26 00:11:21 +00:00
xoviat
e8a3cfaed6 stm32/low-power: refactor refcount 2023-10-25 19:07:31 -05:00
Dario Nieuwenhuis
0cc3e18db6 Merge pull request #2112 from AzazKamaz/patch-1
Fix #2100 - function address comparison
2023-10-25 11:53:52 +00:00
Aleksandr Krotov
6b19c0abd1 Fix #2100 - function address comparison 2023-10-25 11:01:35 +03:00
Dario Nieuwenhuis
f956d19e6e Merge pull request #2111 from yodaldevoid/more-ticks
time: Add tick rates in multiples of 10 kHz
2023-10-24 19:51:24 +00:00
Gabriel Smith
ceb0d0bf08 time: Add tick rates in multiples of 10 kHz 2023-10-24 15:34:39 -04:00
Dario Nieuwenhuis
b3879ec223 Merge pull request #2105 from andresv/fix-stm32-uart-set-config
Fix stm32 uart set_config
2023-10-24 13:13:42 +00:00
Andres Vahter
bda99e59ec stm32: fix uart parity, add comment why it is so 2023-10-24 15:57:03 +03:00
Andres Vahter
25c2a9baaa stm32 uart: remove redundant set_fifoen(true) 2023-10-24 10:11:54 +03:00
Andres Vahter
1e362c750b stm32 uart: use ConfigError instead of () as error 2023-10-24 09:54:17 +03:00
Ulf Lilleengen
1a51a84313 Merge pull request #2109 from rmja/stm32-remove-unsafe-warning
stm32: Remove unneeded unsafe
2023-10-24 06:32:22 +00:00
Andres Vahter
7f72dbdaf2 stm32: fix set_config for buffered uart
In reconfigure() cr1 register is initialised with write (not modify) which means rxneie and idleneie are disabled after reconfiguration.
2023-10-24 09:09:33 +03:00
Rasmus Melchior Jacobsen
e8c162ac03 stm32: Remove unneeded unsafe 2023-10-24 07:44:04 +02:00
xoviat
1aaa19748a Merge pull request #2107 from embassy-rs/hil-test
stm32/build: deterministically generate data
2023-10-23 23:42:38 +00:00
xoviat
9e230b64a4 stm32/build: deterministically generate data 2023-10-23 18:19:42 -05:00
xoviat
17b4cf8ce7 Merge pull request #2106 from xoviat/fix-stop-2
stm32: fix low-power test
2023-10-23 21:29:36 +00:00
xoviat
df4aa0fe25 stm32: fix low-power test 2023-10-23 16:26:34 -05:00
Andres Vahter
188ee59ba6 stm32: fix setting uart databits 2023-10-23 22:40:24 +03:00
Andres Vahter
591612db7e stm32 uart: return error if rx and tx not enabled 2023-10-23 22:39:24 +03:00
Dario Nieuwenhuis
d673f8a865 Merge pull request #2103 from embassy-rs/rcc-no-spaghetti
stm32/rcc: merge wb into l4/l5.
2023-10-23 16:21:17 +00:00
Dario Nieuwenhuis
82593bd404 stm32/gpio: make port G work on U5. 2023-10-23 18:12:31 +02:00
Dario Nieuwenhuis
a39ae12edc stm32/rcc: misc cleanups. 2023-10-23 17:36:21 +02:00
Dario Nieuwenhuis
0ef1cb29f7 stm32/rcc: merge wb into l4/l5. 2023-10-23 17:36:21 +02:00
Dario Nieuwenhuis
64ab23d17d Merge pull request #2104 from glaeqen/slow-dhcp
net: Reset DHCP socket when the link up is detected
2023-10-23 09:55:17 +00:00
Gabriel Górski
18c9bcd44a net: Reset DHCP socket when the link up is detected
Previously, because DHCP DISCOVER is sent before the link is
established, socket has to timeout first. Which takes extra 10 s.

Now if the state of the link changed to up, socket is explicitly reset
so the DISCOVER is repeated much earlier and DHCP configuration is
acquired much faster.
2023-10-23 11:07:21 +02:00
Dario Nieuwenhuis
e895ea2d8b Merge pull request #2102 from embassy-rs/rcc-no-spaghetti
stm32/rcc: merge wl into l4/l5.
2023-10-22 22:48:57 +00:00
Dario Nieuwenhuis
b9e13cb5d1 stm32/rcc: merge wl into l4/l5. 2023-10-23 00:31:36 +02:00
Dario Nieuwenhuis
46ff2c82aa Merge pull request #2101 from embassy-rs/rcc-no-spaghetti
stm32/tests: add stm32wba52cg, stm32u5a9zj
2023-10-22 21:05:27 +00:00
Dario Nieuwenhuis
a84ad741a4 stm32/tests: add stm32wba52cg, stm32u5a9zj 2023-10-22 22:45:11 +02:00
Dario Nieuwenhuis
412bcad2d1 stm32: rename HSI16 -> HSI 2023-10-22 22:39:55 +02:00
xoviat
e70c531d3d Merge pull request #2098 from xoviat/doc
stm32: fix opamp bug in docs build
2023-10-21 12:33:47 +00:00
xoviat
7c5f963d1f stm32: fix opamp bug in docs build 2023-10-21 07:32:04 -05:00
Dario Nieuwenhuis
62e1e1637c Merge pull request #2097 from embassy-rs/rcc-no-spaghetti
stm32/tests: add stm32h753zi, stm32h7a3zi.
2023-10-21 02:49:12 +00:00
Dario Nieuwenhuis
3d03c18d4f stm32/tests: add stm32h753zi, stm32h7a3zi. 2023-10-21 04:46:45 +02:00
xoviat
2157c5a4e3 Merge pull request #2096 from xoviat/rcc
wip: update metapac
2023-10-21 01:23:09 +00:00
xoviat
0fb677aad7 stm32: update metapac 2023-10-20 20:21:53 -05:00
Dario Nieuwenhuis
b1d0947a18 Merge pull request #1991 from diondokter/center-align
stm32: Add the ability to center-align timers
2023-10-20 16:39:30 +00:00
Dion Dokter
5b3f75dc72 Merge branch 'master' into center-align 2023-10-20 14:17:55 +02:00
Dion Dokter
6f2995cd4c Invert assert 2023-10-20 10:41:39 +02:00
Dario Nieuwenhuis
88ada52146 Merge pull request #2017 from ilya-epifanov/rp-adc-div
added sampling frequency setting to adc capture methods on rp2040
2023-10-20 01:47:27 +00:00
Dario Nieuwenhuis
d622181205 Merge pull request #2093 from embassy-rs/net-wiznet-linkupdwon
net-wiznet: report link up/down on cable plug/unplug.
2023-10-19 23:38:44 +00:00
Dario Nieuwenhuis
630443a4d6 net-wiznet: report link up/down on cable plug/unplug. 2023-10-20 01:29:10 +02:00
Ulf Lilleengen
035800bfbd Merge pull request #2091 from embassy-rs/comment-memory-x
docs: add linker script comments
2023-10-19 08:19:42 +00:00
Ulf Lilleengen
c7803bb8f4 docs: add linker script comments
Existing comment were outdated. Provide an example configuration
for using the softdevice with the nRF52 examples.
2023-10-19 09:29:20 +02:00
Dario Nieuwenhuis
d496a1213c Merge pull request #2090 from eZioPan/rcc-init-bypass-oden
bypass `ODEN` in `rcc::init()` if chip doesn't have it
2023-10-18 12:15:30 +00:00
eZio Pan
241488ef1c bypass ODEN if chip doesn't have it 2023-10-18 19:42:31 +08:00
Ulf Lilleengen
88b2cdd6a0 Merge pull request #2087 from riley-williams/rp2040-pwm-docs
Add docs to RP2040 PWM config
2023-10-18 06:30:08 +00:00
Dario Nieuwenhuis
35ffdf2143 Merge pull request #2076 from embassy-rs/net-driver-simplify
net/driver: remove Medium, make HardwareAddress non_exhaustive.
2023-10-18 03:39:41 +00:00
Dario Nieuwenhuis
3cbc687424 net/driver: remove Medium, make HardwareAddress non_exhaustive. 2023-10-18 05:28:16 +02:00
Dario Nieuwenhuis
4f7b831676 Merge pull request #2088 from embassy-rs/rcc-no-spaghetti
stm32: rcc no spaghetti
2023-10-18 03:23:47 +00:00
Dario Nieuwenhuis
f20f170b1f stm32/rcc: refactor and unify f4 into f7. 2023-10-18 05:11:31 +02:00
Dario Nieuwenhuis
67010d123c stm32/rcc: refactor f7. 2023-10-18 05:01:11 +02:00
Dario Nieuwenhuis
51708c8ed1 Merge pull request #2089 from artisdom/patch-1
Update basic_application.adoc
2023-10-18 02:59:48 +00:00
Dario Nieuwenhuis
361fde35cf stm32/rcc: wait for mux switch. 2023-10-18 04:32:18 +02:00
Dario Nieuwenhuis
7ce3b19389 stm32/rcc: remove unused enum. 2023-10-18 04:32:18 +02:00
Ted Feng
10f08445e4 Update basic_application.adoc
typo: change "embassy::main" to "embassy_executor::main"
2023-10-18 14:53:49 +13:00
xoviat
f24a1b62bb Merge pull request #2085 from xoviat/rcc
stm32: update metapac
2023-10-18 01:33:00 +00:00
xoviat
bbd12c9372 stm32: update metapac 2023-10-17 20:31:44 -05:00
Riley Williams
6906cc9c25 remove trailing spaces 2023-10-17 19:30:53 -04:00
Riley Williams
cb211f88d3 Grammar and formatting 2023-10-17 19:17:29 -04:00
Riley Williams
3f262a2603 Add docs to RP2040 PWM 2023-10-17 19:05:35 -04:00
Dario Nieuwenhuis
d94b9fe6fb Merge pull request #2082 from embassy-rs/stm32wl-hil
stm32/tests: add stm32wl hil.
2023-10-17 14:58:53 +00:00
Dario Nieuwenhuis
b478640463 fix clocks in stm32wl rng example. 2023-10-17 15:57:09 +02:00
Dario Nieuwenhuis
846f2fc6e4 stm32/tests: add stm32wl hil. 2023-10-17 15:57:09 +02:00
xoviat
683d5c3066 Merge pull request #2077 from xoviat/rcc
stm32: update metapac
2023-10-17 01:05:18 +00:00
xoviat
a3574e519a stm32: update metapac 2023-10-16 20:04:10 -05:00
Dario Nieuwenhuis
3e3317e8bd Merge pull request #2078 from GrantM11235/prefetch
stm32f1: Keep flash prefetch enabled
2023-10-17 00:29:30 +00:00
Grant Miller
e7aeb9b29f stm32f1: Keep flash prefetch enabled 2023-10-16 19:23:01 -05:00
Dario Nieuwenhuis
7fd868ade9 Merge pull request #2068 from barafael/const_usb_config_builder_new
Constify UsbDevice Config::new (and clippy fixes) in embassy-usb
2023-10-16 23:23:10 +00:00
Dario Nieuwenhuis
6e6df22979 Merge pull request #2075 from CBJamo/rosc_example
Add example to show useage of rp2040 rosc
2023-10-16 23:22:06 +00:00
Ulf Lilleengen
f7980885a5 Merge pull request #2066 from bugadani/net
Prepare embassy-net 0.2.0
2023-10-16 21:19:29 +00:00
Caleb Jamison
5a1393aa0b Add example to show useage of rp2040 rosc 2023-10-16 16:17:07 -04:00
Dániel Buga
40e4ca4751 Prepare embassy-net(/-driver,/-driver-channel) 0.2.0 2023-10-16 20:59:06 +02:00
Rafael Bachmann
31d4516516 Apply Pedantic Clippy Lints 2023-10-15 23:52:44 +02:00
Rafael Bachmann
66e62e9994 Fix clippy 2023-10-15 22:25:35 +02:00
Rafael Bachmann
eeedaf2e76 Constify Config::new 2023-10-15 22:11:30 +02:00
Ilya Epifanov
0c97ce2fcc fixed rp adc tests 2023-10-09 11:46:57 +02:00
Ilya Epifanov
62d6bb6c8a added sampling frequency setting to adc capture methods on rp2040 2023-10-09 10:53:29 +02:00
Dion Dokter
a9dc887060 Added clarifying comment 2023-10-02 21:41:30 +02:00
Dion Dokter
137e47f98d Do affect the frequency 2023-10-02 21:14:44 +02:00
Dion Dokter
05a9b11316 Fix examples 2023-10-01 23:39:53 +02:00
Dion Dokter
561126b0d6 stm32: Add the ability to center-align timers 2023-10-01 23:09:01 +02:00
158 changed files with 2243 additions and 2185 deletions

1
.github/ci/build.sh vendored
View File

@@ -12,6 +12,7 @@ if [ -f /ci/secrets/teleprobe-token.txt ]; then
export TELEPROBE_HOST=https://teleprobe.embassy.dev export TELEPROBE_HOST=https://teleprobe.embassy.dev
export TELEPROBE_TOKEN=$(cat /ci/secrets/teleprobe-token.txt) export TELEPROBE_TOKEN=$(cat /ci/secrets/teleprobe-token.txt)
export TELEPROBE_CACHE=/ci/cache/teleprobe_cache.json export TELEPROBE_CACHE=/ci/cache/teleprobe_cache.json
rm -f $TELEPROBE_CACHE
fi fi
# needed for "dumb HTTP" transport support # needed for "dumb HTTP" transport support

10
ci.sh
View File

@@ -192,9 +192,13 @@ cargo batch \
--- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv6m-none-eabi --features stm32g071rb --out-dir out/tests/stm32g071rb \ --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv6m-none-eabi --features stm32g071rb --out-dir out/tests/stm32g071rb \
--- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv6m-none-eabi --features stm32c031c6 --out-dir out/tests/stm32c031c6 \ --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv6m-none-eabi --features stm32c031c6 --out-dir out/tests/stm32c031c6 \
--- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32h755zi --out-dir out/tests/stm32h755zi \ --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32h755zi --out-dir out/tests/stm32h755zi \
--- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32h753zi --out-dir out/tests/stm32h753zi \
--- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32h7a3zi --out-dir out/tests/stm32h7a3zi \
--- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32wb55rg --out-dir out/tests/stm32wb55rg \ --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32wb55rg --out-dir out/tests/stm32wb55rg \
--- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32h563zi --out-dir out/tests/stm32h563zi \ --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32h563zi --out-dir out/tests/stm32h563zi \
--- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32u585ai --out-dir out/tests/stm32u585ai \ --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32u585ai --out-dir out/tests/stm32u585ai \
--- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32u5a5zj --out-dir out/tests/stm32u5a5zj \
--- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32wba52cg --out-dir out/tests/stm32wba52cg \
--- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv6m-none-eabi --features stm32l073rz --out-dir out/tests/stm32l073rz \ --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv6m-none-eabi --features stm32l073rz --out-dir out/tests/stm32l073rz \
--- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7m-none-eabi --features stm32l152re --out-dir out/tests/stm32l152re \ --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7m-none-eabi --features stm32l152re --out-dir out/tests/stm32l152re \
--- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32l4a6zg --out-dir out/tests/stm32l4a6zg \ --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32l4a6zg --out-dir out/tests/stm32l4a6zg \
@@ -204,6 +208,7 @@ cargo batch \
--- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7m-none-eabi --features stm32f207zg --out-dir out/tests/stm32f207zg \ --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7m-none-eabi --features stm32f207zg --out-dir out/tests/stm32f207zg \
--- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f303ze --out-dir out/tests/stm32f303ze \ --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f303ze --out-dir out/tests/stm32f303ze \
--- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32l496zg --out-dir out/tests/stm32l496zg \ --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32l496zg --out-dir out/tests/stm32l496zg \
--- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32wl55jc --out-dir out/tests/stm32wl55jc \
--- build --release --manifest-path tests/rp/Cargo.toml --target thumbv6m-none-eabi --out-dir out/tests/rpi-pico \ --- build --release --manifest-path tests/rp/Cargo.toml --target thumbv6m-none-eabi --out-dir out/tests/rpi-pico \
--- build --release --manifest-path tests/nrf/Cargo.toml --target thumbv7em-none-eabi --out-dir out/tests/nrf52840-dk \ --- build --release --manifest-path tests/nrf/Cargo.toml --target thumbv7em-none-eabi --out-dir out/tests/nrf52840-dk \
--- build --release --manifest-path tests/riscv32/Cargo.toml --target riscv32imac-unknown-none-elf \ --- build --release --manifest-path tests/riscv32/Cargo.toml --target riscv32imac-unknown-none-elf \
@@ -212,8 +217,13 @@ cargo batch \
rm out/tests/stm32wb55rg/wpan_mac rm out/tests/stm32wb55rg/wpan_mac
rm out/tests/stm32wb55rg/wpan_ble rm out/tests/stm32wb55rg/wpan_ble
# unstable, I think it's running out of RAM?
rm out/tests/stm32f207zg/eth rm out/tests/stm32f207zg/eth
# doesn't work, gives "noise error", no idea why. usart_dma does pass.
rm out/tests/stm32u5a5zj/usart
if [[ -z "${TELEPROBE_TOKEN-}" ]]; then if [[ -z "${TELEPROBE_TOKEN-}" ]]; then
echo No teleprobe token found, skipping running HIL tests echo No teleprobe token found, skipping running HIL tests
exit exit

View File

@@ -14,7 +14,7 @@ firmware-logs = []
embassy-time = { version = "0.1.5", path = "../embassy-time"} embassy-time = { version = "0.1.5", path = "../embassy-time"}
embassy-sync = { version = "0.3.0", path = "../embassy-sync"} embassy-sync = { version = "0.3.0", path = "../embassy-sync"}
embassy-futures = { version = "0.1.0", path = "../embassy-futures"} embassy-futures = { version = "0.1.0", path = "../embassy-futures"}
embassy-net-driver-channel = { version = "0.1.0", path = "../embassy-net-driver-channel"} embassy-net-driver-channel = { version = "0.2.0", path = "../embassy-net-driver-channel"}
defmt = { version = "0.3", optional = true } defmt = { version = "0.3", optional = true }
log = { version = "0.4.17", optional = true } log = { version = "0.4.17", optional = true }

View File

@@ -1,7 +1,7 @@
use core::cmp::{max, min}; use core::cmp::{max, min};
use ch::driver::LinkState;
use embassy_net_driver_channel as ch; use embassy_net_driver_channel as ch;
use embassy_net_driver_channel::driver::{HardwareAddress, LinkState};
use embassy_time::Timer; use embassy_time::Timer;
pub use crate::bus::SpiBusCyw43; pub use crate::bus::SpiBusCyw43;
@@ -133,7 +133,7 @@ impl<'a> Control<'a> {
Timer::after_millis(100).await; Timer::after_millis(100).await;
self.state_ch.set_ethernet_address(mac_addr); self.state_ch.set_hardware_address(HardwareAddress::Ethernet(mac_addr));
debug!("INIT DONE"); debug!("INIT DONE");
} }

View File

@@ -48,7 +48,7 @@ The `Spawner` is the way the main application spawns other tasks. The `Periphera
include::example$basic/src/main.rs[lines="22..-1"] include::example$basic/src/main.rs[lines="22..-1"]
---- ----
What happens when the `blinker` task has been spawned and main returns? Well, the main entry point is actually just like any other task, except that you can only have one and it takes some specific type arguments. The magic lies within the `#[embassy::main]` macro. The macro does the following: What happens when the `blinker` task has been spawned and main returns? Well, the main entry point is actually just like any other task, except that you can only have one and it takes some specific type arguments. The magic lies within the `#[embassy_executor::main]` macro. The macro does the following:
. Creates an Embassy Executor . Creates an Embassy Executor
. Initializes the microcontroller HAL to get the `Peripherals` . Initializes the microcontroller HAL to get the `Peripherals`

View File

@@ -3,7 +3,7 @@ use core::task::{RawWaker, RawWakerVTable, Waker};
use super::{wake_task, TaskHeader, TaskRef}; use super::{wake_task, TaskHeader, TaskRef};
const VTABLE: RawWakerVTable = RawWakerVTable::new(clone, wake, wake, drop); static VTABLE: RawWakerVTable = RawWakerVTable::new(clone, wake, wake, drop);
unsafe fn clone(p: *const ()) -> RawWaker { unsafe fn clone(p: *const ()) -> RawWaker {
RawWaker::new(p, &VTABLE) RawWaker::new(p, &VTABLE)

View File

@@ -16,7 +16,7 @@ log = { version = "0.4", default-features = false, optional = true }
embedded-hal-1 = { package = "embedded-hal", version = "=1.0.0-rc.1" } embedded-hal-1 = { package = "embedded-hal", version = "=1.0.0-rc.1" }
embedded-hal-async = { version = "=1.0.0-rc.1" } embedded-hal-async = { version = "=1.0.0-rc.1" }
embedded-hal-bus = { version = "=0.1.0-rc.1", features = ["async"] } embedded-hal-bus = { version = "=0.1.0-rc.1", features = ["async"] }
embassy-net-driver-channel = { version = "0.1.0", path = "../embassy-net-driver-channel" } embassy-net-driver-channel = { version = "0.2.0", path = "../embassy-net-driver-channel" }
embassy-time = { version = "0.1.5", path = "../embassy-time" } embassy-time = { version = "0.1.5", path = "../embassy-time" }
embassy-futures = { version = "0.1.0", path = "../embassy-futures" } embassy-futures = { version = "0.1.0", path = "../embassy-futures" }
bitfield = "0.14.0" bitfield = "0.14.0"

View File

@@ -0,0 +1,16 @@
# Changelog
All notable changes to this project will be documented in this file.
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
## 0.2.0 - 2023-10-18
- Update `embassy-net-driver` to v0.2
- `Runner::new` now takes an `embassy_net_driver::HardwareAddress` parameter.
- `Runner::set_ethernet_address` is now `set_hardware_address`.
## 0.1.0 - 2023-06-29
- First release

View File

@@ -1,6 +1,6 @@
[package] [package]
name = "embassy-net-driver-channel" name = "embassy-net-driver-channel"
version = "0.1.0" version = "0.2.0"
edition = "2021" edition = "2021"
license = "MIT OR Apache-2.0" license = "MIT OR Apache-2.0"
description = "High-level channel-based driver for the `embassy-net` async TCP/IP network stack." description = "High-level channel-based driver for the `embassy-net` async TCP/IP network stack."
@@ -26,4 +26,4 @@ log = { version = "0.4.14", optional = true }
embassy-sync = { version = "0.3.0", path = "../embassy-sync" } embassy-sync = { version = "0.3.0", path = "../embassy-sync" }
embassy-futures = { version = "0.1.0", path = "../embassy-futures" } embassy-futures = { version = "0.1.0", path = "../embassy-futures" }
embassy-net-driver = { version = "0.1.0", path = "../embassy-net-driver" } embassy-net-driver = { version = "0.2.0", path = "../embassy-net-driver" }

View File

@@ -7,7 +7,9 @@ The `embassy-net-driver` trait is polling-based. To implement it, you must write
hand, and hook up the `Waker`s provided by `embassy-net` to the right interrupt handlers so that `embassy-net` hand, and hook up the `Waker`s provided by `embassy-net` to the right interrupt handlers so that `embassy-net`
knows when to poll your driver again to make more progress. knows when to poll your driver again to make more progress.
With `embassy-net-driver-channel` With `embassy-net-driver-channel` you get a "channel-like" interface instead, where you can send/receive packets
to/from embassy-net. The intended usage is to spawn a "driver task" in the background that does this, passing
packets between the hardware and the channel.
## A note about deadlocks ## A note about deadlocks
@@ -41,7 +43,7 @@ However, this code has a latent deadlock bug. The symptom is it can hang at `rx_
The reason is that, under load, both the TX and RX queues can get full at the same time. When this happens, the `embassy-net` task stalls trying to send because the TX queue is full, therefore it stops processing packets in the RX queue. Your driver task also stalls because the RX queue is full, therefore it stops processing packets in the TX queue. The reason is that, under load, both the TX and RX queues can get full at the same time. When this happens, the `embassy-net` task stalls trying to send because the TX queue is full, therefore it stops processing packets in the RX queue. Your driver task also stalls because the RX queue is full, therefore it stops processing packets in the TX queue.
The fix is to make sure to always service the TX queue while you're waiting for space to become available in the TX queue. For example, select on either "tx_chan.tx_buf() available" or "INT is low AND rx_chan.rx_buf() available": The fix is to make sure to always service the TX queue while you're waiting for space to become available in the RX queue. For example, select on either "tx_chan.tx_buf() available" or "INT is low AND rx_chan.rx_buf() available":
```rust,ignore ```rust,ignore
loop { loop {
@@ -79,12 +81,10 @@ These `embassy-net` drivers are implemented using this crate. You can look at th
- [`embassy-net-wiznet`](https://github.com/embassy-rs/embassy/tree/main/embassy-net-wiznet) for Wiznet SPI Ethernet MAC+PHY chips. - [`embassy-net-wiznet`](https://github.com/embassy-rs/embassy/tree/main/embassy-net-wiznet) for Wiznet SPI Ethernet MAC+PHY chips.
- [`embassy-net-esp-hosted`](https://github.com/embassy-rs/embassy/tree/main/embassy-net-esp-hosted) for using ESP32 chips with the [`esp-hosted`](https://github.com/espressif/esp-hosted) firmware as WiFi adapters for another non-ESP32 MCU. - [`embassy-net-esp-hosted`](https://github.com/embassy-rs/embassy/tree/main/embassy-net-esp-hosted) for using ESP32 chips with the [`esp-hosted`](https://github.com/espressif/esp-hosted) firmware as WiFi adapters for another non-ESP32 MCU.
## Interoperability ## Interoperability
This crate can run on any executor. This crate can run on any executor.
## License ## License
This work is licensed under either of This work is licensed under either of

View File

@@ -8,9 +8,8 @@ use core::cell::RefCell;
use core::mem::MaybeUninit; use core::mem::MaybeUninit;
use core::task::{Context, Poll}; use core::task::{Context, Poll};
use driver::HardwareAddress;
pub use embassy_net_driver as driver; pub use embassy_net_driver as driver;
use embassy_net_driver::{Capabilities, LinkState, Medium}; use embassy_net_driver::{Capabilities, LinkState};
use embassy_sync::blocking_mutex::raw::NoopRawMutex; use embassy_sync::blocking_mutex::raw::NoopRawMutex;
use embassy_sync::blocking_mutex::Mutex; use embassy_sync::blocking_mutex::Mutex;
use embassy_sync::waitqueue::WakerRegistration; use embassy_sync::waitqueue::WakerRegistration;
@@ -161,18 +160,10 @@ impl<'d> StateRunner<'d> {
}); });
} }
pub fn set_ethernet_address(&self, address: [u8; 6]) { pub fn set_hardware_address(&self, address: driver::HardwareAddress) {
self.shared.lock(|s| { self.shared.lock(|s| {
let s = &mut *s.borrow_mut(); let s = &mut *s.borrow_mut();
s.hardware_address = driver::HardwareAddress::Ethernet(address); s.hardware_address = address;
s.waker.wake();
});
}
pub fn set_ieee802154_address(&self, address: [u8; 8]) {
self.shared.lock(|s| {
let s = &mut *s.borrow_mut();
s.hardware_address = driver::HardwareAddress::Ieee802154(address);
s.waker.wake(); s.waker.wake();
}); });
} }
@@ -232,11 +223,6 @@ pub fn new<'d, const MTU: usize, const N_RX: usize, const N_TX: usize>(
) -> (Runner<'d, MTU>, Device<'d, MTU>) { ) -> (Runner<'d, MTU>, Device<'d, MTU>) {
let mut caps = Capabilities::default(); let mut caps = Capabilities::default();
caps.max_transmission_unit = MTU; caps.max_transmission_unit = MTU;
caps.medium = match &hardware_address {
HardwareAddress::Ethernet(_) => Medium::Ethernet,
HardwareAddress::Ieee802154(_) => Medium::Ieee802154,
HardwareAddress::Ip => Medium::Ip,
};
// safety: this is a self-referential struct, however: // safety: this is a self-referential struct, however:
// - it can't move while the `'d` borrow is active. // - it can't move while the `'d` borrow is active.

View File

@@ -0,0 +1,17 @@
# Changelog
All notable changes to this project will be documented in this file.
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
## 0.2.0 - 2023-10-18
- Added support for IEEE 802.15.4 mediums.
- Added `Driver::hardware_address()`, `HardwareAddress`.
- Removed `Medium` enum. The medium is deduced out of the hardware address.
- Removed `Driver::ethernet_address()`. Replacement is `hardware_address()`.
## 0.1.0 - 2023-06-29
- First release

View File

@@ -1,6 +1,6 @@
[package] [package]
name = "embassy-net-driver" name = "embassy-net-driver"
version = "0.1.0" version = "0.2.0"
edition = "2021" edition = "2021"
license = "MIT OR Apache-2.0" license = "MIT OR Apache-2.0"
description = "Driver trait for the `embassy-net` async TCP/IP network stack." description = "Driver trait for the `embassy-net` async TCP/IP network stack."

View File

@@ -7,12 +7,23 @@ use core::task::Context;
/// Representation of an hardware address, such as an Ethernet address or an IEEE802.15.4 address. /// Representation of an hardware address, such as an Ethernet address or an IEEE802.15.4 address.
#[derive(Debug, Clone, Copy, PartialEq, Eq)] #[derive(Debug, Clone, Copy, PartialEq, Eq)]
#[cfg_attr(feature = "defmt", derive(defmt::Format))] #[cfg_attr(feature = "defmt", derive(defmt::Format))]
#[non_exhaustive]
pub enum HardwareAddress { pub enum HardwareAddress {
/// A six-octet Ethernet address /// Ethernet medium, with a A six-octet Ethernet address.
///
/// Devices of this type send and receive Ethernet frames,
/// and interfaces using it must do neighbor discovery via ARP or NDISC.
///
/// Examples of devices of this type are Ethernet, WiFi (802.11), Linux `tap`, and VPNs in tap (layer 2) mode.
Ethernet([u8; 6]), Ethernet([u8; 6]),
/// An eight-octet IEEE802.15.4 address /// 6LoWPAN over IEEE802.15.4, with an eight-octet address.
Ieee802154([u8; 8]), Ieee802154([u8; 8]),
/// Indicates that a Driver is IP-native, and has no hardware address /// Indicates that a Driver is IP-native, and has no hardware address.
///
/// Devices of this type send and receive IP frames, without an
/// Ethernet header. MAC addresses are not used, and no neighbor discovery (ARP, NDISC) is done.
///
/// Examples of devices of this type are the Linux `tun`, PPP interfaces, VPNs in tun (layer 3) mode.
Ip, Ip,
} }
@@ -64,6 +75,10 @@ pub trait Driver {
fn capabilities(&self) -> Capabilities; fn capabilities(&self) -> Capabilities;
/// Get the device's hardware address. /// Get the device's hardware address.
///
/// The returned hardware address also determines the "medium" of this driver. This indicates
/// what kind of packet the sent/received bytes are, and determines some behaviors of
/// the interface. For example, ARP/NDISC address resolution is only done for Ethernet mediums.
fn hardware_address(&self) -> HardwareAddress; fn hardware_address(&self) -> HardwareAddress;
} }
@@ -124,13 +139,6 @@ pub trait TxToken {
#[cfg_attr(feature = "defmt", derive(defmt::Format))] #[cfg_attr(feature = "defmt", derive(defmt::Format))]
#[non_exhaustive] #[non_exhaustive]
pub struct Capabilities { pub struct Capabilities {
/// Medium of the device.
///
/// This indicates what kind of packet the sent/received bytes are, and determines
/// some behaviors of Interface. For example, ARP/NDISC address resolution is only done
/// for Ethernet mediums.
pub medium: Medium,
/// Maximum transmission unit. /// Maximum transmission unit.
/// ///
/// The network device is unable to send or receive frames larger than the value returned /// The network device is unable to send or receive frames larger than the value returned
@@ -161,32 +169,6 @@ pub struct Capabilities {
pub checksum: ChecksumCapabilities, pub checksum: ChecksumCapabilities,
} }
/// Type of medium of a device.
#[derive(Debug, Eq, PartialEq, Copy, Clone)]
#[cfg_attr(feature = "defmt", derive(defmt::Format))]
pub enum Medium {
/// Ethernet medium. Devices of this type send and receive Ethernet frames,
/// and interfaces using it must do neighbor discovery via ARP or NDISC.
///
/// Examples of devices of this type are Ethernet, WiFi (802.11), Linux `tap`, and VPNs in tap (layer 2) mode.
Ethernet,
/// IP medium. Devices of this type send and receive IP frames, without an
/// Ethernet header. MAC addresses are not used, and no neighbor discovery (ARP, NDISC) is done.
///
/// Examples of devices of this type are the Linux `tun`, PPP interfaces, VPNs in tun (layer 3) mode.
Ip,
/// IEEE 802_15_4 medium
Ieee802154,
}
impl Default for Medium {
fn default() -> Medium {
Medium::Ethernet
}
}
/// A description of checksum behavior for every supported protocol. /// A description of checksum behavior for every supported protocol.
#[derive(Debug, Clone, Default)] #[derive(Debug, Clone, Default)]
#[cfg_attr(feature = "defmt", derive(defmt::Format))] #[cfg_attr(feature = "defmt", derive(defmt::Format))]

View File

@@ -10,7 +10,7 @@ edition = "2021"
[dependencies] [dependencies]
embedded-hal = { version = "1.0.0-rc.1" } embedded-hal = { version = "1.0.0-rc.1" }
embedded-hal-async = { version = "=1.0.0-rc.1" } embedded-hal-async = { version = "=1.0.0-rc.1" }
embassy-net-driver = { version = "0.1.0", path = "../embassy-net-driver" } embassy-net-driver = { version = "0.2.0", path = "../embassy-net-driver" }
embassy-time = { version = "0.1.5", path = "../embassy-time" } embassy-time = { version = "0.1.5", path = "../embassy-time" }
embassy-futures = { version = "0.1.0", path = "../embassy-futures" } embassy-futures = { version = "0.1.0", path = "../embassy-futures" }

View File

@@ -19,7 +19,7 @@ mod traits;
use core::cmp; use core::cmp;
use core::convert::TryInto; use core::convert::TryInto;
use embassy_net_driver::{Capabilities, HardwareAddress, LinkState, Medium}; use embassy_net_driver::{Capabilities, HardwareAddress, LinkState};
use embassy_time::Duration; use embassy_time::Duration;
use embedded_hal::digital::OutputPin; use embedded_hal::digital::OutputPin;
use embedded_hal::spi::{Operation, SpiDevice}; use embedded_hal::spi::{Operation, SpiDevice};
@@ -671,7 +671,6 @@ where
fn capabilities(&self) -> Capabilities { fn capabilities(&self) -> Capabilities {
let mut caps = Capabilities::default(); let mut caps = Capabilities::default();
caps.max_transmission_unit = MTU; caps.max_transmission_unit = MTU;
caps.medium = Medium::Ethernet;
caps caps
} }

View File

@@ -10,7 +10,7 @@ log = { version = "0.4.14", optional = true }
embassy-time = { version = "0.1.5", path = "../embassy-time" } embassy-time = { version = "0.1.5", path = "../embassy-time" }
embassy-sync = { version = "0.3.0", path = "../embassy-sync"} embassy-sync = { version = "0.3.0", path = "../embassy-sync"}
embassy-futures = { version = "0.1.0", path = "../embassy-futures"} embassy-futures = { version = "0.1.0", path = "../embassy-futures"}
embassy-net-driver-channel = { version = "0.1.0", path = "../embassy-net-driver-channel"} embassy-net-driver-channel = { version = "0.2.0", path = "../embassy-net-driver-channel"}
embedded-hal = { version = "1.0.0-rc.1" } embedded-hal = { version = "1.0.0-rc.1" }
embedded-hal-async = { version = "=1.0.0-rc.1" } embedded-hal-async = { version = "=1.0.0-rc.1" }

View File

@@ -1,5 +1,5 @@
use ch::driver::LinkState;
use embassy_net_driver_channel as ch; use embassy_net_driver_channel as ch;
use embassy_net_driver_channel::driver::{HardwareAddress, LinkState};
use heapless::String; use heapless::String;
use crate::ioctl::Shared; use crate::ioctl::Shared;
@@ -77,7 +77,7 @@ impl<'a> Control<'a> {
let mac_addr = self.get_mac_addr().await?; let mac_addr = self.get_mac_addr().await?;
debug!("mac addr: {:02x}", mac_addr); debug!("mac addr: {:02x}", mac_addr);
self.state_ch.set_ethernet_address(mac_addr); self.state_ch.set_hardware_address(HardwareAddress::Ethernet(mac_addr));
Ok(()) Ok(())
} }

View File

@@ -16,7 +16,7 @@ defmt = { version = "0.3", optional = true }
log = { version = "0.4.14", optional = true } log = { version = "0.4.14", optional = true }
embedded-io-async = { version = "0.6.0" } embedded-io-async = { version = "0.6.0" }
embassy-net-driver-channel = { version = "0.1.0", path = "../embassy-net-driver-channel" } embassy-net-driver-channel = { version = "0.2.0", path = "../embassy-net-driver-channel" }
embassy-futures = { version = "0.1.0", path = "../embassy-futures" } embassy-futures = { version = "0.1.0", path = "../embassy-futures" }
ppproto = { version = "0.1.2"} ppproto = { version = "0.1.2"}
embassy-sync = { version = "0.3.0", path = "../embassy-sync" } embassy-sync = { version = "0.3.0", path = "../embassy-sync" }

View File

@@ -8,7 +8,7 @@ license = "MIT OR Apache-2.0"
edition = "2021" edition = "2021"
[dependencies] [dependencies]
embassy-net-driver = { version = "0.1.0", path = "../embassy-net-driver" } embassy-net-driver = { version = "0.2.0", path = "../embassy-net-driver" }
async-io = "1.6.0" async-io = "1.6.0"
log = "0.4.14" log = "0.4.14"
libc = "0.2.101" libc = "0.2.101"

View File

@@ -10,7 +10,7 @@ edition = "2021"
[dependencies] [dependencies]
embedded-hal = { version = "1.0.0-rc.1" } embedded-hal = { version = "1.0.0-rc.1" }
embedded-hal-async = { version = "=1.0.0-rc.1" } embedded-hal-async = { version = "=1.0.0-rc.1" }
embassy-net-driver-channel = { version = "0.1.0", path = "../embassy-net-driver-channel" } embassy-net-driver-channel = { version = "0.2.0", path = "../embassy-net-driver-channel" }
embassy-time = { version = "0.1.5", path = "../embassy-time" } embassy-time = { version = "0.1.5", path = "../embassy-time" }
embassy-futures = { version = "0.1.0", path = "../embassy-futures" } embassy-futures = { version = "0.1.0", path = "../embassy-futures" }
defmt = { version = "0.3", optional = true } defmt = { version = "0.3", optional = true }

View File

@@ -1,14 +1,14 @@
//! [`embassy-net`](https://crates.io/crates/embassy-net) driver for WIZnet ethernet chips.
#![no_std] #![no_std]
#![feature(async_fn_in_trait)] #![feature(async_fn_in_trait)]
#![doc = include_str!("../README.md")]
pub mod chip; pub mod chip;
mod device; mod device;
use embassy_futures::select::{select, Either}; use embassy_futures::select::{select3, Either3};
use embassy_net_driver_channel as ch; use embassy_net_driver_channel as ch;
use embassy_net_driver_channel::driver::LinkState; use embassy_net_driver_channel::driver::LinkState;
use embassy_time::Timer; use embassy_time::{Duration, Ticker, Timer};
use embedded_hal::digital::OutputPin; use embedded_hal::digital::OutputPin;
use embedded_hal_async::digital::Wait; use embedded_hal_async::digital::Wait;
use embedded_hal_async::spi::SpiDevice; use embedded_hal_async::spi::SpiDevice;
@@ -49,32 +49,34 @@ pub struct Runner<'d, C: Chip, SPI: SpiDevice, INT: Wait, RST: OutputPin> {
impl<'d, C: Chip, SPI: SpiDevice, INT: Wait, RST: OutputPin> Runner<'d, C, SPI, INT, RST> { impl<'d, C: Chip, SPI: SpiDevice, INT: Wait, RST: OutputPin> Runner<'d, C, SPI, INT, RST> {
pub async fn run(mut self) -> ! { pub async fn run(mut self) -> ! {
let (state_chan, mut rx_chan, mut tx_chan) = self.ch.split(); let (state_chan, mut rx_chan, mut tx_chan) = self.ch.split();
let mut tick = Ticker::every(Duration::from_millis(500));
loop { loop {
if self.mac.is_link_up().await { match select3(
state_chan.set_link_state(LinkState::Up); async {
loop { self.int.wait_for_low().await.ok();
match select( rx_chan.rx_buf().await
async { },
self.int.wait_for_low().await.ok(); tx_chan.tx_buf(),
rx_chan.rx_buf().await tick.next(),
}, )
tx_chan.tx_buf(), .await
) {
.await Either3::First(p) => {
{ if let Ok(n) = self.mac.read_frame(p).await {
Either::First(p) => { rx_chan.rx_done(n);
if let Ok(n) = self.mac.read_frame(p).await { }
rx_chan.rx_done(n); }
} Either3::Second(p) => {
} self.mac.write_frame(p).await.ok();
Either::Second(p) => { tx_chan.tx_done();
self.mac.write_frame(p).await.ok(); }
tx_chan.tx_done(); Either3::Third(()) => {
} if self.mac.is_link_up().await {
state_chan.set_link_state(LinkState::Up);
} else {
state_chan.set_link_state(LinkState::Down);
} }
} }
} else {
state_chan.set_link_state(LinkState::Down);
} }
} }
} }

29
embassy-net/CHANGELOG.md Normal file
View File

@@ -0,0 +1,29 @@
# Changelog
All notable changes to this project will be documented in this file.
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
## 0.2.0 - 2023-10-18
- Re-export `smoltcp::wire::IpEndpoint`
- Add poll functions on UdpSocket
- Make dual-stack work in embassy-net
- Fix multicast support
- Allow ethernet and 802.15.4 to coexist
- Add IEEE802.15.4 address to embassy net Stack
- Use HardwareAddress in Driver
- Add async versions of smoltcp's `send` and `recv` closure based API
- add error translation to tcp errors
- Forward TCP/UDP socket capacity impls
- allow changing IP config at runtime
- allow non-'static drivers
- Remove impl_trait_projections
- update embedded-io, embedded-nal-async
- add support for dhcp hostname option
- Wake stack's task after queueing a DNS query
## 0.1.0 - 2023-06-29
- First release

View File

@@ -1,6 +1,6 @@
[package] [package]
name = "embassy-net" name = "embassy-net"
version = "0.1.0" version = "0.2.0"
edition = "2021" edition = "2021"
license = "MIT OR Apache-2.0" license = "MIT OR Apache-2.0"
description = "Async TCP/IP network stack for embedded systems" description = "Async TCP/IP network stack for embedded systems"
@@ -51,7 +51,7 @@ smoltcp = { version = "0.10.0", default-features = false, features = [
"async", "async",
] } ] }
embassy-net-driver = { version = "0.1.0", path = "../embassy-net-driver" } embassy-net-driver = { version = "0.2.0", path = "../embassy-net-driver" }
embassy-time = { version = "0.1.5", path = "../embassy-time" } embassy-time = { version = "0.1.5", path = "../embassy-time" }
embassy-sync = { version = "0.3.0", path = "../embassy-sync" } embassy-sync = { version = "0.3.0", path = "../embassy-sync" }
embedded-io-async = { version = "0.6.0", optional = true } embedded-io-async = { version = "0.6.0", optional = true }

View File

@@ -1,7 +1,7 @@
use core::task::Context; use core::task::Context;
use embassy_net_driver::{Capabilities, Checksum, Driver, Medium, RxToken, TxToken}; use embassy_net_driver::{Capabilities, Checksum, Driver, RxToken, TxToken};
use smoltcp::phy; use smoltcp::phy::{self, Medium};
use smoltcp::time::Instant; use smoltcp::time::Instant;
pub(crate) struct DriverAdapter<'d, 'c, T> pub(crate) struct DriverAdapter<'d, 'c, T>
@@ -11,6 +11,7 @@ where
// must be Some when actually using this to rx/tx // must be Some when actually using this to rx/tx
pub cx: Option<&'d mut Context<'c>>, pub cx: Option<&'d mut Context<'c>>,
pub inner: &'d mut T, pub inner: &'d mut T,
pub medium: Medium,
} }
impl<'d, 'c, T> phy::Device for DriverAdapter<'d, 'c, T> impl<'d, 'c, T> phy::Device for DriverAdapter<'d, 'c, T>
@@ -46,19 +47,7 @@ where
smolcaps.max_transmission_unit = caps.max_transmission_unit; smolcaps.max_transmission_unit = caps.max_transmission_unit;
smolcaps.max_burst_size = caps.max_burst_size; smolcaps.max_burst_size = caps.max_burst_size;
smolcaps.medium = match caps.medium { smolcaps.medium = self.medium;
#[cfg(feature = "medium-ethernet")]
Medium::Ethernet => phy::Medium::Ethernet,
#[cfg(feature = "medium-ip")]
Medium::Ip => phy::Medium::Ip,
#[cfg(feature = "medium-ieee802154")]
Medium::Ieee802154 => phy::Medium::Ieee802154,
#[allow(unreachable_patterns)]
_ => panic!(
"Unsupported medium {:?}. Make sure to enable it in embassy-net's Cargo features.",
caps.medium
),
};
smolcaps.checksum.ipv4 = convert(caps.checksum.ipv4); smolcaps.checksum.ipv4 = convert(caps.checksum.ipv4);
smolcaps.checksum.tcp = convert(caps.checksum.tcp); smolcaps.checksum.tcp = convert(caps.checksum.tcp);
smolcaps.checksum.udp = convert(caps.checksum.udp); smolcaps.checksum.udp = convert(caps.checksum.udp);

View File

@@ -33,6 +33,7 @@ use heapless::Vec;
pub use smoltcp::iface::MulticastError; pub use smoltcp::iface::MulticastError;
#[allow(unused_imports)] #[allow(unused_imports)]
use smoltcp::iface::{Interface, SocketHandle, SocketSet, SocketStorage}; use smoltcp::iface::{Interface, SocketHandle, SocketSet, SocketStorage};
use smoltcp::phy::Medium;
#[cfg(feature = "dhcpv4")] #[cfg(feature = "dhcpv4")]
use smoltcp::socket::dhcpv4::{self, RetryConfig}; use smoltcp::socket::dhcpv4::{self, RetryConfig};
#[cfg(feature = "medium-ethernet")] #[cfg(feature = "medium-ethernet")]
@@ -264,14 +265,17 @@ pub(crate) struct SocketStack {
next_local_port: u16, next_local_port: u16,
} }
fn to_smoltcp_hardware_address(addr: driver::HardwareAddress) -> HardwareAddress { fn to_smoltcp_hardware_address(addr: driver::HardwareAddress) -> (HardwareAddress, Medium) {
match addr { match addr {
#[cfg(feature = "medium-ethernet")] #[cfg(feature = "medium-ethernet")]
driver::HardwareAddress::Ethernet(eth) => HardwareAddress::Ethernet(EthernetAddress(eth)), driver::HardwareAddress::Ethernet(eth) => (HardwareAddress::Ethernet(EthernetAddress(eth)), Medium::Ethernet),
#[cfg(feature = "medium-ieee802154")] #[cfg(feature = "medium-ieee802154")]
driver::HardwareAddress::Ieee802154(ieee) => HardwareAddress::Ieee802154(Ieee802154Address::Extended(ieee)), driver::HardwareAddress::Ieee802154(ieee) => (
HardwareAddress::Ieee802154(Ieee802154Address::Extended(ieee)),
Medium::Ieee802154,
),
#[cfg(feature = "medium-ip")] #[cfg(feature = "medium-ip")]
driver::HardwareAddress::Ip => HardwareAddress::Ip, driver::HardwareAddress::Ip => (HardwareAddress::Ip, Medium::Ip),
#[allow(unreachable_patterns)] #[allow(unreachable_patterns)]
_ => panic!( _ => panic!(
@@ -289,7 +293,8 @@ impl<D: Driver> Stack<D> {
resources: &'static mut StackResources<SOCK>, resources: &'static mut StackResources<SOCK>,
random_seed: u64, random_seed: u64,
) -> Self { ) -> Self {
let mut iface_cfg = smoltcp::iface::Config::new(to_smoltcp_hardware_address(device.hardware_address())); let (hardware_addr, medium) = to_smoltcp_hardware_address(device.hardware_address());
let mut iface_cfg = smoltcp::iface::Config::new(hardware_addr);
iface_cfg.random_seed = random_seed; iface_cfg.random_seed = random_seed;
let iface = Interface::new( let iface = Interface::new(
@@ -297,6 +302,7 @@ impl<D: Driver> Stack<D> {
&mut DriverAdapter { &mut DriverAdapter {
inner: &mut device, inner: &mut device,
cx: None, cx: None,
medium,
}, },
instant_to_smoltcp(Instant::now()), instant_to_smoltcp(Instant::now()),
); );
@@ -356,7 +362,7 @@ impl<D: Driver> Stack<D> {
/// Get the hardware address of the network interface. /// Get the hardware address of the network interface.
pub fn hardware_address(&self) -> HardwareAddress { pub fn hardware_address(&self) -> HardwareAddress {
self.with(|_s, i| to_smoltcp_hardware_address(i.device.hardware_address())) self.with(|_s, i| to_smoltcp_hardware_address(i.device.hardware_address()).0)
} }
/// Get whether the link is up. /// Get whether the link is up.
@@ -812,18 +818,28 @@ impl<D: Driver> Inner<D> {
fn poll(&mut self, cx: &mut Context<'_>, s: &mut SocketStack) { fn poll(&mut self, cx: &mut Context<'_>, s: &mut SocketStack) {
s.waker.register(cx.waker()); s.waker.register(cx.waker());
let (_hardware_addr, medium) = to_smoltcp_hardware_address(self.device.hardware_address());
#[cfg(any(feature = "medium-ethernet", feature = "medium-ieee802154"))] #[cfg(any(feature = "medium-ethernet", feature = "medium-ieee802154"))]
if self.device.capabilities().medium == embassy_net_driver::Medium::Ethernet
|| self.device.capabilities().medium == embassy_net_driver::Medium::Ieee802154
{ {
s.iface let do_set = match medium {
.set_hardware_addr(to_smoltcp_hardware_address(self.device.hardware_address())); #[cfg(feature = "medium-ethernet")]
Medium::Ethernet => true,
#[cfg(feature = "medium-ieee802154")]
Medium::Ieee802154 => true,
#[allow(unreachable_patterns)]
_ => false,
};
if do_set {
s.iface.set_hardware_addr(_hardware_addr);
}
} }
let timestamp = instant_to_smoltcp(Instant::now()); let timestamp = instant_to_smoltcp(Instant::now());
let mut smoldev = DriverAdapter { let mut smoldev = DriverAdapter {
cx: Some(cx), cx: Some(cx),
inner: &mut self.device, inner: &mut self.device,
medium,
}; };
s.iface.poll(timestamp, &mut smoldev, &mut s.sockets); s.iface.poll(timestamp, &mut smoldev, &mut s.sockets);
@@ -844,6 +860,9 @@ impl<D: Driver> Inner<D> {
let socket = s.sockets.get_mut::<dhcpv4::Socket>(dhcp_handle); let socket = s.sockets.get_mut::<dhcpv4::Socket>(dhcp_handle);
if self.link_up { if self.link_up {
if old_link_up != self.link_up {
socket.reset();
}
match socket.poll() { match socket.poll() {
None => {} None => {}
Some(dhcpv4::Event::Deconfigured) => { Some(dhcpv4::Event::Deconfigured) => {

View File

@@ -213,6 +213,7 @@ impl<'d> Adc<'d, Async> {
ch: &mut Channel<'_>, ch: &mut Channel<'_>,
buf: &mut [W], buf: &mut [W],
fcs_err: bool, fcs_err: bool,
div: u16,
dma: impl Peripheral<P = impl dma::Channel>, dma: impl Peripheral<P = impl dma::Channel>,
) -> Result<(), Error> { ) -> Result<(), Error> {
let r = Self::regs(); let r = Self::regs();
@@ -258,6 +259,7 @@ impl<'d> Adc<'d, Async> {
// start conversions and wait for dma to finish. we can't report errors early // start conversions and wait for dma to finish. we can't report errors early
// because there's no interrupt to signal them, and inspecting every element // because there's no interrupt to signal them, and inspecting every element
// of the fifo is too costly to do here. // of the fifo is too costly to do here.
r.div().write_set(|w| w.set_int(div));
r.cs().write_set(|w| w.set_start_many(true)); r.cs().write_set(|w| w.set_start_many(true));
dma.await; dma.await;
mem::drop(auto_reset); mem::drop(auto_reset);
@@ -275,9 +277,10 @@ impl<'d> Adc<'d, Async> {
&mut self, &mut self,
ch: &mut Channel<'_>, ch: &mut Channel<'_>,
buf: &mut [S], buf: &mut [S],
div: u16,
dma: impl Peripheral<P = impl dma::Channel>, dma: impl Peripheral<P = impl dma::Channel>,
) -> Result<(), Error> { ) -> Result<(), Error> {
self.read_many_inner(ch, buf, false, dma).await self.read_many_inner(ch, buf, false, div, dma).await
} }
#[inline] #[inline]
@@ -285,11 +288,12 @@ impl<'d> Adc<'d, Async> {
&mut self, &mut self,
ch: &mut Channel<'_>, ch: &mut Channel<'_>,
buf: &mut [Sample], buf: &mut [Sample],
div: u16,
dma: impl Peripheral<P = impl dma::Channel>, dma: impl Peripheral<P = impl dma::Channel>,
) { ) {
// errors are reported in individual samples // errors are reported in individual samples
let _ = self let _ = self
.read_many_inner(ch, unsafe { mem::transmute::<_, &mut [u16]>(buf) }, true, dma) .read_many_inner(ch, unsafe { mem::transmute::<_, &mut [u16]>(buf) }, true, div, dma)
.await; .await;
} }
} }

View File

@@ -10,16 +10,39 @@ use crate::gpio::sealed::Pin as _;
use crate::gpio::{AnyPin, Pin as GpioPin}; use crate::gpio::{AnyPin, Pin as GpioPin};
use crate::{pac, peripherals, RegExt}; use crate::{pac, peripherals, RegExt};
/// The configuration of a PWM slice.
/// Note the period in clock cycles of a slice can be computed as:
/// `(top + 1) * (phase_correct ? 1 : 2) * divider`
#[non_exhaustive] #[non_exhaustive]
#[derive(Clone)] #[derive(Clone)]
pub struct Config { pub struct Config {
/// Inverts the PWM output signal on channel A.
pub invert_a: bool, pub invert_a: bool,
/// Inverts the PWM output signal on channel B.
pub invert_b: bool, pub invert_b: bool,
/// Enables phase-correct mode for PWM operation.
/// In phase-correct mode, the PWM signal is generated in such a way that
/// the pulse is always centered regardless of the duty cycle.
/// The output frequency is halved when phase-correct mode is enabled.
pub phase_correct: bool, pub phase_correct: bool,
/// Enables the PWM slice, allowing it to generate an output.
pub enable: bool, pub enable: bool,
/// A fractional clock divider, represented as a fixed-point number with
/// 8 integer bits and 4 fractional bits. It allows precise control over
/// the PWM output frequency by gating the PWM counter increment.
/// A higher value will result in a slower output frequency.
pub divider: fixed::FixedU16<fixed::types::extra::U4>, pub divider: fixed::FixedU16<fixed::types::extra::U4>,
/// The output on channel A goes high when `compare_a` is higher than the
/// counter. A compare of 0 will produce an always low output, while a
/// compare of `top + 1` will produce an always high output.
pub compare_a: u16, pub compare_a: u16,
/// The output on channel B goes high when `compare_b` is higher than the
/// counter. A compare of 0 will produce an always low output, while a
/// compare of `top + 1` will produce an always high output.
pub compare_b: u16, pub compare_b: u16,
/// The point at which the counter wraps, representing the maximum possible
/// period. The counter will either wrap to 0 or reverse depending on the
/// setting of `phase_correct`.
pub top: u16, pub top: u16,
} }
@@ -173,6 +196,9 @@ impl<'d, T: Channel> Pwm<'d, T> {
}); });
} }
/// Advances a slices output phase by one count while it is running
/// by inserting a pulse into the clock enable. The counter
/// will not count faster than once per cycle.
#[inline] #[inline]
pub fn phase_advance(&mut self) { pub fn phase_advance(&mut self) {
let p = self.inner.regs(); let p = self.inner.regs();
@@ -180,6 +206,9 @@ impl<'d, T: Channel> Pwm<'d, T> {
while p.csr().read().ph_adv() {} while p.csr().read().ph_adv() {}
} }
/// Retards a slices output phase by one count while it is running
/// by deleting a pulse from the clock enable. The counter will not
/// count backward when clock enable is permenantly low.
#[inline] #[inline]
pub fn phase_retard(&mut self) { pub fn phase_retard(&mut self) {
let p = self.inner.regs(); let p = self.inner.regs();

View File

@@ -17,7 +17,7 @@ embassy-time = { version = "0.1.5", path = "../embassy-time", optional = true }
embassy-futures = { version = "0.1.0", path = "../embassy-futures" } embassy-futures = { version = "0.1.0", path = "../embassy-futures" }
embassy-hal-internal = { version = "0.1.0", path = "../embassy-hal-internal" } embassy-hal-internal = { version = "0.1.0", path = "../embassy-hal-internal" }
embassy-embedded-hal = { version = "0.1.0", path = "../embassy-embedded-hal" } embassy-embedded-hal = { version = "0.1.0", path = "../embassy-embedded-hal" }
embassy-net-driver = { version = "0.1.0", path = "../embassy-net-driver", optional=true } embassy-net-driver = { version = "0.2.0", path = "../embassy-net-driver", optional=true }
defmt = { version = "0.3", optional = true } defmt = { version = "0.3", optional = true }
cortex-m = "0.7.6" cortex-m = "0.7.6"

View File

@@ -3,7 +3,7 @@
use core::task::Context; use core::task::Context;
use embassy_net_driver::{Capabilities, HardwareAddress, LinkState, Medium}; use embassy_net_driver::{Capabilities, HardwareAddress, LinkState};
use embassy_sync::blocking_mutex::raw::CriticalSectionRawMutex; use embassy_sync::blocking_mutex::raw::CriticalSectionRawMutex;
use embassy_sync::channel::Channel; use embassy_sync::channel::Channel;
@@ -60,24 +60,15 @@ impl<'d> embassy_net_driver::Driver for Driver<'d> {
let mut caps = Capabilities::default(); let mut caps = Capabilities::default();
caps.max_transmission_unit = MTU; caps.max_transmission_unit = MTU;
// caps.max_burst_size = Some(self.tx.len()); // caps.max_burst_size = Some(self.tx.len());
caps.medium = Medium::Ieee802154;
caps caps
} }
fn link_state(&mut self, _cx: &mut Context) -> LinkState { fn link_state(&mut self, _cx: &mut Context) -> LinkState {
// if self.phy.poll_link(&mut self.station_management, cx) {
// LinkState::Up
// } else {
// LinkState::Down
// }
LinkState::Down LinkState::Down
} }
fn hardware_address(&self) -> HardwareAddress { fn hardware_address(&self) -> HardwareAddress {
// self.mac_addr // self.mac_addr
HardwareAddress::Ieee802154([0; 8]) HardwareAddress::Ieee802154([0; 8])
} }
} }

View File

@@ -37,7 +37,7 @@ embassy-time = { version = "0.1.5", path = "../embassy-time", optional = true }
embassy-futures = { version = "0.1.0", path = "../embassy-futures" } embassy-futures = { version = "0.1.0", path = "../embassy-futures" }
embassy-hal-internal = {version = "0.1.0", path = "../embassy-hal-internal", features = ["cortex-m", "prio-bits-4"] } embassy-hal-internal = {version = "0.1.0", path = "../embassy-hal-internal", features = ["cortex-m", "prio-bits-4"] }
embassy-embedded-hal = {version = "0.1.0", path = "../embassy-embedded-hal" } embassy-embedded-hal = {version = "0.1.0", path = "../embassy-embedded-hal" }
embassy-net-driver = { version = "0.1.0", path = "../embassy-net-driver" } embassy-net-driver = { version = "0.2.0", path = "../embassy-net-driver" }
embassy-usb-driver = {version = "0.1.0", path = "../embassy-usb-driver", optional = true } embassy-usb-driver = {version = "0.1.0", path = "../embassy-usb-driver", optional = true }
embassy-executor = { version = "0.3.0", path = "../embassy-executor", optional = true } embassy-executor = { version = "0.3.0", path = "../embassy-executor", optional = true }
@@ -58,7 +58,7 @@ rand_core = "0.6.3"
sdio-host = "0.5.0" sdio-host = "0.5.0"
embedded-sdmmc = { git = "https://github.com/embassy-rs/embedded-sdmmc-rs", rev = "a4f293d3a6f72158385f79c98634cb8a14d0d2fc", optional = true } embedded-sdmmc = { git = "https://github.com/embassy-rs/embedded-sdmmc-rs", rev = "a4f293d3a6f72158385f79c98634cb8a14d0d2fc", optional = true }
critical-section = "1.1" critical-section = "1.1"
stm32-metapac = { git = "https://github.com/embassy-rs/stm32-data-generated", tag = "stm32-data-9330e31117668350a62572fdcd2598ec17d08042" } stm32-metapac = { git = "https://github.com/embassy-rs/stm32-data-generated", tag = "stm32-data-bcc9b6bf9fa195e91625849efc4ba473d9ace4e9" }
vcell = "0.1.3" vcell = "0.1.3"
bxcan = "0.7.0" bxcan = "0.7.0"
nb = "1.0.0" nb = "1.0.0"
@@ -76,7 +76,7 @@ critical-section = { version = "1.1", features = ["std"] }
[build-dependencies] [build-dependencies]
proc-macro2 = "1.0.36" proc-macro2 = "1.0.36"
quote = "1.0.15" quote = "1.0.15"
stm32-metapac = { git = "https://github.com/embassy-rs/stm32-data-generated", tag = "stm32-data-9330e31117668350a62572fdcd2598ec17d08042", default-features = false, features = ["metadata"]} stm32-metapac = { git = "https://github.com/embassy-rs/stm32-data-generated", tag = "stm32-data-bcc9b6bf9fa195e91625849efc4ba473d9ace4e9", default-features = false, features = ["metadata"]}
[features] [features]

View File

@@ -1,4 +1,4 @@
use std::collections::{HashMap, HashSet}; use std::collections::{BTreeMap, BTreeSet, HashMap, HashSet};
use std::fmt::Write as _; use std::fmt::Write as _;
use std::path::PathBuf; use std::path::PathBuf;
use std::{env, fs}; use std::{env, fs};
@@ -352,7 +352,7 @@ fn main() {
// ======== // ========
// Generate DMA IRQs. // Generate DMA IRQs.
let mut dma_irqs: HashMap<&str, Vec<(&str, &str, &str)>> = HashMap::new(); let mut dma_irqs: BTreeMap<&str, Vec<(&str, &str, &str)>> = BTreeMap::new();
for p in METADATA.peripherals { for p in METADATA.peripherals {
if let Some(r) = &p.registers { if let Some(r) = &p.registers {
@@ -371,22 +371,27 @@ fn main() {
} }
} }
for (irq, channels) in dma_irqs { let dma_irqs: TokenStream = dma_irqs
let irq = format_ident!("{}", irq); .iter()
.map(|(irq, channels)| {
let irq = format_ident!("{}", irq);
let xdma = format_ident!("{}", channels[0].0); let xdma = format_ident!("{}", channels[0].0);
let channels = channels.iter().map(|(_, dma, ch)| format_ident!("{}_{}", dma, ch)); let channels = channels.iter().map(|(_, dma, ch)| format_ident!("{}_{}", dma, ch));
g.extend(quote! { quote! {
#[cfg(feature = "rt")] #[cfg(feature = "rt")]
#[crate::interrupt] #[crate::interrupt]
unsafe fn #irq () { unsafe fn #irq () {
#( #(
<crate::peripherals::#channels as crate::dma::#xdma::sealed::Channel>::on_irq(); <crate::peripherals::#channels as crate::dma::#xdma::sealed::Channel>::on_irq();
)* )*
}
} }
}); })
} .collect();
g.extend(dma_irqs);
// ======== // ========
// Extract the rcc registers // Extract the rcc registers
@@ -433,7 +438,7 @@ fn main() {
// Generate RccPeripheral impls // Generate RccPeripheral impls
let refcounted_peripherals = HashSet::from(["usart", "adc"]); let refcounted_peripherals = HashSet::from(["usart", "adc"]);
let mut refcount_statics = HashSet::new(); let mut refcount_statics = BTreeSet::new();
for p in METADATA.peripherals { for p in METADATA.peripherals {
if !singletons.contains(&p.name.to_string()) { if !singletons.contains(&p.name.to_string()) {
@@ -466,15 +471,9 @@ fn main() {
let ptype = if let Some(reg) = &p.registers { reg.kind } else { "" }; let ptype = if let Some(reg) = &p.registers { reg.kind } else { "" };
let pname = format_ident!("{}", p.name); let pname = format_ident!("{}", p.name);
let clk = format_ident!( let clk = format_ident!("{}", rcc.clock);
"{}", let en_reg = format_ident!("{}", en.register);
rcc.clock let set_en_field = format_ident!("set_{}", en.field);
.to_ascii_lowercase()
.replace("ahb", "hclk")
.replace("apb", "pclk")
);
let en_reg = format_ident!("{}", en.register.to_ascii_lowercase());
let set_en_field = format_ident!("set_{}", en.field.to_ascii_lowercase());
let (before_enable, before_disable) = if refcounted_peripherals.contains(ptype) { let (before_enable, before_disable) = if refcounted_peripherals.contains(ptype) {
let refcount_static = let refcount_static =
@@ -500,11 +499,11 @@ fn main() {
(TokenStream::new(), TokenStream::new()) (TokenStream::new(), TokenStream::new())
}; };
let mux_supported = HashSet::from(["c0", "h5", "h50", "h7", "h7ab", "h7rm0433", "g4", "l4"])
.contains(rcc_registers.version);
let mux_for = |mux: Option<&'static PeripheralRccRegister>| { let mux_for = |mux: Option<&'static PeripheralRccRegister>| {
let checked_rccs = HashSet::from(["h5", "h50", "h7", "h7ab", "h7rm0433", "g4"]);
// restrict mux implementation to supported versions // restrict mux implementation to supported versions
if !checked_rccs.contains(rcc_registers.version) { if !mux_supported {
return None; return None;
} }
@@ -565,7 +564,7 @@ fn main() {
fn enable_and_reset_with_cs(_cs: critical_section::CriticalSection) { fn enable_and_reset_with_cs(_cs: critical_section::CriticalSection) {
#before_enable #before_enable
#[cfg(feature = "low-power")] #[cfg(feature = "low-power")]
crate::rcc::clock_refcount_add(_cs); unsafe { crate::rcc::REFCOUNT_STOP2 += 1 };
crate::pac::RCC.#en_reg().modify(|w| w.#set_en_field(true)); crate::pac::RCC.#en_reg().modify(|w| w.#set_en_field(true));
#after_enable #after_enable
#rst #rst
@@ -574,7 +573,7 @@ fn main() {
#before_disable #before_disable
crate::pac::RCC.#en_reg().modify(|w| w.#set_en_field(false)); crate::pac::RCC.#en_reg().modify(|w| w.#set_en_field(false));
#[cfg(feature = "low-power")] #[cfg(feature = "low-power")]
crate::rcc::clock_refcount_sub(_cs); unsafe { crate::rcc::REFCOUNT_STOP2 -= 1 };
} }
} }

View File

@@ -465,7 +465,7 @@ pub(crate) fn assert_not_corrupted_read(end_address: u32) {
feature = "stm32f439vg", feature = "stm32f439vg",
feature = "stm32f439zg", feature = "stm32f439zg",
))] ))]
if second_bank_read && unsafe { pac::DBGMCU.idcode().read().rev_id() < REVISION_3 && !pa12_is_output_pull_low() } { if second_bank_read && pac::DBGMCU.idcode().read().rev_id() < REVISION_3 && !pa12_is_output_pull_low() {
panic!("Read corruption for stm32f42xxG and stm32f43xxG in dual bank mode when PA12 is in use for chips below revision 3, see errata 2.2.11"); panic!("Read corruption for stm32f42xxG and stm32f43xxG in dual bank mode when PA12 is in use for chips below revision 3, see errata 2.2.11");
} }
} }

View File

@@ -763,6 +763,13 @@ pub(crate) unsafe fn init(_cs: CriticalSection) {
<crate::peripherals::AFIO as crate::rcc::sealed::RccPeripheral>::enable_and_reset_with_cs(_cs); <crate::peripherals::AFIO as crate::rcc::sealed::RccPeripheral>::enable_and_reset_with_cs(_cs);
crate::_generated::init_gpio(); crate::_generated::init_gpio();
// Setting this bit is mandatory to use PG[15:2].
#[cfg(stm32u5)]
crate::pac::PWR.svmcr().modify(|w| {
w.set_io2sv(true);
w.set_io2vmen(true);
});
} }
mod eh02 { mod eh02 {

View File

@@ -5,6 +5,7 @@ use core::task::Poll;
use self::sealed::Instance; use self::sealed::Instance;
use crate::interrupt; use crate::interrupt;
use crate::interrupt::typelevel::Interrupt; use crate::interrupt::typelevel::Interrupt;
use crate::pac::rcc::vals::{Lptim1sel, Lptim2sel};
use crate::peripherals::IPCC; use crate::peripherals::IPCC;
use crate::rcc::sealed::RccPeripheral; use crate::rcc::sealed::RccPeripheral;
@@ -273,7 +274,7 @@ fn _configure_pwr() {
// set LPTIM1 & LPTIM2 clock source // set LPTIM1 & LPTIM2 clock source
rcc.ccipr().modify(|w| { rcc.ccipr().modify(|w| {
w.set_lptim1sel(0b00); // PCLK w.set_lptim1sel(Lptim1sel::PCLK1);
w.set_lptim2sel(0b00); // PCLK w.set_lptim2sel(Lptim2sel::PCLK1);
}); });
} }

View File

@@ -226,9 +226,9 @@ pub fn init(config: Config) -> Peripherals {
time_driver::init(cs); time_driver::init(cs);
#[cfg(feature = "low-power")] #[cfg(feature = "low-power")]
while !crate::rcc::low_power_ready() { {
crate::rcc::clock_refcount_sub(cs); crate::rcc::REFCOUNT_STOP2 = 0
} };
} }
p p

View File

@@ -6,7 +6,6 @@ use cortex_m::peripheral::SCB;
use embassy_executor::*; use embassy_executor::*;
use crate::interrupt; use crate::interrupt;
use crate::rcc::low_power_ready;
use crate::time_driver::{get_driver, RtcDriver}; use crate::time_driver::{get_driver, RtcDriver};
const THREAD_PENDER: usize = usize::MAX; const THREAD_PENDER: usize = usize::MAX;
@@ -33,6 +32,15 @@ pub fn stop_with_rtc(rtc: &'static Rtc) {
unsafe { EXECUTOR.as_mut().unwrap() }.stop_with_rtc(rtc) unsafe { EXECUTOR.as_mut().unwrap() }.stop_with_rtc(rtc)
} }
pub fn stop_ready(stop_mode: StopMode) -> bool {
unsafe { EXECUTOR.as_mut().unwrap() }.stop_ready(stop_mode)
}
#[non_exhaustive]
pub enum StopMode {
Stop2,
}
/// Thread mode executor, using WFE/SEV. /// Thread mode executor, using WFE/SEV.
/// ///
/// This is the simplest and most common kind of executor. It runs on /// This is the simplest and most common kind of executor. It runs on
@@ -80,12 +88,18 @@ impl Executor {
trace!("low power: stop with rtc configured"); trace!("low power: stop with rtc configured");
} }
fn stop_ready(&self, stop_mode: StopMode) -> bool {
match stop_mode {
StopMode::Stop2 => unsafe { crate::rcc::REFCOUNT_STOP2 == 0 },
}
}
fn configure_pwr(&mut self) { fn configure_pwr(&mut self) {
self.scb.clear_sleepdeep(); self.scb.clear_sleepdeep();
compiler_fence(Ordering::SeqCst); compiler_fence(Ordering::SeqCst);
if !low_power_ready() { if !self.stop_ready(StopMode::Stop2) {
trace!("low power: not ready to stop"); trace!("low power: not ready to stop");
} else if self.time_driver.pause_time().is_err() { } else if self.time_driver.pause_time().is_err() {
trace!("low power: failed to pause time"); trace!("low power: failed to pause time");

View File

@@ -101,18 +101,22 @@ pub trait InvertingPin<T: Instance>: sealed::InvertingPin<T> {}
#[cfg(opamp_f3)] #[cfg(opamp_f3)]
macro_rules! impl_opamp_output { macro_rules! impl_opamp_output {
($inst:ident, $adc:ident, $ch:expr) => { ($inst:ident, $adc:ident, $ch:expr) => {
impl<'d, 'p, P: NonInvertingPin<crate::peripherals::$inst>> crate::adc::sealed::AdcPin<crate::peripherals::$adc> foreach_adc!(
for OpAmpOutput<'d, 'p, crate::peripherals::$inst, P> ($adc, $common_inst:ident, $adc_clock:ident) => {
{ impl<'d, 'p, P: NonInvertingPin<crate::peripherals::$inst>> crate::adc::sealed::AdcPin<crate::peripherals::$adc>
fn channel(&self) -> u8 { for OpAmpOutput<'d, 'p, crate::peripherals::$inst, P>
$ch {
} fn channel(&self) -> u8 {
} $ch
}
}
impl<'d, 'p, P: NonInvertingPin<crate::peripherals::$inst>> crate::adc::AdcPin<crate::peripherals::$adc> impl<'d, 'p, P: NonInvertingPin<crate::peripherals::$inst>> crate::adc::AdcPin<crate::peripherals::$adc>
for OpAmpOutput<'d, 'p, crate::peripherals::$inst, P> for OpAmpOutput<'d, 'p, crate::peripherals::$inst, P>
{ {
} }
};
);
}; };
} }

View File

@@ -134,6 +134,8 @@ pub(crate) unsafe fn init(config: Config) {
}; };
set_freqs(Clocks { set_freqs(Clocks {
hsi: None,
lse: None,
sys: sys_clk, sys: sys_clk,
hclk1: ahb_freq, hclk1: ahb_freq,
pclk1: apb_freq, pclk1: apb_freq,

View File

@@ -127,7 +127,7 @@ pub(crate) unsafe fn init(config: Config) {
} }
if config.usb_pll { if config.usb_pll {
RCC.cfgr3().modify(|w| w.set_usbsw(Usbsw::PLLCLK)); RCC.cfgr3().modify(|w| w.set_usbsw(Usbsw::PLL1_P));
} }
// TODO: Option to use CRS (Clock Recovery) // TODO: Option to use CRS (Clock Recovery)
@@ -140,7 +140,7 @@ pub(crate) unsafe fn init(config: Config) {
RCC.cfgr().modify(|w| { RCC.cfgr().modify(|w| {
w.set_ppre(Ppre::from_bits(ppre_bits)); w.set_ppre(Ppre::from_bits(ppre_bits));
w.set_hpre(Hpre::from_bits(hpre_bits)); w.set_hpre(Hpre::from_bits(hpre_bits));
w.set_sw(Sw::PLL) w.set_sw(Sw::PLL1_P)
}); });
} else { } else {
RCC.cfgr().modify(|w| { RCC.cfgr().modify(|w| {

View File

@@ -102,7 +102,6 @@ pub(crate) unsafe fn init(config: Config) {
assert!(pclk2 <= 72_000_000); assert!(pclk2 <= 72_000_000);
// Only needed for stm32f103?
FLASH.acr().write(|w| { FLASH.acr().write(|w| {
w.set_latency(if real_sysclk <= 24_000_000 { w.set_latency(if real_sysclk <= 24_000_000 {
Latency::WS0 Latency::WS0
@@ -111,6 +110,8 @@ pub(crate) unsafe fn init(config: Config) {
} else { } else {
Latency::WS2 Latency::WS2
}); });
// the prefetch buffer is enabled by default, let's keep it enabled
w.set_prftbe(true);
}); });
// the USB clock is only valid if an external crystal is used, the PLL is enabled, and the // the USB clock is only valid if an external crystal is used, the PLL is enabled, and the
@@ -168,7 +169,7 @@ pub(crate) unsafe fn init(config: Config) {
#[cfg(not(rcc_f100))] #[cfg(not(rcc_f100))]
w.set_usbpre(Usbpre::from_bits(usbpre as u8)); w.set_usbpre(Usbpre::from_bits(usbpre as u8));
w.set_sw(if pllmul_bits.is_some() { w.set_sw(if pllmul_bits.is_some() {
Sw::PLL Sw::PLL1_P
} else if config.hse.is_some() { } else if config.hse.is_some() {
Sw::HSE Sw::HSE
} else { } else {

View File

@@ -256,7 +256,7 @@ pub(crate) unsafe fn init(config: Config) {
ClockSrc::PLL => { ClockSrc::PLL => {
RCC.cr().modify(|w| w.set_pllon(true)); RCC.cr().modify(|w| w.set_pllon(true));
while !RCC.cr().read().pllrdy() {} while !RCC.cr().read().pllrdy() {}
(pll_clocks.main_freq, Sw::PLL) (pll_clocks.main_freq, Sw::PLL1_P)
} }
}; };
// RM0033 Figure 9. Clock tree suggests max SYSCLK/HCLK is 168 MHz, but datasheet specifies PLL // RM0033 Figure 9. Clock tree suggests max SYSCLK/HCLK is 168 MHz, but datasheet specifies PLL

View File

@@ -214,7 +214,7 @@ pub(crate) unsafe fn init(config: Config) {
// CFGR has been written before (PLL, PLL48, clock divider) don't overwrite these settings // CFGR has been written before (PLL, PLL48, clock divider) don't overwrite these settings
RCC.cfgr().modify(|w| { RCC.cfgr().modify(|w| {
w.set_sw(match (pll_config, config.hse) { w.set_sw(match (pll_config, config.hse) {
(Some(_), _) => Sw::PLL, (Some(_), _) => Sw::PLL1_P,
(None, Some(_)) => Sw::HSE, (None, Some(_)) => Sw::HSE,
(None, None) => Sw::HSI, (None, None) => Sw::HSI,
}) })
@@ -271,7 +271,7 @@ pub(crate) unsafe fn init(config: Config) {
pll_config.unwrap(); pll_config.unwrap();
assert!((pclk2 == sysclk) || (pclk2 * 2u32 == sysclk)); assert!((pclk2 == sysclk) || (pclk2 * 2u32 == sysclk));
RCC.cfgr3().modify(|w| w.set_hrtim1sw(Timsw::PLL)); RCC.cfgr3().modify(|w| w.set_hrtim1sw(Timsw::PLL1_P));
Some(sysclk * 2u32) Some(sysclk * 2u32)
} }

View File

@@ -1,400 +0,0 @@
use crate::pac::rcc::vals::{Hpre, Pllm, Plln, Pllq, Pllr, Ppre, Sw};
use crate::pac::{FLASH, PWR, RCC};
use crate::rcc::{set_freqs, Clocks};
use crate::time::Hertz;
/// HSI speed
pub const HSI_FREQ: Hertz = Hertz(16_000_000);
/// Clocks configuration
#[non_exhaustive]
#[derive(Default)]
pub struct Config {
pub hse: Option<Hertz>,
pub bypass_hse: bool,
pub hclk: Option<Hertz>,
pub sys_ck: Option<Hertz>,
pub pclk1: Option<Hertz>,
pub pclk2: Option<Hertz>,
#[cfg(not(any(stm32f410, stm32f411, stm32f412, stm32f413, stm32f423, stm32f446)))]
pub plli2s: Option<Hertz>,
#[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))]
pub pllsai: Option<Hertz>,
pub pll48: bool,
pub ls: super::LsConfig,
}
#[cfg(stm32f410)]
fn setup_i2s_pll(_vco_in: u32, _plli2s: Option<u32>) -> Option<u32> {
None
}
// Not currently implemented, but will be in the future
#[cfg(any(stm32f411, stm32f412, stm32f413, stm32f423, stm32f446))]
fn setup_i2s_pll(_vco_in: u32, _plli2s: Option<u32>) -> Option<u32> {
None
}
#[cfg(not(any(stm32f410, stm32f411, stm32f412, stm32f413, stm32f423)))]
fn calculate_sai_i2s_pll_values(vco_in: u32, max_div: u32, target: Option<u32>) -> Option<(u32, u32, u32)> {
let min_div = 2;
let target = match target {
Some(target) => target,
None => return None,
};
// We loop through the possible divider values to find the best configuration. Looping
// through all possible "N" values would result in more iterations.
let (n, outdiv, output, _error) = (min_div..=max_div)
.filter_map(|outdiv| {
let target_vco_out = match target.checked_mul(outdiv) {
Some(x) => x,
None => return None,
};
let n = (target_vco_out + (vco_in >> 1)) / vco_in;
let vco_out = vco_in * n;
if !(100_000_000..=432_000_000).contains(&vco_out) {
return None;
}
let output = vco_out / outdiv;
let error = (output as i32 - target as i32).unsigned_abs();
Some((n, outdiv, output, error))
})
.min_by_key(|(_, _, _, error)| *error)?;
Some((n, outdiv, output))
}
#[cfg(not(any(stm32f410, stm32f411, stm32f412, stm32f413, stm32f423, stm32f446)))]
fn setup_i2s_pll(vco_in: u32, plli2s: Option<u32>) -> Option<u32> {
let (n, outdiv, output) = calculate_sai_i2s_pll_values(vco_in, 7, plli2s)?;
RCC.plli2scfgr().modify(|w| {
w.set_plli2sn(n as u16);
w.set_plli2sr(outdiv as u8);
#[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))]
w.set_plli2sq(outdiv as u8); //set sai divider same as i2s
});
Some(output)
}
#[cfg(not(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479)))]
fn setup_sai_pll(_vco_in: u32, _pllsai: Option<u32>) -> Option<u32> {
None
}
#[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))]
fn setup_sai_pll(vco_in: u32, pllsai: Option<u32>) -> Option<u32> {
let (n, outdiv, output) = calculate_sai_i2s_pll_values(vco_in, 15, pllsai)?;
RCC.pllsaicfgr().modify(|w| {
w.set_pllsain(n as u16);
w.set_pllsaiq(outdiv as u8);
});
Some(output)
}
fn setup_pll(
pllsrcclk: u32,
use_hse: bool,
pllsysclk: Option<u32>,
plli2s: Option<u32>,
pllsai: Option<u32>,
pll48clk: bool,
) -> PllResults {
use crate::pac::rcc::vals::{Pllp, Pllsrc};
let sysclk = pllsysclk.unwrap_or(pllsrcclk);
if pllsysclk.is_none() && !pll48clk {
RCC.pllcfgr().modify(|w| w.set_pllsrc(Pllsrc::from_bits(use_hse as u8)));
return PllResults {
use_pll: false,
pllsysclk: None,
pll48clk: None,
plli2sclk: None,
pllsaiclk: None,
};
}
// Input divisor from PLL source clock, must result to frequency in
// the range from 1 to 2 MHz
let pllm_min = (pllsrcclk + 1_999_999) / 2_000_000;
let pllm_max = pllsrcclk / 1_000_000;
// Sysclk output divisor must be one of 2, 4, 6 or 8
let sysclk_div = core::cmp::min(8, (432_000_000 / sysclk) & !1);
let target_freq = if pll48clk { 48_000_000 } else { sysclk * sysclk_div };
// Find the lowest pllm value that minimize the difference between
// target frequency and the real vco_out frequency.
let pllm = unwrap!((pllm_min..=pllm_max).min_by_key(|pllm| {
let vco_in = pllsrcclk / pllm;
let plln = target_freq / vco_in;
target_freq - vco_in * plln
}));
let vco_in = pllsrcclk / pllm;
assert!((1_000_000..=2_000_000).contains(&vco_in));
// Main scaler, must result in >= 100MHz (>= 192MHz for F401)
// and <= 432MHz, min 50, max 432
let plln = if pll48clk {
// try the different valid pllq according to the valid
// main scaller values, and take the best
let pllq = unwrap!((4..=9).min_by_key(|pllq| {
let plln = 48_000_000 * pllq / vco_in;
let pll48_diff = 48_000_000 - vco_in * plln / pllq;
let sysclk_diff = (sysclk as i32 - (vco_in * plln / sysclk_div) as i32).abs();
(pll48_diff, sysclk_diff)
}));
48_000_000 * pllq / vco_in
} else {
sysclk * sysclk_div / vco_in
};
let pllp = (sysclk_div / 2) - 1;
let pllq = (vco_in * plln + 47_999_999) / 48_000_000;
let real_pll48clk = vco_in * plln / pllq;
RCC.pllcfgr().modify(|w| {
w.set_pllm(Pllm::from_bits(pllm as u8));
w.set_plln(Plln::from_bits(plln as u16));
w.set_pllp(Pllp::from_bits(pllp as u8));
w.set_pllq(Pllq::from_bits(pllq as u8));
w.set_pllsrc(Pllsrc::from_bits(use_hse as u8));
w.set_pllr(Pllr::from_bits(0));
});
let real_pllsysclk = vco_in * plln / sysclk_div;
PllResults {
use_pll: true,
pllsysclk: Some(real_pllsysclk),
pll48clk: if pll48clk { Some(real_pll48clk) } else { None },
plli2sclk: setup_i2s_pll(vco_in, plli2s),
pllsaiclk: setup_sai_pll(vco_in, pllsai),
}
}
fn flash_setup(sysclk: u32) {
use crate::pac::flash::vals::Latency;
// Be conservative with voltage ranges
const FLASH_LATENCY_STEP: u32 = 30_000_000;
critical_section::with(|_| {
FLASH
.acr()
.modify(|w| w.set_latency(Latency::from_bits(((sysclk - 1) / FLASH_LATENCY_STEP) as u8)));
});
}
pub(crate) unsafe fn init(config: Config) {
let pllsrcclk = config.hse.map(|hse| hse.0).unwrap_or(HSI_FREQ.0);
let sysclk = config.sys_ck.map(|sys| sys.0).unwrap_or(pllsrcclk);
let sysclk_on_pll = sysclk != pllsrcclk;
let plls = setup_pll(
pllsrcclk,
config.hse.is_some(),
if sysclk_on_pll { Some(sysclk) } else { None },
#[cfg(not(any(stm32f410, stm32f411, stm32f412, stm32f413, stm32f423, stm32f446)))]
config.plli2s.map(|i2s| i2s.0),
#[cfg(any(stm32f410, stm32f411, stm32f412, stm32f413, stm32f423, stm32f446))]
None,
#[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))]
config.pllsai.map(|sai| sai.0),
#[cfg(not(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479)))]
None,
config.pll48,
);
if config.pll48 {
let freq = unwrap!(plls.pll48clk);
assert!((max::PLL_48_CLK as i32 - freq as i32).abs() <= max::PLL_48_TOLERANCE as i32);
}
let sysclk = if sysclk_on_pll { unwrap!(plls.pllsysclk) } else { sysclk };
// AHB prescaler
let hclk = config.hclk.map(|h| h.0).unwrap_or(sysclk);
let (hpre_bits, hpre_div) = match (sysclk + hclk - 1) / hclk {
0 => unreachable!(),
1 => (Hpre::DIV1, 1),
2 => (Hpre::DIV2, 2),
3..=5 => (Hpre::DIV4, 4),
6..=11 => (Hpre::DIV8, 8),
12..=39 => (Hpre::DIV16, 16),
40..=95 => (Hpre::DIV64, 64),
96..=191 => (Hpre::DIV128, 128),
192..=383 => (Hpre::DIV256, 256),
_ => (Hpre::DIV512, 512),
};
// Calculate real AHB clock
let hclk = sysclk / hpre_div;
let pclk1 = config
.pclk1
.map(|p| p.0)
.unwrap_or_else(|| core::cmp::min(max::PCLK1_MAX, hclk));
let (ppre1_bits, ppre1) = match (hclk + pclk1 - 1) / pclk1 {
0 => unreachable!(),
1 => (0b000, 1),
2 => (0b100, 2),
3..=5 => (0b101, 4),
6..=11 => (0b110, 8),
_ => (0b111, 16),
};
let timer_mul1 = if ppre1 == 1 { 1 } else { 2 };
// Calculate real APB1 clock
let pclk1 = hclk / ppre1;
assert!(pclk1 <= max::PCLK1_MAX);
let pclk2 = config
.pclk2
.map(|p| p.0)
.unwrap_or_else(|| core::cmp::min(max::PCLK2_MAX, hclk));
let (ppre2_bits, ppre2) = match (hclk + pclk2 - 1) / pclk2 {
0 => unreachable!(),
1 => (0b000, 1),
2 => (0b100, 2),
3..=5 => (0b101, 4),
6..=11 => (0b110, 8),
_ => (0b111, 16),
};
let timer_mul2 = if ppre2 == 1 { 1 } else { 2 };
// Calculate real APB2 clock
let pclk2 = hclk / ppre2;
assert!(pclk2 <= max::PCLK2_MAX);
flash_setup(sysclk);
if config.hse.is_some() {
RCC.cr().modify(|w| {
w.set_hsebyp(config.bypass_hse);
w.set_hseon(true);
});
while !RCC.cr().read().hserdy() {}
}
if plls.use_pll {
RCC.cr().modify(|w| w.set_pllon(true));
if hclk > max::HCLK_OVERDRIVE_FREQUENCY {
PWR.cr1().modify(|w| w.set_oden(true));
while !PWR.csr1().read().odrdy() {}
PWR.cr1().modify(|w| w.set_odswen(true));
while !PWR.csr1().read().odswrdy() {}
}
while !RCC.cr().read().pllrdy() {}
}
#[cfg(not(stm32f410))]
if plls.plli2sclk.is_some() {
RCC.cr().modify(|w| w.set_plli2son(true));
while !RCC.cr().read().plli2srdy() {}
}
#[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))]
if plls.pllsaiclk.is_some() {
RCC.cr().modify(|w| w.set_pllsaion(true));
while !RCC.cr().read().pllsairdy() {}
}
RCC.cfgr().modify(|w| {
w.set_ppre2(Ppre::from_bits(ppre2_bits));
w.set_ppre1(Ppre::from_bits(ppre1_bits));
w.set_hpre(hpre_bits);
});
// Wait for the new prescalers to kick in
// "The clocks are divided with the new prescaler factor from 1 to 16 AHB cycles after write"
cortex_m::asm::delay(16);
RCC.cfgr().modify(|w| {
w.set_sw(if sysclk_on_pll {
Sw::PLL
} else if config.hse.is_some() {
Sw::HSE
} else {
Sw::HSI
})
});
let rtc = config.ls.init();
set_freqs(Clocks {
sys: Hertz(sysclk),
pclk1: Hertz(pclk1),
pclk2: Hertz(pclk2),
pclk1_tim: Hertz(pclk1 * timer_mul1),
pclk2_tim: Hertz(pclk2 * timer_mul2),
hclk1: Hertz(hclk),
hclk2: Hertz(hclk),
hclk3: Hertz(hclk),
pll1_q: plls.pll48clk.map(Hertz),
#[cfg(not(stm32f410))]
plli2s1_q: plls.plli2sclk.map(Hertz),
#[cfg(not(stm32f410))]
plli2s1_r: None,
#[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))]
pllsai1_q: plls.pllsaiclk.map(Hertz),
#[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))]
pllsai1_r: None,
rtc,
});
}
struct PllResults {
use_pll: bool,
pllsysclk: Option<u32>,
pll48clk: Option<u32>,
#[allow(dead_code)]
plli2sclk: Option<u32>,
#[allow(dead_code)]
pllsaiclk: Option<u32>,
}
mod max {
#[cfg(stm32f401)]
pub(crate) const SYSCLK_MAX: u32 = 84_000_000;
#[cfg(any(stm32f405, stm32f407, stm32f415, stm32f417,))]
pub(crate) const SYSCLK_MAX: u32 = 168_000_000;
#[cfg(any(stm32f410, stm32f411, stm32f412, stm32f413, stm32f423,))]
pub(crate) const SYSCLK_MAX: u32 = 100_000_000;
#[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479,))]
pub(crate) const SYSCLK_MAX: u32 = 180_000_000;
pub(crate) const HCLK_OVERDRIVE_FREQUENCY: u32 = 168_000_000;
pub(crate) const PCLK1_MAX: u32 = PCLK2_MAX / 2;
#[cfg(any(stm32f401, stm32f410, stm32f411, stm32f412, stm32f413, stm32f423,))]
pub(crate) const PCLK2_MAX: u32 = SYSCLK_MAX;
#[cfg(not(any(stm32f401, stm32f410, stm32f411, stm32f412, stm32f413, stm32f423,)))]
pub(crate) const PCLK2_MAX: u32 = SYSCLK_MAX / 2;
pub(crate) const PLL_48_CLK: u32 = 48_000_000;
pub(crate) const PLL_48_TOLERANCE: u32 = 120_000;
}

View File

@@ -0,0 +1,387 @@
pub use crate::pac::rcc::vals::{
Hpre as AHBPrescaler, Pllm as PllPreDiv, Plln as PllMul, Pllp, Pllq, Pllr, Pllsrc as PllSource,
Ppre as APBPrescaler, Sw as Sysclk,
};
use crate::pac::{FLASH, RCC};
use crate::rcc::{set_freqs, Clocks};
use crate::time::Hertz;
// TODO: on some F4s, PLLM is shared between all PLLs. Enforce that.
// TODO: on some F4s, add support for plli2s_src
//
// plli2s plli2s_m plli2s_src pllsai pllsai_m
// f401 y shared
// f410
// f411 y individual
// f412 y individual y
// f4[12]3 y individual y
// f446 y individual y individual
// f4[67]9 y shared y shared
// f4[23][79] y shared y shared
// f4[01][57] y shared
/// HSI speed
pub const HSI_FREQ: Hertz = Hertz(16_000_000);
#[derive(Clone, Copy, Eq, PartialEq)]
pub enum HseMode {
/// crystal/ceramic oscillator (HSEBYP=0)
Oscillator,
/// external analog clock (low swing) (HSEBYP=1)
Bypass,
}
#[derive(Clone, Copy, Eq, PartialEq)]
pub struct Hse {
/// HSE frequency.
pub freq: Hertz,
/// HSE mode.
pub mode: HseMode,
}
#[derive(Clone, Copy)]
pub struct Pll {
/// PLL pre-divider (DIVM).
pub prediv: PllPreDiv,
/// PLL multiplication factor.
pub mul: PllMul,
/// PLL P division factor. If None, PLL P output is disabled.
pub divp: Option<Pllp>,
/// PLL Q division factor. If None, PLL Q output is disabled.
pub divq: Option<Pllq>,
/// PLL R division factor. If None, PLL R output is disabled.
pub divr: Option<Pllr>,
}
/// Configuration of the core clocks
#[non_exhaustive]
pub struct Config {
pub hsi: bool,
pub hse: Option<Hse>,
pub sys: Sysclk,
pub pll_src: PllSource,
pub pll: Option<Pll>,
#[cfg(any(all(stm32f4, not(stm32f410)), stm32f7))]
pub plli2s: Option<Pll>,
#[cfg(any(stm32f446, stm32f427, stm32f437, stm32f4x9, stm32f7))]
pub pllsai: Option<Pll>,
pub ahb_pre: AHBPrescaler,
pub apb1_pre: APBPrescaler,
pub apb2_pre: APBPrescaler,
pub ls: super::LsConfig,
}
impl Default for Config {
fn default() -> Self {
Self {
hsi: true,
hse: None,
sys: Sysclk::HSI,
pll_src: PllSource::HSI,
pll: None,
#[cfg(any(all(stm32f4, not(stm32f410)), stm32f7))]
plli2s: None,
#[cfg(any(stm32f446, stm32f427, stm32f437, stm32f4x9, stm32f7))]
pllsai: None,
ahb_pre: AHBPrescaler::DIV1,
apb1_pre: APBPrescaler::DIV1,
apb2_pre: APBPrescaler::DIV1,
ls: Default::default(),
}
}
}
pub(crate) unsafe fn init(config: Config) {
// always enable overdrive for now. Make it configurable in the future.
#[cfg(not(any(
stm32f401, stm32f410, stm32f411, stm32f412, stm32f413, stm32f423, stm32f405, stm32f407, stm32f415, stm32f417
)))]
{
use crate::pac::PWR;
PWR.cr1().modify(|w| w.set_oden(true));
while !PWR.csr1().read().odrdy() {}
PWR.cr1().modify(|w| w.set_odswen(true));
while !PWR.csr1().read().odswrdy() {}
}
// Configure HSI
let hsi = match config.hsi {
false => {
RCC.cr().modify(|w| w.set_hsion(false));
None
}
true => {
RCC.cr().modify(|w| w.set_hsion(true));
while !RCC.cr().read().hsirdy() {}
Some(HSI_FREQ)
}
};
// Configure HSE
let hse = match config.hse {
None => {
RCC.cr().modify(|w| w.set_hseon(false));
None
}
Some(hse) => {
match hse.mode {
HseMode::Bypass => assert!(max::HSE_BYP.contains(&hse.freq)),
HseMode::Oscillator => assert!(max::HSE_OSC.contains(&hse.freq)),
}
RCC.cr().modify(|w| w.set_hsebyp(hse.mode != HseMode::Oscillator));
RCC.cr().modify(|w| w.set_hseon(true));
while !RCC.cr().read().hserdy() {}
Some(hse.freq)
}
};
// Configure PLLs.
let pll_input = PllInput {
hse,
hsi,
source: config.pll_src,
};
let pll = init_pll(PllInstance::Pll, config.pll, &pll_input);
#[cfg(any(all(stm32f4, not(any(stm32f410, stm32f429))), stm32f7))]
let _plli2s = init_pll(PllInstance::Plli2s, config.plli2s, &pll_input);
#[cfg(all(any(stm32f446, stm32f427, stm32f437, stm32f4x9, stm32f7), not(stm32f429)))]
let _pllsai = init_pll(PllInstance::Pllsai, config.pllsai, &pll_input);
// Configure sysclk
let sys = match config.sys {
Sysclk::HSI => unwrap!(hsi),
Sysclk::HSE => unwrap!(hse),
Sysclk::PLL1_P => unwrap!(pll.p),
_ => unreachable!(),
};
let hclk = sys / config.ahb_pre;
let (pclk1, pclk1_tim) = super::util::calc_pclk(hclk, config.apb1_pre);
let (pclk2, pclk2_tim) = super::util::calc_pclk(hclk, config.apb2_pre);
assert!(max::SYSCLK.contains(&sys));
assert!(max::HCLK.contains(&hclk));
assert!(max::PCLK1.contains(&pclk1));
assert!(max::PCLK2.contains(&pclk2));
let rtc = config.ls.init();
flash_setup(hclk);
RCC.cfgr().modify(|w| {
w.set_sw(config.sys);
w.set_hpre(config.ahb_pre);
w.set_ppre1(config.apb1_pre);
w.set_ppre2(config.apb2_pre);
});
while RCC.cfgr().read().sws() != config.sys {}
set_freqs(Clocks {
sys,
hclk1: hclk,
hclk2: hclk,
hclk3: hclk,
pclk1,
pclk2,
pclk1_tim,
pclk2_tim,
rtc,
pll1_q: pll.q,
#[cfg(all(rcc_f4, not(any(stm32f410, stm32f429))))]
plli2s1_q: _plli2s.q,
#[cfg(all(rcc_f4, not(any(stm32f410, stm32f429))))]
plli2s1_r: _plli2s.r,
#[cfg(stm32f429)]
plli2s1_q: None,
#[cfg(stm32f429)]
plli2s1_r: None,
#[cfg(any(stm32f427, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))]
pllsai1_q: _pllsai.q,
#[cfg(any(stm32f427, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))]
pllsai1_r: _pllsai.r,
#[cfg(stm32f429)]
pllsai1_q: None,
#[cfg(stm32f429)]
pllsai1_r: None,
});
}
struct PllInput {
source: PllSource,
hsi: Option<Hertz>,
hse: Option<Hertz>,
}
#[derive(Default)]
#[allow(unused)]
struct PllOutput {
p: Option<Hertz>,
q: Option<Hertz>,
r: Option<Hertz>,
}
#[allow(dead_code)]
#[derive(PartialEq, Eq, Clone, Copy)]
enum PllInstance {
Pll,
#[cfg(any(all(stm32f4, not(stm32f410)), stm32f7))]
Plli2s,
#[cfg(any(stm32f446, stm32f427, stm32f437, stm32f4x9, stm32f7))]
Pllsai,
}
fn pll_enable(instance: PllInstance, enabled: bool) {
match instance {
PllInstance::Pll => {
RCC.cr().modify(|w| w.set_pllon(enabled));
while RCC.cr().read().pllrdy() != enabled {}
}
#[cfg(any(all(stm32f4, not(stm32f410)), stm32f7))]
PllInstance::Plli2s => {
RCC.cr().modify(|w| w.set_plli2son(enabled));
while RCC.cr().read().plli2srdy() != enabled {}
}
#[cfg(any(stm32f446, stm32f427, stm32f437, stm32f4x9, stm32f7))]
PllInstance::Pllsai => {
RCC.cr().modify(|w| w.set_pllsaion(enabled));
while RCC.cr().read().pllsairdy() != enabled {}
}
}
}
fn init_pll(instance: PllInstance, config: Option<Pll>, input: &PllInput) -> PllOutput {
// Disable PLL
pll_enable(instance, false);
let Some(pll) = config else { return PllOutput::default() };
let pll_src = match input.source {
PllSource::HSE => input.hse,
PllSource::HSI => input.hsi,
};
let pll_src = pll_src.unwrap();
let in_freq = pll_src / pll.prediv;
assert!(max::PLL_IN.contains(&in_freq));
let vco_freq = in_freq * pll.mul;
assert!(max::PLL_VCO.contains(&vco_freq));
let p = pll.divp.map(|div| vco_freq / div);
let q = pll.divq.map(|div| vco_freq / div);
let r = pll.divr.map(|div| vco_freq / div);
macro_rules! write_fields {
($w:ident) => {
$w.set_plln(pll.mul);
if let Some(divp) = pll.divp {
$w.set_pllp(divp);
}
if let Some(divq) = pll.divq {
$w.set_pllq(divq);
}
if let Some(divr) = pll.divr {
$w.set_pllr(divr);
}
};
}
match instance {
PllInstance::Pll => RCC.pllcfgr().write(|w| {
w.set_pllm(pll.prediv);
w.set_pllsrc(input.source);
write_fields!(w);
}),
#[cfg(any(all(stm32f4, not(stm32f410)), stm32f7))]
PllInstance::Plli2s => RCC.plli2scfgr().write(|w| {
write_fields!(w);
}),
#[cfg(any(stm32f446, stm32f427, stm32f437, stm32f4x9, stm32f7))]
PllInstance::Pllsai => RCC.pllsaicfgr().write(|w| {
write_fields!(w);
}),
}
// Enable PLL
pll_enable(instance, true);
PllOutput { p, q, r }
}
fn flash_setup(clk: Hertz) {
use crate::pac::flash::vals::Latency;
// Be conservative with voltage ranges
const FLASH_LATENCY_STEP: u32 = 30_000_000;
let latency = (clk.0 - 1) / FLASH_LATENCY_STEP;
debug!("flash: latency={}", latency);
let latency = Latency::from_bits(latency as u8);
FLASH.acr().write(|w| {
w.set_latency(latency);
});
while FLASH.acr().read().latency() != latency {}
}
#[cfg(stm32f7)]
mod max {
use core::ops::RangeInclusive;
use crate::time::Hertz;
pub(crate) const HSE_OSC: RangeInclusive<Hertz> = Hertz(4_000_000)..=Hertz(26_000_000);
pub(crate) const HSE_BYP: RangeInclusive<Hertz> = Hertz(1_000_000)..=Hertz(50_000_000);
pub(crate) const SYSCLK: RangeInclusive<Hertz> = Hertz(12_500_000)..=Hertz(216_000_000);
pub(crate) const HCLK: RangeInclusive<Hertz> = Hertz(12_500_000)..=Hertz(216_000_000);
pub(crate) const PCLK1: RangeInclusive<Hertz> = Hertz(12_500_000)..=Hertz(216_000_000 / 4);
pub(crate) const PCLK2: RangeInclusive<Hertz> = Hertz(12_500_000)..=Hertz(216_000_000 / 2);
pub(crate) const PLL_IN: RangeInclusive<Hertz> = Hertz(1_000_000)..=Hertz(2_100_000);
pub(crate) const PLL_VCO: RangeInclusive<Hertz> = Hertz(100_000_000)..=Hertz(432_000_000);
}
#[cfg(stm32f4)]
mod max {
use core::ops::RangeInclusive;
use crate::time::Hertz;
pub(crate) const HSE_OSC: RangeInclusive<Hertz> = Hertz(4_000_000)..=Hertz(26_000_000);
pub(crate) const HSE_BYP: RangeInclusive<Hertz> = Hertz(1_000_000)..=Hertz(50_000_000);
#[cfg(stm32f401)]
pub(crate) const SYSCLK: RangeInclusive<Hertz> = Hertz(0)..=Hertz(84_000_000);
#[cfg(any(stm32f405, stm32f407, stm32f415, stm32f417,))]
pub(crate) const SYSCLK: RangeInclusive<Hertz> = Hertz(0)..=Hertz(168_000_000);
#[cfg(any(stm32f410, stm32f411, stm32f412, stm32f413, stm32f423,))]
pub(crate) const SYSCLK: RangeInclusive<Hertz> = Hertz(0)..=Hertz(100_000_000);
#[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479,))]
pub(crate) const SYSCLK: RangeInclusive<Hertz> = Hertz(0)..=Hertz(180_000_000);
pub(crate) const HCLK: RangeInclusive<Hertz> = Hertz(0)..=Hertz(SYSCLK.end().0);
pub(crate) const PCLK1: RangeInclusive<Hertz> = Hertz(0)..=Hertz(PCLK2.end().0 / 2);
#[cfg(any(stm32f401, stm32f410, stm32f411, stm32f412, stm32f413, stm32f423,))]
pub(crate) const PCLK2: RangeInclusive<Hertz> = Hertz(0)..=Hertz(HCLK.end().0);
#[cfg(not(any(stm32f401, stm32f410, stm32f411, stm32f412, stm32f413, stm32f423,)))]
pub(crate) const PCLK2: RangeInclusive<Hertz> = Hertz(0)..=Hertz(HCLK.end().0 / 2);
pub(crate) const PLL_IN: RangeInclusive<Hertz> = Hertz(1_000_000)..=Hertz(2_100_000);
pub(crate) const PLL_VCO: RangeInclusive<Hertz> = Hertz(100_000_000)..=Hertz(432_000_000);
}

View File

@@ -1,305 +0,0 @@
use crate::pac::pwr::vals::Vos;
use crate::pac::rcc::vals::{Hpre, Pllm, Plln, Pllp, Pllq, Pllsrc, Ppre, Sw};
use crate::pac::{FLASH, PWR, RCC};
use crate::rcc::{set_freqs, Clocks};
use crate::time::Hertz;
/// HSI speed
pub const HSI_FREQ: Hertz = Hertz(16_000_000);
/// Clocks configuration
#[non_exhaustive]
#[derive(Default)]
pub struct Config {
pub hse: Option<Hertz>,
pub bypass_hse: bool,
pub hclk: Option<Hertz>,
pub sys_ck: Option<Hertz>,
pub pclk1: Option<Hertz>,
pub pclk2: Option<Hertz>,
pub pll48: bool,
pub ls: super::LsConfig,
}
fn setup_pll(pllsrcclk: u32, use_hse: bool, pllsysclk: Option<u32>, pll48clk: bool) -> PllResults {
let sysclk = pllsysclk.unwrap_or(pllsrcclk);
if pllsysclk.is_none() && !pll48clk {
RCC.pllcfgr().modify(|w| w.set_pllsrc(Pllsrc::from_bits(use_hse as u8)));
return PllResults {
use_pll: false,
pllsysclk: None,
pll48clk: None,
};
}
// Input divisor from PLL source clock, must result to frequency in
// the range from 1 to 2 MHz
let pllm_min = (pllsrcclk + 1_999_999) / 2_000_000;
let pllm_max = pllsrcclk / 1_000_000;
// Sysclk output divisor must be one of 2, 4, 6 or 8
let sysclk_div = core::cmp::min(8, (432_000_000 / sysclk) & !1);
let target_freq = if pll48clk { 48_000_000 } else { sysclk * sysclk_div };
// Find the lowest pllm value that minimize the difference between
// target frequency and the real vco_out frequency.
let pllm = unwrap!((pllm_min..=pllm_max).min_by_key(|pllm| {
let vco_in = pllsrcclk / pllm;
let plln = target_freq / vco_in;
target_freq - vco_in * plln
}));
let vco_in = pllsrcclk / pllm;
assert!((1_000_000..=2_000_000).contains(&vco_in));
// Main scaler, must result in >= 100MHz (>= 192MHz for F401)
// and <= 432MHz, min 50, max 432
let plln = if pll48clk {
// try the different valid pllq according to the valid
// main scaller values, and take the best
let pllq = unwrap!((4..=9).min_by_key(|pllq| {
let plln = 48_000_000 * pllq / vco_in;
let pll48_diff = 48_000_000 - vco_in * plln / pllq;
let sysclk_diff = (sysclk as i32 - (vco_in * plln / sysclk_div) as i32).abs();
(pll48_diff, sysclk_diff)
}));
48_000_000 * pllq / vco_in
} else {
sysclk * sysclk_div / vco_in
};
let pllp = (sysclk_div / 2) - 1;
let pllq = (vco_in * plln + 47_999_999) / 48_000_000;
let real_pll48clk = vco_in * plln / pllq;
RCC.pllcfgr().modify(|w| {
w.set_pllm(Pllm::from_bits(pllm as u8));
w.set_plln(Plln::from_bits(plln as u16));
w.set_pllp(Pllp::from_bits(pllp as u8));
w.set_pllq(Pllq::from_bits(pllq as u8));
w.set_pllsrc(Pllsrc::from_bits(use_hse as u8));
});
let real_pllsysclk = vco_in * plln / sysclk_div;
PllResults {
use_pll: true,
pllsysclk: Some(real_pllsysclk),
pll48clk: if pll48clk { Some(real_pll48clk) } else { None },
}
}
fn flash_setup(sysclk: u32) {
use crate::pac::flash::vals::Latency;
// Be conservative with voltage ranges
const FLASH_LATENCY_STEP: u32 = 30_000_000;
critical_section::with(|_| {
FLASH
.acr()
.modify(|w| w.set_latency(Latency::from_bits(((sysclk - 1) / FLASH_LATENCY_STEP) as u8)));
});
}
pub(crate) unsafe fn init(config: Config) {
if let Some(hse) = config.hse {
if config.bypass_hse {
assert!((max::HSE_BYPASS_MIN..=max::HSE_BYPASS_MAX).contains(&hse.0));
} else {
assert!((max::HSE_OSC_MIN..=max::HSE_OSC_MAX).contains(&hse.0));
}
}
let pllsrcclk = config.hse.map(|hse| hse.0).unwrap_or(HSI_FREQ.0);
let sysclk = config.sys_ck.map(|sys| sys.0).unwrap_or(pllsrcclk);
let sysclk_on_pll = sysclk != pllsrcclk;
assert!((max::SYSCLK_MIN..=max::SYSCLK_MAX).contains(&sysclk));
let plls = setup_pll(
pllsrcclk,
config.hse.is_some(),
if sysclk_on_pll { Some(sysclk) } else { None },
config.pll48,
);
if config.pll48 {
let freq = unwrap!(plls.pll48clk);
assert!((max::PLL_48_CLK as i32 - freq as i32).abs() <= max::PLL_48_TOLERANCE as i32);
}
let sysclk = if sysclk_on_pll { unwrap!(plls.pllsysclk) } else { sysclk };
// AHB prescaler
let hclk = config.hclk.map(|h| h.0).unwrap_or(sysclk);
let (hpre_bits, hpre_div) = match (sysclk + hclk - 1) / hclk {
0 => unreachable!(),
1 => (Hpre::DIV1, 1),
2 => (Hpre::DIV2, 2),
3..=5 => (Hpre::DIV4, 4),
6..=11 => (Hpre::DIV8, 8),
12..=39 => (Hpre::DIV16, 16),
40..=95 => (Hpre::DIV64, 64),
96..=191 => (Hpre::DIV128, 128),
192..=383 => (Hpre::DIV256, 256),
_ => (Hpre::DIV512, 512),
};
// Calculate real AHB clock
let hclk = sysclk / hpre_div;
assert!(hclk <= max::HCLK_MAX);
let pclk1 = config
.pclk1
.map(|p| p.0)
.unwrap_or_else(|| core::cmp::min(max::PCLK1_MAX, hclk));
let (ppre1_bits, ppre1) = match (hclk + pclk1 - 1) / pclk1 {
0 => unreachable!(),
1 => (0b000, 1),
2 => (0b100, 2),
3..=5 => (0b101, 4),
6..=11 => (0b110, 8),
_ => (0b111, 16),
};
let timer_mul1 = if ppre1 == 1 { 1 } else { 2 };
// Calculate real APB1 clock
let pclk1 = hclk / ppre1;
assert!((max::PCLK1_MIN..=max::PCLK1_MAX).contains(&pclk1));
let pclk2 = config
.pclk2
.map(|p| p.0)
.unwrap_or_else(|| core::cmp::min(max::PCLK2_MAX, hclk));
let (ppre2_bits, ppre2) = match (hclk + pclk2 - 1) / pclk2 {
0 => unreachable!(),
1 => (0b000, 1),
2 => (0b100, 2),
3..=5 => (0b101, 4),
6..=11 => (0b110, 8),
_ => (0b111, 16),
};
let timer_mul2 = if ppre2 == 1 { 1 } else { 2 };
// Calculate real APB2 clock
let pclk2 = hclk / ppre2;
assert!((max::PCLK2_MIN..=max::PCLK2_MAX).contains(&pclk2));
flash_setup(sysclk);
if config.hse.is_some() {
RCC.cr().modify(|w| {
w.set_hsebyp(config.bypass_hse);
w.set_hseon(true);
});
while !RCC.cr().read().hserdy() {}
}
if plls.use_pll {
RCC.cr().modify(|w| w.set_pllon(false));
// setup VOSScale
let vos_scale = if sysclk <= 144_000_000 {
3
} else if sysclk <= 168_000_000 {
2
} else {
1
};
PWR.cr1().modify(|w| {
w.set_vos(match vos_scale {
3 => Vos::SCALE3,
2 => Vos::SCALE2,
1 => Vos::SCALE1,
_ => panic!("Invalid VOS Scale."),
})
});
RCC.cr().modify(|w| w.set_pllon(true));
if hclk > max::HCLK_OVERDRIVE_FREQUENCY {
PWR.cr1().modify(|w| w.set_oden(true));
while !PWR.csr1().read().odrdy() {}
PWR.cr1().modify(|w| w.set_odswen(true));
while !PWR.csr1().read().odswrdy() {}
}
while !RCC.cr().read().pllrdy() {}
}
RCC.cfgr().modify(|w| {
w.set_ppre2(Ppre::from_bits(ppre2_bits));
w.set_ppre1(Ppre::from_bits(ppre1_bits));
w.set_hpre(hpre_bits);
});
// Wait for the new prescalers to kick in
// "The clocks are divided with the new prescaler factor from 1 to 16 AHB cycles after write"
cortex_m::asm::delay(16);
RCC.cfgr().modify(|w| {
w.set_sw(if sysclk_on_pll {
Sw::PLL
} else if config.hse.is_some() {
Sw::HSE
} else {
Sw::HSI
})
});
let rtc = config.ls.init();
set_freqs(Clocks {
sys: Hertz(sysclk),
pclk1: Hertz(pclk1),
pclk2: Hertz(pclk2),
pclk1_tim: Hertz(pclk1 * timer_mul1),
pclk2_tim: Hertz(pclk2 * timer_mul2),
hclk1: Hertz(hclk),
hclk2: Hertz(hclk),
hclk3: Hertz(hclk),
pll1_q: plls.pll48clk.map(Hertz),
rtc,
});
}
struct PllResults {
use_pll: bool,
pllsysclk: Option<u32>,
pll48clk: Option<u32>,
}
mod max {
pub(crate) const HSE_OSC_MIN: u32 = 4_000_000;
pub(crate) const HSE_OSC_MAX: u32 = 26_000_000;
pub(crate) const HSE_BYPASS_MIN: u32 = 1_000_000;
pub(crate) const HSE_BYPASS_MAX: u32 = 50_000_000;
pub(crate) const HCLK_MAX: u32 = 216_000_000;
pub(crate) const HCLK_OVERDRIVE_FREQUENCY: u32 = 180_000_000;
pub(crate) const SYSCLK_MIN: u32 = 12_500_000;
pub(crate) const SYSCLK_MAX: u32 = 216_000_000;
pub(crate) const PCLK1_MIN: u32 = SYSCLK_MIN;
pub(crate) const PCLK1_MAX: u32 = SYSCLK_MAX / 4;
pub(crate) const PCLK2_MIN: u32 = SYSCLK_MIN;
pub(crate) const PCLK2_MAX: u32 = SYSCLK_MAX / 2;
// USB specification allows +-0.25%
pub(crate) const PLL_48_CLK: u32 = 48_000_000;
pub(crate) const PLL_48_TOLERANCE: u32 = 120_000;
}

View File

@@ -1,7 +1,7 @@
use crate::pac::flash::vals::Latency; use crate::pac::flash::vals::Latency;
use crate::pac::rcc::vals::{self, Sw}; use crate::pac::rcc::vals::{self, Sw};
pub use crate::pac::rcc::vals::{ pub use crate::pac::rcc::vals::{
Hpre as AHBPrescaler, Hsidiv as HSI16Prescaler, Pllm, Plln, Pllp, Pllq, Pllr, Ppre as APBPrescaler, Hpre as AHBPrescaler, Hsidiv as HSIPrescaler, Pllm, Plln, Pllp, Pllq, Pllr, Ppre as APBPrescaler,
}; };
use crate::pac::{FLASH, PWR, RCC}; use crate::pac::{FLASH, PWR, RCC};
use crate::rcc::{set_freqs, Clocks}; use crate::rcc::{set_freqs, Clocks};
@@ -14,7 +14,7 @@ pub const HSI_FREQ: Hertz = Hertz(16_000_000);
#[derive(Clone, Copy)] #[derive(Clone, Copy)]
pub enum ClockSrc { pub enum ClockSrc {
HSE(Hertz), HSE(Hertz),
HSI16(HSI16Prescaler), HSI(HSIPrescaler),
PLL(PllConfig), PLL(PllConfig),
LSI, LSI,
} }
@@ -46,9 +46,9 @@ pub struct PllConfig {
impl Default for PllConfig { impl Default for PllConfig {
#[inline] #[inline]
fn default() -> PllConfig { fn default() -> PllConfig {
// HSI16 / 1 * 8 / 2 = 64 MHz // HSI / 1 * 8 / 2 = 64 MHz
PllConfig { PllConfig {
source: PllSrc::HSI16, source: PllSrc::HSI,
m: Pllm::DIV1, m: Pllm::DIV1,
n: Plln::MUL8, n: Plln::MUL8,
r: Pllr::DIV2, r: Pllr::DIV2,
@@ -60,7 +60,7 @@ impl Default for PllConfig {
#[derive(Clone, Copy, Eq, PartialEq)] #[derive(Clone, Copy, Eq, PartialEq)]
pub enum PllSrc { pub enum PllSrc {
HSI16, HSI,
HSE(Hertz), HSE(Hertz),
} }
@@ -77,7 +77,7 @@ impl Default for Config {
#[inline] #[inline]
fn default() -> Config { fn default() -> Config {
Config { Config {
mux: ClockSrc::HSI16(HSI16Prescaler::DIV1), mux: ClockSrc::HSI(HSIPrescaler::DIV1),
ahb_pre: AHBPrescaler::DIV1, ahb_pre: AHBPrescaler::DIV1,
apb_pre: APBPrescaler::DIV1, apb_pre: APBPrescaler::DIV1,
low_power_run: false, low_power_run: false,
@@ -89,7 +89,7 @@ impl Default for Config {
impl PllConfig { impl PllConfig {
pub(crate) fn init(self) -> Hertz { pub(crate) fn init(self) -> Hertz {
let (src, input_freq) = match self.source { let (src, input_freq) = match self.source {
PllSrc::HSI16 => (vals::Pllsrc::HSI, HSI_FREQ), PllSrc::HSI => (vals::Pllsrc::HSI, HSI_FREQ),
PllSrc::HSE(freq) => (vals::Pllsrc::HSE, freq), PllSrc::HSE(freq) => (vals::Pllsrc::HSE, freq),
}; };
@@ -121,7 +121,7 @@ impl PllConfig {
// > 3. Change the desired parameter. // > 3. Change the desired parameter.
// Enable whichever clock source we're using, and wait for it to become ready // Enable whichever clock source we're using, and wait for it to become ready
match self.source { match self.source {
PllSrc::HSI16 => { PllSrc::HSI => {
RCC.cr().write(|w| w.set_hsion(true)); RCC.cr().write(|w| w.set_hsion(true));
while !RCC.cr().read().hsirdy() {} while !RCC.cr().read().hsirdy() {}
} }
@@ -167,8 +167,8 @@ impl PllConfig {
pub(crate) unsafe fn init(config: Config) { pub(crate) unsafe fn init(config: Config) {
let (sys_clk, sw) = match config.mux { let (sys_clk, sw) = match config.mux {
ClockSrc::HSI16(div) => { ClockSrc::HSI(div) => {
// Enable HSI16 // Enable HSI
RCC.cr().write(|w| { RCC.cr().write(|w| {
w.set_hsidiv(div); w.set_hsidiv(div);
w.set_hsion(true) w.set_hsion(true)

View File

@@ -18,14 +18,14 @@ pub const HSI_FREQ: Hertz = Hertz(16_000_000);
#[derive(Clone, Copy)] #[derive(Clone, Copy)]
pub enum ClockSrc { pub enum ClockSrc {
HSE(Hertz), HSE(Hertz),
HSI16, HSI,
PLL, PLL,
} }
/// PLL clock input source /// PLL clock input source
#[derive(Clone, Copy, Debug)] #[derive(Clone, Copy, Debug)]
pub enum PllSrc { pub enum PllSrc {
HSI16, HSI,
HSE(Hertz), HSE(Hertz),
} }
@@ -33,7 +33,7 @@ impl Into<Pllsrc> for PllSrc {
fn into(self) -> Pllsrc { fn into(self) -> Pllsrc {
match self { match self {
PllSrc::HSE(..) => Pllsrc::HSE, PllSrc::HSE(..) => Pllsrc::HSE,
PllSrc::HSI16 => Pllsrc::HSI, PllSrc::HSI => Pllsrc::HSI,
} }
} }
} }
@@ -112,7 +112,7 @@ impl Default for Config {
#[inline] #[inline]
fn default() -> Config { fn default() -> Config {
Config { Config {
mux: ClockSrc::HSI16, mux: ClockSrc::HSI,
ahb_pre: AHBPrescaler::DIV1, ahb_pre: AHBPrescaler::DIV1,
apb1_pre: APBPrescaler::DIV1, apb1_pre: APBPrescaler::DIV1,
apb2_pre: APBPrescaler::DIV1, apb2_pre: APBPrescaler::DIV1,
@@ -135,7 +135,7 @@ pub struct PllFreq {
pub(crate) unsafe fn init(config: Config) { pub(crate) unsafe fn init(config: Config) {
let pll_freq = config.pll.map(|pll_config| { let pll_freq = config.pll.map(|pll_config| {
let src_freq = match pll_config.source { let src_freq = match pll_config.source {
PllSrc::HSI16 => { PllSrc::HSI => {
RCC.cr().write(|w| w.set_hsion(true)); RCC.cr().write(|w| w.set_hsion(true));
while !RCC.cr().read().hsirdy() {} while !RCC.cr().read().hsirdy() {}
@@ -196,8 +196,8 @@ pub(crate) unsafe fn init(config: Config) {
}); });
let (sys_clk, sw) = match config.mux { let (sys_clk, sw) = match config.mux {
ClockSrc::HSI16 => { ClockSrc::HSI => {
// Enable HSI16 // Enable HSI
RCC.cr().write(|w| w.set_hsion(true)); RCC.cr().write(|w| w.set_hsion(true));
while !RCC.cr().read().hsirdy() {} while !RCC.cr().read().hsirdy() {}

View File

@@ -6,8 +6,11 @@ use crate::pac::pwr::vals::Vos;
pub use crate::pac::rcc::vals::Adcdacsel as AdcClockSource; pub use crate::pac::rcc::vals::Adcdacsel as AdcClockSource;
#[cfg(stm32h7)] #[cfg(stm32h7)]
pub use crate::pac::rcc::vals::Adcsel as AdcClockSource; pub use crate::pac::rcc::vals::Adcsel as AdcClockSource;
use crate::pac::rcc::vals::{Ckpersel, Hsidiv, Pllrge, Pllsrc, Pllvcosel, Sw, Timpre}; pub use crate::pac::rcc::vals::{
pub use crate::pac::rcc::vals::{Ckpersel as PerClockSource, Plldiv as PllDiv, Pllm as PllPreDiv, Plln as PllMul}; Ckpersel as PerClockSource, Hsidiv as HSIPrescaler, Plldiv as PllDiv, Pllm as PllPreDiv, Plln as PllMul,
Pllsrc as PllSource, Sw as Sysclk,
};
use crate::pac::rcc::vals::{Ckpersel, Pllrge, Pllvcosel, Timpre};
use crate::pac::{FLASH, PWR, RCC}; use crate::pac::{FLASH, PWR, RCC};
use crate::rcc::{set_freqs, Clocks}; use crate::rcc::{set_freqs, Clocks};
use crate::time::Hertz; use crate::time::Hertz;
@@ -58,50 +61,9 @@ pub struct Hse {
pub mode: HseMode, pub mode: HseMode,
} }
#[cfg(stm32h7)]
#[derive(Clone, Copy, Eq, PartialEq)]
pub enum Lse {
/// 32.768 kHz crystal/ceramic oscillator (LSEBYP=0)
Oscillator,
/// external clock input up to 1MHz (LSEBYP=1)
Bypass(Hertz),
}
#[derive(Clone, Copy, Eq, PartialEq)]
pub enum Hsi {
/// 64Mhz
Mhz64,
/// 32Mhz (divided by 2)
Mhz32,
/// 16Mhz (divided by 4)
Mhz16,
/// 8Mhz (divided by 8)
Mhz8,
}
#[derive(Clone, Copy, Eq, PartialEq)]
pub enum Sysclk {
/// HSI selected as sysclk
HSI,
/// HSE selected as sysclk
HSE,
/// CSI selected as sysclk
CSI,
/// PLL1_P selected as sysclk
Pll1P,
}
#[derive(Clone, Copy, Eq, PartialEq)]
pub enum PllSource {
Hsi,
Csi,
Hse,
}
#[derive(Clone, Copy)] #[derive(Clone, Copy)]
pub struct Pll { pub struct Pll {
/// Source clock selection. /// Source clock selection.
#[cfg(stm32h5)]
pub source: PllSource, pub source: PllSource,
/// PLL pre-divider (DIVM). /// PLL pre-divider (DIVM).
@@ -161,15 +123,12 @@ impl From<TimerPrescaler> for Timpre {
/// Configuration of the core clocks /// Configuration of the core clocks
#[non_exhaustive] #[non_exhaustive]
pub struct Config { pub struct Config {
pub hsi: Option<Hsi>, pub hsi: Option<HSIPrescaler>,
pub hse: Option<Hse>, pub hse: Option<Hse>,
pub csi: bool, pub csi: bool,
pub hsi48: bool, pub hsi48: bool,
pub sys: Sysclk, pub sys: Sysclk,
#[cfg(stm32h7)]
pub pll_src: PllSource,
pub pll1: Option<Pll>, pub pll1: Option<Pll>,
pub pll2: Option<Pll>, pub pll2: Option<Pll>,
#[cfg(any(rcc_h5, stm32h7))] #[cfg(any(rcc_h5, stm32h7))]
@@ -193,13 +152,11 @@ pub struct Config {
impl Default for Config { impl Default for Config {
fn default() -> Self { fn default() -> Self {
Self { Self {
hsi: Some(Hsi::Mhz64), hsi: Some(HSIPrescaler::DIV1),
hse: None, hse: None,
csi: false, csi: false,
hsi48: false, hsi48: false,
sys: Sysclk::HSI, sys: Sysclk::HSI,
#[cfg(stm32h7)]
pll_src: PllSource::Hsi,
pll1: None, pll1: None,
pll2: None, pll2: None,
#[cfg(any(rcc_h5, stm32h7))] #[cfg(any(rcc_h5, stm32h7))]
@@ -312,19 +269,13 @@ pub(crate) unsafe fn init(config: Config) {
RCC.cr().modify(|w| w.set_hsion(false)); RCC.cr().modify(|w| w.set_hsion(false));
None None
} }
Some(hsi) => { Some(hsidiv) => {
let (freq, hsidiv) = match hsi {
Hsi::Mhz64 => (HSI_FREQ / 1u32, Hsidiv::DIV1),
Hsi::Mhz32 => (HSI_FREQ / 2u32, Hsidiv::DIV2),
Hsi::Mhz16 => (HSI_FREQ / 4u32, Hsidiv::DIV4),
Hsi::Mhz8 => (HSI_FREQ / 8u32, Hsidiv::DIV8),
};
RCC.cr().modify(|w| { RCC.cr().modify(|w| {
w.set_hsidiv(hsidiv); w.set_hsidiv(hsidiv);
w.set_hsion(true); w.set_hsion(true);
}); });
while !RCC.cr().read().hsirdy() {} while !RCC.cr().read().hsirdy() {}
Some(freq) Some(HSI_FREQ / hsidiv)
} }
}; };
@@ -369,25 +320,29 @@ pub(crate) unsafe fn init(config: Config) {
} }
}; };
// H7 has shared PLLSRC, check it's equal in all PLLs.
#[cfg(stm32h7)]
{
let plls = [&config.pll1, &config.pll2, &config.pll3];
if !super::util::all_equal(plls.into_iter().flatten().map(|p| p.source)) {
panic!("Source must be equal across all enabled PLLs.")
};
}
// Configure PLLs. // Configure PLLs.
let pll_input = PllInput { let pll_input = PllInput { csi, hse, hsi };
csi,
hse,
hsi,
#[cfg(stm32h7)]
source: config.pll_src,
};
let pll1 = init_pll(0, config.pll1, &pll_input); let pll1 = init_pll(0, config.pll1, &pll_input);
let pll2 = init_pll(1, config.pll2, &pll_input); let pll2 = init_pll(1, config.pll2, &pll_input);
#[cfg(any(rcc_h5, stm32h7))] #[cfg(any(rcc_h5, stm32h7))]
let pll3 = init_pll(2, config.pll3, &pll_input); let pll3 = init_pll(2, config.pll3, &pll_input);
// Configure sysclk // Configure sysclk
let (sys, sw) = match config.sys { let sys = match config.sys {
Sysclk::HSI => (unwrap!(hsi), Sw::HSI), Sysclk::HSI => unwrap!(hsi),
Sysclk::HSE => (unwrap!(hse), Sw::HSE), Sysclk::HSE => unwrap!(hse),
Sysclk::CSI => (unwrap!(csi), Sw::CSI), Sysclk::CSI => unwrap!(csi),
Sysclk::Pll1P => (unwrap!(pll1.p), Sw::PLL1_P), Sysclk::PLL1_P => unwrap!(pll1.p),
_ => unreachable!(),
}; };
// Check limits. // Check limits.
@@ -398,7 +353,14 @@ pub(crate) unsafe fn init(config: Config) {
VoltageScale::Scale2 => (Hertz(150_000_000), Hertz(150_000_000)), VoltageScale::Scale2 => (Hertz(150_000_000), Hertz(150_000_000)),
VoltageScale::Scale3 => (Hertz(100_000_000), Hertz(100_000_000)), VoltageScale::Scale3 => (Hertz(100_000_000), Hertz(100_000_000)),
}; };
#[cfg(stm32h7)] #[cfg(pwr_h7rm0455)]
let (d1cpre_clk_max, hclk_max, pclk_max) = match config.voltage_scale {
VoltageScale::Scale0 => (Hertz(280_000_000), Hertz(280_000_000), Hertz(140_000_000)),
VoltageScale::Scale1 => (Hertz(225_000_000), Hertz(225_000_000), Hertz(112_500_000)),
VoltageScale::Scale2 => (Hertz(160_000_000), Hertz(160_000_000), Hertz(80_000_000)),
VoltageScale::Scale3 => (Hertz(88_000_000), Hertz(88_000_000), Hertz(44_000_000)),
};
#[cfg(all(stm32h7, not(pwr_h7rm0455)))]
let (d1cpre_clk_max, hclk_max, pclk_max) = match config.voltage_scale { let (d1cpre_clk_max, hclk_max, pclk_max) = match config.voltage_scale {
VoltageScale::Scale0 => (Hertz(480_000_000), Hertz(240_000_000), Hertz(120_000_000)), VoltageScale::Scale0 => (Hertz(480_000_000), Hertz(240_000_000), Hertz(120_000_000)),
VoltageScale::Scale1 => (Hertz(400_000_000), Hertz(200_000_000), Hertz(100_000_000)), VoltageScale::Scale1 => (Hertz(400_000_000), Hertz(200_000_000), Hertz(100_000_000)),
@@ -504,8 +466,8 @@ pub(crate) unsafe fn init(config: Config) {
RCC.cfgr().modify(|w| w.set_timpre(config.timer_prescaler.into())); RCC.cfgr().modify(|w| w.set_timpre(config.timer_prescaler.into()));
RCC.cfgr().modify(|w| w.set_sw(sw)); RCC.cfgr().modify(|w| w.set_sw(config.sys));
while RCC.cfgr().read().sws() != sw {} while RCC.cfgr().read().sws() != config.sys {}
// IO compensation cell - Requires CSI clock and SYSCFG // IO compensation cell - Requires CSI clock and SYSCFG
#[cfg(stm32h7)] // TODO h5 #[cfg(stm32h7)] // TODO h5
@@ -590,8 +552,6 @@ struct PllInput {
hsi: Option<Hertz>, hsi: Option<Hertz>,
hse: Option<Hertz>, hse: Option<Hertz>,
csi: Option<Hertz>, csi: Option<Hertz>,
#[cfg(stm32h7)]
source: PllSource,
} }
struct PllOutput { struct PllOutput {
@@ -621,15 +581,11 @@ fn init_pll(num: usize, config: Option<Pll>, input: &PllInput) -> PllOutput {
}; };
}; };
#[cfg(stm32h5)] let in_clk = match config.source {
let source = config.source; PllSource::DISABLE => panic!("must not set PllSource::Disable"),
#[cfg(stm32h7)] PllSource::HSI => unwrap!(input.hsi),
let source = input.source; PllSource::HSE => unwrap!(input.hse),
PllSource::CSI => unwrap!(input.csi),
let (in_clk, src) = match source {
PllSource::Hsi => (unwrap!(input.hsi), Pllsrc::HSI),
PllSource::Hse => (unwrap!(input.hse), Pllsrc::HSE),
PllSource::Csi => (unwrap!(input.csi), Pllsrc::CSI),
}; };
let ref_clk = in_clk / config.prediv as u32; let ref_clk = in_clk / config.prediv as u32;
@@ -669,7 +625,7 @@ fn init_pll(num: usize, config: Option<Pll>, input: &PllInput) -> PllOutput {
#[cfg(stm32h5)] #[cfg(stm32h5)]
RCC.pllcfgr(num).write(|w| { RCC.pllcfgr(num).write(|w| {
w.set_pllsrc(src); w.set_pllsrc(config.source);
w.set_divm(config.prediv); w.set_divm(config.prediv);
w.set_pllvcosel(vco_range); w.set_pllvcosel(vco_range);
w.set_pllrge(ref_range); w.set_pllrge(ref_range);
@@ -683,7 +639,7 @@ fn init_pll(num: usize, config: Option<Pll>, input: &PllInput) -> PllOutput {
{ {
RCC.pllckselr().modify(|w| { RCC.pllckselr().modify(|w| {
w.set_divm(num, config.prediv); w.set_divm(num, config.prediv);
w.set_pllsrc(src); w.set_pllsrc(config.source);
}); });
RCC.pllcfgr().modify(|w| { RCC.pllcfgr().modify(|w| {
w.set_pllvcosel(num, vco_range); w.set_pllvcosel(num, vco_range);

View File

@@ -18,20 +18,20 @@ pub enum ClockSrc {
MSI(MSIRange), MSI(MSIRange),
PLL(PLLSource, PLLMul, PLLDiv), PLL(PLLSource, PLLMul, PLLDiv),
HSE(Hertz), HSE(Hertz),
HSI16, HSI,
} }
/// PLL clock input source /// PLL clock input source
#[derive(Clone, Copy)] #[derive(Clone, Copy)]
pub enum PLLSource { pub enum PLLSource {
HSI16, HSI,
HSE(Hertz), HSE(Hertz),
} }
impl From<PLLSource> for Pllsrc { impl From<PLLSource> for Pllsrc {
fn from(val: PLLSource) -> Pllsrc { fn from(val: PLLSource) -> Pllsrc {
match val { match val {
PLLSource::HSI16 => Pllsrc::HSI16, PLLSource::HSI => Pllsrc::HSI,
PLLSource::HSE(_) => Pllsrc::HSE, PLLSource::HSE(_) => Pllsrc::HSE,
} }
} }
@@ -83,12 +83,12 @@ pub(crate) unsafe fn init(config: Config) {
let freq = 32_768 * (1 << (range as u8 + 1)); let freq = 32_768 * (1 << (range as u8 + 1));
(Hertz(freq), Sw::MSI) (Hertz(freq), Sw::MSI)
} }
ClockSrc::HSI16 => { ClockSrc::HSI => {
// Enable HSI16 // Enable HSI
RCC.cr().write(|w| w.set_hsi16on(true)); RCC.cr().write(|w| w.set_hsion(true));
while !RCC.cr().read().hsi16rdy() {} while !RCC.cr().read().hsirdy() {}
(HSI_FREQ, Sw::HSI16) (HSI_FREQ, Sw::HSI)
} }
ClockSrc::HSE(freq) => { ClockSrc::HSE(freq) => {
// Enable HSE // Enable HSE
@@ -105,10 +105,10 @@ pub(crate) unsafe fn init(config: Config) {
while !RCC.cr().read().hserdy() {} while !RCC.cr().read().hserdy() {}
freq freq
} }
PLLSource::HSI16 => { PLLSource::HSI => {
// Enable HSI // Enable HSI
RCC.cr().write(|w| w.set_hsi16on(true)); RCC.cr().write(|w| w.set_hsion(true));
while !RCC.cr().read().hsi16rdy() {} while !RCC.cr().read().hsirdy() {}
HSI_FREQ HSI_FREQ
} }
}; };
@@ -131,7 +131,7 @@ pub(crate) unsafe fn init(config: Config) {
RCC.cr().modify(|w| w.set_pllon(true)); RCC.cr().modify(|w| w.set_pllon(true));
while !RCC.cr().read().pllrdy() {} while !RCC.cr().read().pllrdy() {}
(freq, Sw::PLL) (freq, Sw::PLL1_P)
} }
}; };
@@ -156,23 +156,9 @@ pub(crate) unsafe fn init(config: Config) {
w.set_ppre2(config.apb2_pre); w.set_ppre2(config.apb2_pre);
}); });
let ahb_freq = sys_clk / config.ahb_pre; let hclk1 = sys_clk / config.ahb_pre;
let (pclk1, pclk1_tim) = super::util::calc_pclk(hclk1, config.apb1_pre);
let (apb1_freq, apb1_tim_freq) = match config.apb1_pre { let (pclk2, pclk2_tim) = super::util::calc_pclk(hclk1, config.apb2_pre);
APBPrescaler::DIV1 => (ahb_freq, ahb_freq),
pre => {
let freq = ahb_freq / pre;
(freq, freq * 2u32)
}
};
let (apb2_freq, apb2_tim_freq) = match config.apb2_pre {
APBPrescaler::DIV1 => (ahb_freq, ahb_freq),
pre => {
let freq = ahb_freq / pre;
(freq, freq * 2u32)
}
};
#[cfg(crs)] #[cfg(crs)]
if config.enable_hsi48 { if config.enable_hsi48 {
@@ -209,11 +195,11 @@ pub(crate) unsafe fn init(config: Config) {
set_freqs(Clocks { set_freqs(Clocks {
sys: sys_clk, sys: sys_clk,
hclk1: ahb_freq, hclk1,
pclk1: apb1_freq, pclk1,
pclk2: apb2_freq, pclk2,
pclk1_tim: apb1_tim_freq, pclk1_tim,
pclk2_tim: apb2_tim_freq, pclk2_tim,
rtc, rtc,
}); });
} }

View File

@@ -1,8 +1,11 @@
use crate::pac::rcc::regs::Cfgr; use crate::pac::rcc::regs::Cfgr;
use crate::pac::rcc::vals::Msirgsel; #[cfg(any(stm32l4, stm32l5, stm32wb))]
pub use crate::pac::rcc::vals::Clk48sel as Clk48Src;
#[cfg(any(stm32wb, stm32wl))]
pub use crate::pac::rcc::vals::Hsepre as HsePrescaler;
pub use crate::pac::rcc::vals::{ pub use crate::pac::rcc::vals::{
Clk48sel as Clk48Src, Hpre as AHBPrescaler, Msirange as MSIRange, Pllm as PllPreDiv, Plln as PllMul, Hpre as AHBPrescaler, Msirange as MSIRange, Pllm as PllPreDiv, Plln as PllMul, Pllp as PllPDiv, Pllq as PllQDiv,
Pllp as PllPDiv, Pllq as PllQDiv, Pllr as PllRDiv, Pllsrc as PLLSource, Ppre as APBPrescaler, Sw as ClockSrc, Pllr as PllRDiv, Pllsrc as PLLSource, Ppre as APBPrescaler, Sw as ClockSrc,
}; };
use crate::pac::{FLASH, RCC}; use crate::pac::{FLASH, RCC};
use crate::rcc::{set_freqs, Clocks}; use crate::rcc::{set_freqs, Clocks};
@@ -11,6 +14,25 @@ use crate::time::Hertz;
/// HSI speed /// HSI speed
pub const HSI_FREQ: Hertz = Hertz(16_000_000); pub const HSI_FREQ: Hertz = Hertz(16_000_000);
#[derive(Clone, Copy, Eq, PartialEq)]
pub enum HseMode {
/// crystal/ceramic oscillator (HSEBYP=0)
Oscillator,
/// external analog clock (low swing) (HSEBYP=1)
Bypass,
}
#[derive(Clone, Copy, Eq, PartialEq)]
pub struct Hse {
/// HSE frequency.
pub freq: Hertz,
/// HSE mode.
pub mode: HseMode,
/// HSE prescaler
#[cfg(any(stm32wb, stm32wl))]
pub prescaler: HsePrescaler,
}
#[derive(Clone, Copy)] #[derive(Clone, Copy)]
pub struct Pll { pub struct Pll {
/// PLL source /// PLL source
@@ -34,13 +56,14 @@ pub struct Pll {
pub struct Config { pub struct Config {
// base clock sources // base clock sources
pub msi: Option<MSIRange>, pub msi: Option<MSIRange>,
pub hsi16: bool, pub hsi: bool,
pub hse: Option<Hertz>, pub hse: Option<Hse>,
#[cfg(not(any(stm32l47x, stm32l48x)))] #[cfg(any(all(stm32l4, not(any(stm32l47x, stm32l48x))), stm32l5, stm32wb))]
pub hsi48: bool, pub hsi48: bool,
// pll // pll
pub pll: Option<Pll>, pub pll: Option<Pll>,
#[cfg(any(stm32l4, stm32l5, stm32wb))]
pub pllsai1: Option<Pll>, pub pllsai1: Option<Pll>,
#[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))] #[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))]
pub pllsai2: Option<Pll>, pub pllsai2: Option<Pll>,
@@ -50,8 +73,13 @@ pub struct Config {
pub ahb_pre: AHBPrescaler, pub ahb_pre: AHBPrescaler,
pub apb1_pre: APBPrescaler, pub apb1_pre: APBPrescaler,
pub apb2_pre: APBPrescaler, pub apb2_pre: APBPrescaler,
#[cfg(any(stm32wl5x, stm32wb))]
pub core2_ahb_pre: AHBPrescaler,
#[cfg(any(stm32wl, stm32wb))]
pub shared_ahb_pre: AHBPrescaler,
// muxes // muxes
#[cfg(any(stm32l4, stm32l5, stm32wb))]
pub clk48_src: Clk48Src, pub clk48_src: Clk48Src,
// low speed LSI/LSE/RTC // low speed LSI/LSE/RTC
@@ -63,30 +91,69 @@ impl Default for Config {
fn default() -> Config { fn default() -> Config {
Config { Config {
hse: None, hse: None,
hsi16: false, hsi: false,
msi: Some(MSIRange::RANGE4M), msi: Some(MSIRange::RANGE4M),
mux: ClockSrc::MSI, mux: ClockSrc::MSI,
ahb_pre: AHBPrescaler::DIV1, ahb_pre: AHBPrescaler::DIV1,
apb1_pre: APBPrescaler::DIV1, apb1_pre: APBPrescaler::DIV1,
apb2_pre: APBPrescaler::DIV1, apb2_pre: APBPrescaler::DIV1,
#[cfg(any(stm32wl5x, stm32wb))]
core2_ahb_pre: AHBPrescaler::DIV1,
#[cfg(any(stm32wl, stm32wb))]
shared_ahb_pre: AHBPrescaler::DIV1,
pll: None, pll: None,
#[cfg(any(stm32l4, stm32l5, stm32wb))]
pllsai1: None, pllsai1: None,
#[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))] #[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))]
pllsai2: None, pllsai2: None,
#[cfg(not(any(stm32l471, stm32l475, stm32l476, stm32l486)))] #[cfg(any(all(stm32l4, not(any(stm32l47x, stm32l48x))), stm32l5, stm32wb))]
hsi48: true, hsi48: true,
#[cfg(any(stm32l4, stm32l5, stm32wb))]
clk48_src: Clk48Src::HSI48, clk48_src: Clk48Src::HSI48,
ls: Default::default(), ls: Default::default(),
} }
} }
} }
#[cfg(stm32wb)]
pub const WPAN_DEFAULT: Config = Config {
hse: Some(Hse {
freq: Hertz(32_000_000),
mode: HseMode::Oscillator,
prescaler: HsePrescaler::DIV1,
}),
mux: ClockSrc::PLL1_R,
hsi48: true,
msi: None,
hsi: false,
clk48_src: Clk48Src::PLL1_Q,
ls: super::LsConfig::default_lse(),
pll: Some(Pll {
source: PLLSource::HSE,
prediv: PllPreDiv::DIV2,
mul: PllMul::MUL12,
divp: Some(PllPDiv::DIV3), // 32 / 2 * 12 / 3 = 64Mhz
divq: Some(PllQDiv::DIV4), // 32 / 2 * 12 / 4 = 48Mhz
divr: Some(PllRDiv::DIV3), // 32 / 2 * 12 / 3 = 64Mhz
}),
pllsai1: None,
ahb_pre: AHBPrescaler::DIV1,
core2_ahb_pre: AHBPrescaler::DIV2,
shared_ahb_pre: AHBPrescaler::DIV1,
apb1_pre: APBPrescaler::DIV1,
apb2_pre: APBPrescaler::DIV1,
};
pub(crate) unsafe fn init(config: Config) { pub(crate) unsafe fn init(config: Config) {
// Switch to MSI to prevent problems with PLL configuration. // Switch to MSI to prevent problems with PLL configuration.
if !RCC.cr().read().msion() { if !RCC.cr().read().msion() {
// Turn on MSI and configure it to 4MHz. // Turn on MSI and configure it to 4MHz.
RCC.cr().modify(|w| { RCC.cr().modify(|w| {
w.set_msirgsel(Msirgsel::CR); #[cfg(not(stm32wb))]
w.set_msirgsel(crate::pac::rcc::vals::Msirgsel::CR);
w.set_msirange(MSIRange::RANGE4M); w.set_msirange(MSIRange::RANGE4M);
w.set_msipllen(false); w.set_msipllen(false);
w.set_msion(true) w.set_msion(true)
@@ -111,9 +178,10 @@ pub(crate) unsafe fn init(config: Config) {
let msi = config.msi.map(|range| { let msi = config.msi.map(|range| {
// Enable MSI // Enable MSI
RCC.cr().write(|w| { RCC.cr().modify(|w| {
#[cfg(not(stm32wb))]
w.set_msirgsel(crate::pac::rcc::vals::Msirgsel::CR);
w.set_msirange(range); w.set_msirange(range);
w.set_msirgsel(Msirgsel::CR);
w.set_msion(true); w.set_msion(true);
// If LSE is enabled, enable calibration of MSI // If LSE is enabled, enable calibration of MSI
@@ -127,21 +195,27 @@ pub(crate) unsafe fn init(config: Config) {
msirange_to_hertz(range) msirange_to_hertz(range)
}); });
let hsi16 = config.hsi16.then(|| { let hsi = config.hsi.then(|| {
RCC.cr().write(|w| w.set_hsion(true)); RCC.cr().modify(|w| w.set_hsion(true));
while !RCC.cr().read().hsirdy() {} while !RCC.cr().read().hsirdy() {}
HSI_FREQ HSI_FREQ
}); });
let hse = config.hse.map(|freq| { let hse = config.hse.map(|hse| {
RCC.cr().write(|w| w.set_hseon(true)); RCC.cr().modify(|w| {
#[cfg(stm32wl)]
w.set_hsebyppwr(hse.mode == HseMode::Bypass);
#[cfg(not(stm32wl))]
w.set_hsebyp(hse.mode == HseMode::Bypass);
w.set_hseon(true);
});
while !RCC.cr().read().hserdy() {} while !RCC.cr().read().hserdy() {}
freq hse.freq
}); });
#[cfg(not(any(stm32l47x, stm32l48x)))] #[cfg(any(all(stm32l4, not(any(stm32l47x, stm32l48x))), stm32l5, stm32wb))]
let hsi48 = config.hsi48.then(|| { let hsi48 = config.hsi48.then(|| {
RCC.crrcr().modify(|w| w.set_hsi48on(true)); RCC.crrcr().modify(|w| w.set_hsi48on(true));
while !RCC.crrcr().read().hsi48rdy() {} while !RCC.crrcr().read().hsi48rdy() {}
@@ -153,6 +227,7 @@ pub(crate) unsafe fn init(config: Config) {
let _plls = [ let _plls = [
&config.pll, &config.pll,
#[cfg(any(stm32l4, stm32l5, stm32wb))]
&config.pllsai1, &config.pllsai1,
#[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))] #[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))]
&config.pllsai2, &config.pllsai2,
@@ -160,7 +235,7 @@ pub(crate) unsafe fn init(config: Config) {
// L4 has shared PLLSRC, PLLM, check it's equal in all PLLs. // L4 has shared PLLSRC, PLLM, check it's equal in all PLLs.
#[cfg(all(stm32l4, not(rcc_l4plus)))] #[cfg(all(stm32l4, not(rcc_l4plus)))]
match get_equal(_plls.into_iter().flatten().map(|p| (p.source, p.prediv))) { match super::util::get_equal(_plls.into_iter().flatten().map(|p| (p.source, p.prediv))) {
Err(()) => panic!("Source must be equal across all enabled PLLs."), Err(()) => panic!("Source must be equal across all enabled PLLs."),
Ok(None) => {} Ok(None) => {}
Ok(Some((source, prediv))) => RCC.pllcfgr().write(|w| { Ok(Some((source, prediv))) => RCC.pllcfgr().write(|w| {
@@ -169,9 +244,9 @@ pub(crate) unsafe fn init(config: Config) {
}), }),
}; };
// L4+ has shared PLLSRC, check it's equal in all PLLs. // L4+, WL has shared PLLSRC, check it's equal in all PLLs.
#[cfg(any(rcc_l4plus))] #[cfg(any(rcc_l4plus, stm32wl))]
match get_equal(_plls.into_iter().flatten().map(|p| p.source)) { match super::util::get_equal(_plls.into_iter().flatten().map(|p| p.source)) {
Err(()) => panic!("Source must be equal across all enabled PLLs."), Err(()) => panic!("Source must be equal across all enabled PLLs."),
Ok(None) => {} Ok(None) => {}
Ok(Some(source)) => RCC.pllcfgr().write(|w| { Ok(Some(source)) => RCC.pllcfgr().write(|w| {
@@ -179,28 +254,30 @@ pub(crate) unsafe fn init(config: Config) {
}), }),
}; };
let pll_input = PllInput { hse, hsi16, msi }; let pll_input = PllInput { hse, hsi, msi };
let pll = init_pll(PllInstance::Pll, config.pll, &pll_input); let pll = init_pll(PllInstance::Pll, config.pll, &pll_input);
#[cfg(any(stm32l4, stm32l5, stm32wb))]
let pllsai1 = init_pll(PllInstance::Pllsai1, config.pllsai1, &pll_input); let pllsai1 = init_pll(PllInstance::Pllsai1, config.pllsai1, &pll_input);
#[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))] #[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))]
let _pllsai2 = init_pll(PllInstance::Pllsai2, config.pllsai2, &pll_input); let _pllsai2 = init_pll(PllInstance::Pllsai2, config.pllsai2, &pll_input);
let sys_clk = match config.mux { let sys_clk = match config.mux {
ClockSrc::HSE => hse.unwrap(), ClockSrc::HSE => hse.unwrap(),
ClockSrc::HSI16 => hsi16.unwrap(), ClockSrc::HSI => hsi.unwrap(),
ClockSrc::MSI => msi.unwrap(), ClockSrc::MSI => msi.unwrap(),
ClockSrc::PLL => pll._r.unwrap(), ClockSrc::PLL1_R => pll.r.unwrap(),
}; };
#[cfg(stm32l4)] #[cfg(stm32l4)]
RCC.ccipr().modify(|w| w.set_clk48sel(config.clk48_src)); RCC.ccipr().modify(|w| w.set_clk48sel(config.clk48_src));
#[cfg(stm32l5)] #[cfg(stm32l5)]
RCC.ccipr1().modify(|w| w.set_clk48sel(config.clk48_src)); RCC.ccipr1().modify(|w| w.set_clk48sel(config.clk48_src));
#[cfg(any(stm32l4, stm32l5, stm32wb))]
let _clk48 = match config.clk48_src { let _clk48 = match config.clk48_src {
Clk48Src::HSI48 => hsi48, Clk48Src::HSI48 => hsi48,
Clk48Src::MSI => msi, Clk48Src::MSI => msi,
Clk48Src::PLLSAI1_Q => pllsai1._q, Clk48Src::PLLSAI1_Q => pllsai1.q,
Clk48Src::PLL_Q => pll._q, Clk48Src::PLL1_Q => pll.q,
}; };
#[cfg(rcc_l4plus)] #[cfg(rcc_l4plus)]
@@ -208,29 +285,56 @@ pub(crate) unsafe fn init(config: Config) {
#[cfg(all(stm32l4, not(rcc_l4plus)))] #[cfg(all(stm32l4, not(rcc_l4plus)))]
assert!(sys_clk.0 <= 80_000_000); assert!(sys_clk.0 <= 80_000_000);
let hclk1 = sys_clk / config.ahb_pre;
let (pclk1, pclk1_tim) = super::util::calc_pclk(hclk1, config.apb1_pre);
let (pclk2, pclk2_tim) = super::util::calc_pclk(hclk1, config.apb2_pre);
#[cfg(not(any(stm32wl5x, stm32wb)))]
let hclk2 = hclk1;
#[cfg(any(stm32wl5x, stm32wb))]
let hclk2 = sys_clk / config.core2_ahb_pre;
#[cfg(not(any(stm32wl, stm32wb)))]
let hclk3 = hclk1;
#[cfg(any(stm32wl, stm32wb))]
let hclk3 = sys_clk / config.shared_ahb_pre;
// Set flash wait states // Set flash wait states
#[cfg(stm32l4)] #[cfg(stm32l4)]
FLASH.acr().modify(|w| { let latency = match hclk1.0 {
w.set_latency(match sys_clk.0 { 0..=16_000_000 => 0,
0..=16_000_000 => 0, 0..=32_000_000 => 1,
0..=32_000_000 => 1, 0..=48_000_000 => 2,
0..=48_000_000 => 2, 0..=64_000_000 => 3,
0..=64_000_000 => 3, _ => 4,
_ => 4, };
})
});
// VCORE Range 0 (performance), others TODO
#[cfg(stm32l5)] #[cfg(stm32l5)]
FLASH.acr().modify(|w| { let latency = match hclk1.0 {
w.set_latency(match sys_clk.0 { // VCORE Range 0 (performance), others TODO
0..=20_000_000 => 0, 0..=20_000_000 => 0,
0..=40_000_000 => 1, 0..=40_000_000 => 1,
0..=60_000_000 => 2, 0..=60_000_000 => 2,
0..=80_000_000 => 3, 0..=80_000_000 => 3,
0..=100_000_000 => 4, 0..=100_000_000 => 4,
_ => 5, _ => 5,
}) };
}); #[cfg(stm32wl)]
let latency = match hclk3.0 {
// VOS RANGE1, others TODO.
..=18_000_000 => 0,
..=36_000_000 => 1,
_ => 2,
};
#[cfg(stm32wb)]
let latency = match hclk3.0 {
// VOS RANGE1, others TODO.
..=18_000_000 => 0,
..=36_000_000 => 1,
..=54_000_000 => 2,
..=64_000_000 => 3,
_ => 4,
};
FLASH.acr().modify(|w| w.set_latency(latency));
while FLASH.acr().read().latency() != latency {}
RCC.cfgr().modify(|w| { RCC.cfgr().modify(|w| {
w.set_sw(config.mux); w.set_sw(config.mux);
@@ -238,34 +342,47 @@ pub(crate) unsafe fn init(config: Config) {
w.set_ppre1(config.apb1_pre); w.set_ppre1(config.apb1_pre);
w.set_ppre2(config.apb2_pre); w.set_ppre2(config.apb2_pre);
}); });
while RCC.cfgr().read().sws() != config.mux {}
let ahb_freq = sys_clk / config.ahb_pre; #[cfg(any(stm32wl, stm32wb))]
{
let (apb1_freq, apb1_tim_freq) = match config.apb1_pre { RCC.extcfgr().modify(|w| {
APBPrescaler::DIV1 => (ahb_freq, ahb_freq), w.set_shdhpre(config.shared_ahb_pre);
pre => { #[cfg(any(stm32wl5x, stm32wb))]
let freq = ahb_freq / pre; w.set_c2hpre(config.core2_ahb_pre);
(freq, freq * 2u32) });
} while !RCC.extcfgr().read().shdhpref() {}
}; #[cfg(any(stm32wl5x, stm32wb))]
while !RCC.extcfgr().read().c2hpref() {}
let (apb2_freq, apb2_tim_freq) = match config.apb2_pre { }
APBPrescaler::DIV1 => (ahb_freq, ahb_freq),
pre => {
let freq = ahb_freq / pre;
(freq, freq * 2u32)
}
};
set_freqs(Clocks { set_freqs(Clocks {
sys: sys_clk, sys: sys_clk,
hclk1: ahb_freq, hclk1,
hclk2: ahb_freq, hclk2,
hclk3: ahb_freq, hclk3,
pclk1: apb1_freq, pclk1,
pclk2: apb2_freq, pclk2,
pclk1_tim: apb1_tim_freq, pclk1_tim,
pclk2_tim: apb2_tim_freq, pclk2_tim,
#[cfg(stm32wl)]
pclk3: hclk3,
#[cfg(rcc_l4)]
hsi: None,
#[cfg(rcc_l4)]
lse: None,
#[cfg(rcc_l4)]
pllsai1_p: None,
#[cfg(rcc_l4)]
pllsai2_p: None,
#[cfg(rcc_l4)]
pll1_p: None,
#[cfg(rcc_l4)]
pll1_q: None,
#[cfg(rcc_l4)]
sai1_extclk: None,
#[cfg(rcc_l4)]
sai2_extclk: None,
rtc, rtc,
}); });
} }
@@ -288,60 +405,58 @@ fn msirange_to_hertz(range: MSIRange) -> Hertz {
} }
} }
#[allow(unused)]
fn get_equal<T: Eq>(mut iter: impl Iterator<Item = T>) -> Result<Option<T>, ()> {
let Some(x) = iter.next() else { return Ok(None) };
if !iter.all(|y| y == x) {
return Err(());
}
return Ok(Some(x));
}
struct PllInput { struct PllInput {
hsi16: Option<Hertz>, hsi: Option<Hertz>,
hse: Option<Hertz>, hse: Option<Hertz>,
msi: Option<Hertz>, msi: Option<Hertz>,
} }
#[allow(unused)]
#[derive(Default)] #[derive(Default)]
struct PllOutput { struct PllOutput {
_p: Option<Hertz>, p: Option<Hertz>,
_q: Option<Hertz>, q: Option<Hertz>,
_r: Option<Hertz>, r: Option<Hertz>,
} }
#[derive(PartialEq, Eq, Clone, Copy)] #[derive(PartialEq, Eq, Clone, Copy)]
enum PllInstance { enum PllInstance {
Pll, Pll,
#[cfg(any(stm32l4, stm32l5, stm32wb))]
Pllsai1, Pllsai1,
#[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))] #[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))]
Pllsai2, Pllsai2,
} }
fn init_pll(instance: PllInstance, config: Option<Pll>, input: &PllInput) -> PllOutput { fn pll_enable(instance: PllInstance, enabled: bool) {
// Disable PLL
match instance { match instance {
PllInstance::Pll => { PllInstance::Pll => {
RCC.cr().modify(|w| w.set_pllon(false)); RCC.cr().modify(|w| w.set_pllon(enabled));
while RCC.cr().read().pllrdy() {} while RCC.cr().read().pllrdy() != enabled {}
} }
#[cfg(any(stm32l4, stm32l5, stm32wb))]
PllInstance::Pllsai1 => { PllInstance::Pllsai1 => {
RCC.cr().modify(|w| w.set_pllsai1on(false)); RCC.cr().modify(|w| w.set_pllsai1on(enabled));
while RCC.cr().read().pllsai1rdy() {} while RCC.cr().read().pllsai1rdy() != enabled {}
} }
#[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))] #[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))]
PllInstance::Pllsai2 => { PllInstance::Pllsai2 => {
RCC.cr().modify(|w| w.set_pllsai2on(false)); RCC.cr().modify(|w| w.set_pllsai2on(enabled));
while RCC.cr().read().pllsai2rdy() {} while RCC.cr().read().pllsai2rdy() != enabled {}
} }
} }
}
fn init_pll(instance: PllInstance, config: Option<Pll>, input: &PllInput) -> PllOutput {
// Disable PLL
pll_enable(instance, false);
let Some(pll) = config else { return PllOutput::default() }; let Some(pll) = config else { return PllOutput::default() };
let pll_src = match pll.source { let pll_src = match pll.source {
PLLSource::NONE => panic!("must not select PLL source as NONE"), PLLSource::DISABLE => panic!("must not select PLL source as DISABLE"),
PLLSource::HSE => input.hse, PLLSource::HSE => input.hse,
PLLSource::HSI16 => input.hsi16, PLLSource::HSI => input.hsi,
PLLSource::MSI => input.msi, PLLSource::MSI => input.msi,
}; };
@@ -383,6 +498,7 @@ fn init_pll(instance: PllInstance, config: Option<Pll>, input: &PllInput) -> Pll
w.set_pllsrc(pll.source); w.set_pllsrc(pll.source);
write_fields!(w); write_fields!(w);
}), }),
#[cfg(any(stm32l4, stm32l5, stm32wb))]
PllInstance::Pllsai1 => RCC.pllsai1cfgr().write(|w| { PllInstance::Pllsai1 => RCC.pllsai1cfgr().write(|w| {
#[cfg(any(rcc_l4plus, stm32l5))] #[cfg(any(rcc_l4plus, stm32l5))]
w.set_pllm(pll.prediv); w.set_pllm(pll.prediv);
@@ -401,21 +517,7 @@ fn init_pll(instance: PllInstance, config: Option<Pll>, input: &PllInput) -> Pll
} }
// Enable PLL // Enable PLL
match instance { pll_enable(instance, true);
PllInstance::Pll => {
RCC.cr().modify(|w| w.set_pllon(true));
while !RCC.cr().read().pllrdy() {}
}
PllInstance::Pllsai1 => {
RCC.cr().modify(|w| w.set_pllsai1on(true));
while !RCC.cr().read().pllsai1rdy() {}
}
#[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))]
PllInstance::Pllsai2 => {
RCC.cr().modify(|w| w.set_pllsai2on(true));
while !RCC.cr().read().pllsai2rdy() {}
}
}
PllOutput { _p: p, _q: q, _r: r } PllOutput { p, q, r }
} }

View File

@@ -13,21 +13,16 @@ pub use mco::*;
#[cfg_attr(any(rcc_f1, rcc_f100, rcc_f1cl), path = "f1.rs")] #[cfg_attr(any(rcc_f1, rcc_f100, rcc_f1cl), path = "f1.rs")]
#[cfg_attr(rcc_f2, path = "f2.rs")] #[cfg_attr(rcc_f2, path = "f2.rs")]
#[cfg_attr(any(rcc_f3, rcc_f3_v2), path = "f3.rs")] #[cfg_attr(any(rcc_f3, rcc_f3_v2), path = "f3.rs")]
#[cfg_attr(any(rcc_f4, rcc_f410), path = "f4.rs")] #[cfg_attr(any(rcc_f4, rcc_f410, rcc_f7), path = "f4f7.rs")]
#[cfg_attr(rcc_f7, path = "f7.rs")]
#[cfg_attr(rcc_c0, path = "c0.rs")] #[cfg_attr(rcc_c0, path = "c0.rs")]
#[cfg_attr(rcc_g0, path = "g0.rs")] #[cfg_attr(rcc_g0, path = "g0.rs")]
#[cfg_attr(rcc_g4, path = "g4.rs")] #[cfg_attr(rcc_g4, path = "g4.rs")]
#[cfg_attr(any(rcc_h5, rcc_h50, rcc_h7, rcc_h7rm0433, rcc_h7ab), path = "h.rs")] #[cfg_attr(any(rcc_h5, rcc_h50, rcc_h7, rcc_h7rm0433, rcc_h7ab), path = "h.rs")]
#[cfg_attr(any(rcc_l0, rcc_l0_v2, rcc_l1), path = "l0l1.rs")] #[cfg_attr(any(rcc_l0, rcc_l0_v2, rcc_l1), path = "l0l1.rs")]
#[cfg_attr(any(rcc_l4, rcc_l4plus, rcc_l5), path = "l4l5.rs")] #[cfg_attr(any(rcc_l4, rcc_l4plus, rcc_l5, rcc_wl5, rcc_wle, rcc_wb), path = "l4l5.rs")]
#[cfg_attr(rcc_u5, path = "u5.rs")] #[cfg_attr(rcc_u5, path = "u5.rs")]
#[cfg_attr(rcc_wb, path = "wb.rs")]
#[cfg_attr(rcc_wba, path = "wba.rs")] #[cfg_attr(rcc_wba, path = "wba.rs")]
#[cfg_attr(any(rcc_wl5, rcc_wle), path = "wl.rs")]
mod _version; mod _version;
#[cfg(feature = "low-power")]
use core::sync::atomic::{AtomicU32, Ordering};
pub use _version::*; pub use _version::*;
@@ -110,14 +105,18 @@ pub struct Clocks {
#[cfg(all(rcc_f4, not(stm32f410)))] #[cfg(all(rcc_f4, not(stm32f410)))]
pub plli2s1_r: Option<Hertz>, pub plli2s1_r: Option<Hertz>,
#[cfg(rcc_l4)]
pub pllsai1_p: Option<Hertz>,
#[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))] #[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))]
pub pllsai1_q: Option<Hertz>, pub pllsai1_q: Option<Hertz>,
#[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))] #[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))]
pub pllsai1_r: Option<Hertz>, pub pllsai1_r: Option<Hertz>,
#[cfg(rcc_l4)]
pub pllsai2_p: Option<Hertz>,
#[cfg(stm32g4)] #[cfg(any(stm32g4, rcc_l4))]
pub pll1_p: Option<Hertz>, pub pll1_p: Option<Hertz>,
#[cfg(any(stm32h5, stm32h7, rcc_f2, rcc_f4, rcc_f410, rcc_f7))] #[cfg(any(stm32h5, stm32h7, rcc_f2, rcc_f4, rcc_f410, rcc_f7, rcc_l4))]
pub pll1_q: Option<Hertz>, pub pll1_q: Option<Hertz>,
#[cfg(any(stm32h5, stm32h7))] #[cfg(any(stm32h5, stm32h7))]
pub pll2_p: Option<Hertz>, pub pll2_p: Option<Hertz>,
@@ -154,7 +153,7 @@ pub struct Clocks {
pub rtc: Option<Hertz>, pub rtc: Option<Hertz>,
#[cfg(any(stm32h5, stm32h7))] #[cfg(any(stm32h5, stm32h7, rcc_l4, rcc_c0))]
pub hsi: Option<Hertz>, pub hsi: Option<Hertz>,
#[cfg(stm32h5)] #[cfg(stm32h5)]
pub hsi48: Option<Hertz>, pub hsi48: Option<Hertz>,
@@ -163,7 +162,7 @@ pub struct Clocks {
#[cfg(any(stm32h5, stm32h7))] #[cfg(any(stm32h5, stm32h7))]
pub csi: Option<Hertz>, pub csi: Option<Hertz>,
#[cfg(any(stm32h5, stm32h7))] #[cfg(any(stm32h5, stm32h7, rcc_l4, rcc_c0))]
pub lse: Option<Hertz>, pub lse: Option<Hertz>,
#[cfg(any(stm32h5, stm32h7))] #[cfg(any(stm32h5, stm32h7))]
pub hse: Option<Hertz>, pub hse: Option<Hertz>,
@@ -175,30 +174,14 @@ pub struct Clocks {
#[cfg(stm32h7)] #[cfg(stm32h7)]
pub rcc_pclk_d3: Option<Hertz>, pub rcc_pclk_d3: Option<Hertz>,
#[cfg(rcc_l4)]
pub sai1_extclk: Option<Hertz>,
#[cfg(rcc_l4)]
pub sai2_extclk: Option<Hertz>,
} }
#[cfg(feature = "low-power")] #[cfg(feature = "low-power")]
static CLOCK_REFCOUNT: AtomicU32 = AtomicU32::new(0); pub(crate) static mut REFCOUNT_STOP2: u32 = 0;
#[cfg(feature = "low-power")]
pub fn low_power_ready() -> bool {
// trace!("clock refcount: {}", CLOCK_REFCOUNT.load(Ordering::SeqCst));
CLOCK_REFCOUNT.load(Ordering::SeqCst) == 0
}
#[cfg(feature = "low-power")]
pub(crate) fn clock_refcount_add(_cs: critical_section::CriticalSection) {
// We don't check for overflow because constructing more than u32 peripherals is unlikely
let n = CLOCK_REFCOUNT.load(Ordering::Relaxed);
CLOCK_REFCOUNT.store(n + 1, Ordering::Relaxed);
}
#[cfg(feature = "low-power")]
pub(crate) fn clock_refcount_sub(_cs: critical_section::CriticalSection) {
let n = CLOCK_REFCOUNT.load(Ordering::Relaxed);
assert!(n != 0);
CLOCK_REFCOUNT.store(n - 1, Ordering::Relaxed);
}
/// Frozen clock frequencies /// Frozen clock frequencies
/// ///
@@ -241,3 +224,33 @@ pub(crate) mod sealed {
} }
pub trait RccPeripheral: sealed::RccPeripheral + 'static {} pub trait RccPeripheral: sealed::RccPeripheral + 'static {}
#[allow(unused)]
mod util {
use crate::time::Hertz;
pub fn calc_pclk<D>(hclk: Hertz, ppre: D) -> (Hertz, Hertz)
where
Hertz: core::ops::Div<D, Output = Hertz>,
{
let pclk = hclk / ppre;
let pclk_tim = if hclk == pclk { pclk } else { pclk * 2u32 };
(pclk, pclk_tim)
}
pub fn all_equal<T: Eq>(mut iter: impl Iterator<Item = T>) -> bool {
let Some(x) = iter.next() else { return true };
if !iter.all(|y| y == x) {
return false;
}
true
}
pub fn get_equal<T: Eq>(mut iter: impl Iterator<Item = T>) -> Result<Option<T>, ()> {
let Some(x) = iter.next() else { return Ok(None) };
if !iter.all(|y| y == x) {
return Err(());
}
Ok(Some(x))
}
}

View File

@@ -10,6 +10,7 @@ pub const HSI_FREQ: Hertz = Hertz(16_000_000);
pub use crate::pac::pwr::vals::Vos as VoltageScale; pub use crate::pac::pwr::vals::Vos as VoltageScale;
#[derive(Copy, Clone)] #[derive(Copy, Clone)]
#[allow(non_camel_case_types)]
pub enum ClockSrc { pub enum ClockSrc {
/// Use an internal medium speed oscillator (MSIS) as the system clock. /// Use an internal medium speed oscillator (MSIS) as the system clock.
MSI(Msirange), MSI(Msirange),
@@ -19,9 +20,9 @@ pub enum ClockSrc {
/// never exceed 50 MHz. /// never exceed 50 MHz.
HSE(Hertz), HSE(Hertz),
/// Use the 16 MHz internal high speed oscillator as the system clock. /// Use the 16 MHz internal high speed oscillator as the system clock.
HSI16, HSI,
/// Use PLL1 as the system clock. /// Use PLL1 as the system clock.
PLL1R(PllConfig), PLL1_R(PllConfig),
} }
impl Default for ClockSrc { impl Default for ClockSrc {
@@ -53,10 +54,10 @@ pub struct PllConfig {
} }
impl PllConfig { impl PllConfig {
/// A configuration for HSI16 / 1 * 10 / 1 = 160 MHz /// A configuration for HSI / 1 * 10 / 1 = 160 MHz
pub const fn hsi16_160mhz() -> Self { pub const fn hsi_160mhz() -> Self {
PllConfig { PllConfig {
source: PllSrc::HSI16, source: PllSrc::HSI,
m: Pllm::DIV1, m: Pllm::DIV1,
n: Plln::MUL10, n: Plln::MUL10,
r: Plldiv::DIV1, r: Plldiv::DIV1,
@@ -84,7 +85,7 @@ pub enum PllSrc {
/// never exceed 50 MHz. /// never exceed 50 MHz.
HSE(Hertz), HSE(Hertz),
/// Use the 16 MHz internal high speed oscillator as the PLL source. /// Use the 16 MHz internal high speed oscillator as the PLL source.
HSI16, HSI,
} }
impl Into<Pllsrc> for PllSrc { impl Into<Pllsrc> for PllSrc {
@@ -92,7 +93,7 @@ impl Into<Pllsrc> for PllSrc {
match self { match self {
PllSrc::MSIS(..) => Pllsrc::MSIS, PllSrc::MSIS(..) => Pllsrc::MSIS,
PllSrc::HSE(..) => Pllsrc::HSE, PllSrc::HSE(..) => Pllsrc::HSE,
PllSrc::HSI16 => Pllsrc::HSI16, PllSrc::HSI => Pllsrc::HSI,
} }
} }
} }
@@ -102,8 +103,8 @@ impl Into<Sw> for ClockSrc {
match self { match self {
ClockSrc::MSI(..) => Sw::MSIS, ClockSrc::MSI(..) => Sw::MSIS,
ClockSrc::HSE(..) => Sw::HSE, ClockSrc::HSE(..) => Sw::HSE,
ClockSrc::HSI16 => Sw::HSI16, ClockSrc::HSI => Sw::HSI,
ClockSrc::PLL1R(..) => Sw::PLL1_R, ClockSrc::PLL1_R(..) => Sw::PLL1_R,
} }
} }
} }
@@ -125,7 +126,7 @@ pub struct Config {
} }
impl Config { impl Config {
unsafe fn init_hsi16(&self) -> Hertz { unsafe fn init_hsi(&self) -> Hertz {
RCC.cr().write(|w| w.set_hsion(true)); RCC.cr().write(|w| w.set_hsion(true));
while !RCC.cr().read().hsirdy() {} while !RCC.cr().read().hsirdy() {}
@@ -169,7 +170,7 @@ impl Config {
RCC.icscr1().modify(|w| { RCC.icscr1().modify(|w| {
w.set_msisrange(range); w.set_msisrange(range);
w.set_msirgsel(Msirgsel::RCC_ICSCR1); w.set_msirgsel(Msirgsel::ICSCR1);
}); });
RCC.cr().write(|w| { RCC.cr().write(|w| {
w.set_msipllen(false); w.set_msipllen(false);
@@ -211,13 +212,13 @@ pub(crate) unsafe fn init(config: Config) {
let sys_clk = match config.mux { let sys_clk = match config.mux {
ClockSrc::MSI(range) => config.init_msis(range), ClockSrc::MSI(range) => config.init_msis(range),
ClockSrc::HSE(freq) => config.init_hse(freq), ClockSrc::HSE(freq) => config.init_hse(freq),
ClockSrc::HSI16 => config.init_hsi16(), ClockSrc::HSI => config.init_hsi(),
ClockSrc::PLL1R(pll) => { ClockSrc::PLL1_R(pll) => {
// Configure the PLL source // Configure the PLL source
let source_clk = match pll.source { let source_clk = match pll.source {
PllSrc::MSIS(range) => config.init_msis(range), PllSrc::MSIS(range) => config.init_msis(range),
PllSrc::HSE(hertz) => config.init_hse(hertz), PllSrc::HSE(hertz) => config.init_hse(hertz),
PllSrc::HSI16 => config.init_hsi16(), PllSrc::HSI => config.init_hsi(),
}; };
// Calculate the reference clock, which is the source divided by m // Calculate the reference clock, which is the source divided by m
@@ -292,7 +293,7 @@ pub(crate) unsafe fn init(config: Config) {
// Set the prescaler for PWR EPOD // Set the prescaler for PWR EPOD
w.set_pllmboost(mboost); w.set_pllmboost(mboost);
// Enable PLL1R output // Enable PLL1_R output
w.set_pllren(true); w.set_pllren(true);
}); });

View File

@@ -1,258 +0,0 @@
pub use crate::pac::rcc::vals::{
Hpre as AHBPrescaler, Hsepre as HsePrescaler, Pllm, Plln, Pllp, Pllq, Pllr, Pllsrc as PllSource,
Ppre as APBPrescaler, Sw as Sysclk,
};
use crate::rcc::{set_freqs, Clocks};
use crate::time::{mhz, Hertz};
/// HSI speed
pub const HSI_FREQ: Hertz = Hertz(16_000_000);
pub struct Hse {
pub prediv: HsePrescaler,
pub frequency: Hertz,
}
pub struct PllMux {
/// Source clock selection.
pub source: PllSource,
/// PLL pre-divider (DIVM). Must be between 1 and 63.
pub prediv: Pllm,
}
pub struct Pll {
/// PLL multiplication factor. Must be between 4 and 512.
pub mul: Plln,
/// PLL P division factor. If None, PLL P output is disabled. Must be between 1 and 128.
/// On PLL1, it must be even (in particular, it cannot be 1.)
pub divp: Option<Pllp>,
/// PLL Q division factor. If None, PLL Q output is disabled. Must be between 1 and 128.
pub divq: Option<Pllq>,
/// PLL R division factor. If None, PLL R output is disabled. Must be between 1 and 128.
pub divr: Option<Pllr>,
}
/// Clocks configutation
pub struct Config {
pub hse: Option<Hse>,
pub sys: Sysclk,
pub mux: Option<PllMux>,
pub hsi48: bool,
pub pll: Option<Pll>,
pub pllsai: Option<Pll>,
pub ahb1_pre: AHBPrescaler,
pub ahb2_pre: AHBPrescaler,
pub ahb3_pre: AHBPrescaler,
pub apb1_pre: APBPrescaler,
pub apb2_pre: APBPrescaler,
pub ls: super::LsConfig,
}
pub const WPAN_DEFAULT: Config = Config {
hse: Some(Hse {
frequency: mhz(32),
prediv: HsePrescaler::DIV1,
}),
sys: Sysclk::PLL,
mux: Some(PllMux {
source: PllSource::HSE,
prediv: Pllm::DIV2,
}),
hsi48: true,
ls: super::LsConfig::default_lse(),
pll: Some(Pll {
mul: Plln::MUL12,
divp: Some(Pllp::DIV3),
divq: Some(Pllq::DIV4),
divr: Some(Pllr::DIV3),
}),
pllsai: None,
ahb1_pre: AHBPrescaler::DIV1,
ahb2_pre: AHBPrescaler::DIV2,
ahb3_pre: AHBPrescaler::DIV1,
apb1_pre: APBPrescaler::DIV1,
apb2_pre: APBPrescaler::DIV1,
};
impl Default for Config {
#[inline]
fn default() -> Config {
Config {
hse: None,
sys: Sysclk::HSI16,
mux: None,
pll: None,
pllsai: None,
hsi48: true,
ls: Default::default(),
ahb1_pre: AHBPrescaler::DIV1,
ahb2_pre: AHBPrescaler::DIV1,
ahb3_pre: AHBPrescaler::DIV1,
apb1_pre: APBPrescaler::DIV1,
apb2_pre: APBPrescaler::DIV1,
}
}
}
#[cfg(stm32wb)]
/// RCC initialization function
pub(crate) unsafe fn init(config: Config) {
let hse_clk = config.hse.as_ref().map(|hse| hse.frequency / hse.prediv);
let mux_clk = config.mux.as_ref().map(|pll_mux| {
(match pll_mux.source {
PllSource::HSE => hse_clk.unwrap(),
PllSource::HSI16 => HSI_FREQ,
_ => unreachable!(),
} / pll_mux.prediv)
});
let (pll_r, _pll_q, _pll_p) = match &config.pll {
Some(pll) => {
let pll_vco = mux_clk.unwrap() * pll.mul as u32;
(
pll.divr.map(|divr| pll_vco / divr),
pll.divq.map(|divq| pll_vco / divq),
pll.divp.map(|divp| pll_vco / divp),
)
}
None => (None, None, None),
};
let sys_clk = match config.sys {
Sysclk::HSE => hse_clk.unwrap(),
Sysclk::HSI16 => HSI_FREQ,
Sysclk::PLL => pll_r.unwrap(),
_ => unreachable!(),
};
let ahb1_clk = sys_clk / config.ahb1_pre;
let ahb2_clk = sys_clk / config.ahb2_pre;
let ahb3_clk = sys_clk / config.ahb3_pre;
let (apb1_clk, apb1_tim_clk) = match config.apb1_pre {
APBPrescaler::DIV1 => (ahb1_clk, ahb1_clk),
pre => {
let freq = ahb1_clk / pre;
(freq, freq * 2u32)
}
};
let (apb2_clk, apb2_tim_clk) = match config.apb2_pre {
APBPrescaler::DIV1 => (ahb1_clk, ahb1_clk),
pre => {
let freq = ahb1_clk / pre;
(freq, freq * 2u32)
}
};
let rcc = crate::pac::RCC;
let needs_hsi = if let Some(pll_mux) = &config.mux {
pll_mux.source == PllSource::HSI16
} else {
false
};
if needs_hsi || config.sys == Sysclk::HSI16 {
rcc.cr().modify(|w| {
w.set_hsion(true);
});
while !rcc.cr().read().hsirdy() {}
}
rcc.cfgr().modify(|w| w.set_stopwuck(true));
let rtc = config.ls.init();
match &config.hse {
Some(hse) => {
rcc.cr().modify(|w| {
w.set_hsepre(hse.prediv);
w.set_hseon(true);
});
while !rcc.cr().read().hserdy() {}
}
_ => {}
}
match &config.mux {
Some(pll_mux) => {
rcc.pllcfgr().modify(|w| {
w.set_pllm(pll_mux.prediv);
w.set_pllsrc(pll_mux.source.into());
});
}
_ => {}
};
match &config.pll {
Some(pll) => {
rcc.pllcfgr().modify(|w| {
w.set_plln(pll.mul);
pll.divp.map(|divp| {
w.set_pllpen(true);
w.set_pllp(divp)
});
pll.divq.map(|divq| {
w.set_pllqen(true);
w.set_pllq(divq)
});
pll.divr.map(|divr| {
w.set_pllren(true);
w.set_pllr(divr);
});
});
rcc.cr().modify(|w| w.set_pllon(true));
while !rcc.cr().read().pllrdy() {}
}
_ => {}
}
let _hsi48 = config.hsi48.then(|| {
rcc.crrcr().modify(|w| w.set_hsi48on(true));
while !rcc.crrcr().read().hsi48rdy() {}
Hertz(48_000_000)
});
rcc.cfgr().modify(|w| {
w.set_sw(config.sys.into());
w.set_hpre(config.ahb1_pre);
w.set_ppre1(config.apb1_pre);
w.set_ppre2(config.apb2_pre);
});
rcc.extcfgr().modify(|w| {
w.set_c2hpre(config.ahb2_pre);
w.set_shdhpre(config.ahb3_pre);
});
set_freqs(Clocks {
sys: sys_clk,
hclk1: ahb1_clk,
hclk2: ahb2_clk,
hclk3: ahb3_clk,
pclk1: apb1_clk,
pclk2: apb2_clk,
pclk1_tim: apb1_tim_clk,
pclk2_tim: apb2_tim_clk,
rtc,
})
}

View File

@@ -13,20 +13,20 @@ pub use crate::pac::rcc::vals::{Hpre as AHBPrescaler, Ppre as APBPrescaler};
#[derive(Copy, Clone)] #[derive(Copy, Clone)]
pub enum ClockSrc { pub enum ClockSrc {
HSE(Hertz), HSE(Hertz),
HSI16, HSI,
} }
#[derive(Clone, Copy, Debug)] #[derive(Clone, Copy, Debug)]
pub enum PllSrc { pub enum PllSrc {
HSE(Hertz), HSE(Hertz),
HSI16, HSI,
} }
impl Into<Pllsrc> for PllSrc { impl Into<Pllsrc> for PllSrc {
fn into(self) -> Pllsrc { fn into(self) -> Pllsrc {
match self { match self {
PllSrc::HSE(..) => Pllsrc::HSE, PllSrc::HSE(..) => Pllsrc::HSE,
PllSrc::HSI16 => Pllsrc::HSI16, PllSrc::HSI => Pllsrc::HSI,
} }
} }
} }
@@ -35,7 +35,7 @@ impl Into<Sw> for ClockSrc {
fn into(self) -> Sw { fn into(self) -> Sw {
match self { match self {
ClockSrc::HSE(..) => Sw::HSE, ClockSrc::HSE(..) => Sw::HSE,
ClockSrc::HSI16 => Sw::HSI16, ClockSrc::HSI => Sw::HSI,
} }
} }
} }
@@ -52,7 +52,7 @@ pub struct Config {
impl Default for Config { impl Default for Config {
fn default() -> Self { fn default() -> Self {
Self { Self {
mux: ClockSrc::HSI16, mux: ClockSrc::HSI,
ahb_pre: AHBPrescaler::DIV1, ahb_pre: AHBPrescaler::DIV1,
apb1_pre: APBPrescaler::DIV1, apb1_pre: APBPrescaler::DIV1,
apb2_pre: APBPrescaler::DIV1, apb2_pre: APBPrescaler::DIV1,
@@ -70,7 +70,7 @@ pub(crate) unsafe fn init(config: Config) {
freq freq
} }
ClockSrc::HSI16 => { ClockSrc::HSI => {
RCC.cr().write(|w| w.set_hsion(true)); RCC.cr().write(|w| w.set_hsion(true));
while !RCC.cr().read().hsirdy() {} while !RCC.cr().read().hsirdy() {}

View File

@@ -1,184 +0,0 @@
pub use crate::pac::pwr::vals::Vos as VoltageScale;
use crate::pac::rcc::vals::Sw;
pub use crate::pac::rcc::vals::{
Adcsel as AdcClockSource, Hpre as AHBPrescaler, Msirange as MSIRange, Pllm, Plln, Pllp, Pllq, Pllr,
Pllsrc as PllSource, Ppre as APBPrescaler,
};
use crate::pac::{FLASH, RCC};
use crate::rcc::{set_freqs, Clocks};
use crate::time::Hertz;
/// HSI speed
pub const HSI_FREQ: Hertz = Hertz(16_000_000);
/// HSE speed
pub const HSE_FREQ: Hertz = Hertz(32_000_000);
/// System clock mux source
#[derive(Clone, Copy)]
pub enum ClockSrc {
MSI(MSIRange),
HSE,
HSI16,
}
/// Clocks configutation
pub struct Config {
pub mux: ClockSrc,
pub ahb_pre: AHBPrescaler,
pub shd_ahb_pre: AHBPrescaler,
pub apb1_pre: APBPrescaler,
pub apb2_pre: APBPrescaler,
pub adc_clock_source: AdcClockSource,
pub ls: super::LsConfig,
}
impl Default for Config {
#[inline]
fn default() -> Config {
Config {
mux: ClockSrc::MSI(MSIRange::RANGE4M),
ahb_pre: AHBPrescaler::DIV1,
shd_ahb_pre: AHBPrescaler::DIV1,
apb1_pre: APBPrescaler::DIV1,
apb2_pre: APBPrescaler::DIV1,
adc_clock_source: AdcClockSource::HSI16,
ls: Default::default(),
}
}
}
pub(crate) unsafe fn init(config: Config) {
let (sys_clk, sw, vos) = match config.mux {
ClockSrc::HSI16 => (HSI_FREQ, Sw::HSI16, VoltageScale::RANGE2),
ClockSrc::HSE => (HSE_FREQ, Sw::HSE, VoltageScale::RANGE1),
ClockSrc::MSI(range) => (msirange_to_hertz(range), Sw::MSI, msirange_to_vos(range)),
};
let ahb_freq = sys_clk / config.ahb_pre;
let shd_ahb_freq = sys_clk / config.shd_ahb_pre;
let (apb1_freq, apb1_tim_freq) = match config.apb1_pre {
APBPrescaler::DIV1 => (ahb_freq, ahb_freq),
pre => {
let freq = ahb_freq / pre;
(freq, freq * 2u32)
}
};
let (apb2_freq, apb2_tim_freq) = match config.apb2_pre {
APBPrescaler::DIV1 => (ahb_freq, ahb_freq),
pre => {
let freq = ahb_freq / pre;
(freq, freq * 2u32)
}
};
// Adjust flash latency
let flash_clk_src_freq = shd_ahb_freq;
let ws = match vos {
VoltageScale::RANGE1 => match flash_clk_src_freq.0 {
0..=18_000_000 => 0b000,
18_000_001..=36_000_000 => 0b001,
_ => 0b010,
},
VoltageScale::RANGE2 => match flash_clk_src_freq.0 {
0..=6_000_000 => 0b000,
6_000_001..=12_000_000 => 0b001,
_ => 0b010,
},
_ => unreachable!(),
};
FLASH.acr().modify(|w| {
w.set_latency(ws);
});
while FLASH.acr().read().latency() != ws {}
match config.mux {
ClockSrc::HSI16 => {
// Enable HSI16
RCC.cr().write(|w| w.set_hsion(true));
while !RCC.cr().read().hsirdy() {}
}
ClockSrc::HSE => {
// Enable HSE
RCC.cr().write(|w| {
w.set_hsebyppwr(true);
w.set_hseon(true);
});
while !RCC.cr().read().hserdy() {}
}
ClockSrc::MSI(range) => {
let cr = RCC.cr().read();
assert!(!cr.msion() || cr.msirdy());
RCC.cr().write(|w| {
w.set_msirgsel(true);
w.set_msirange(range);
w.set_msion(true);
// If LSE is enabled, enable calibration of MSI
w.set_msipllen(config.ls.lse.is_some());
});
while !RCC.cr().read().msirdy() {}
}
}
RCC.extcfgr().modify(|w| {
w.set_shdhpre(config.shd_ahb_pre);
});
RCC.cfgr().modify(|w| {
w.set_sw(sw.into());
w.set_hpre(config.ahb_pre);
w.set_ppre1(config.apb1_pre);
w.set_ppre2(config.apb2_pre);
});
// ADC clock MUX
RCC.ccipr().modify(|w| w.set_adcsel(config.adc_clock_source));
// TODO: switch voltage range
let rtc = config.ls.init();
set_freqs(Clocks {
sys: sys_clk,
hclk1: ahb_freq,
hclk2: ahb_freq,
hclk3: shd_ahb_freq,
pclk1: apb1_freq,
pclk2: apb2_freq,
pclk3: shd_ahb_freq,
pclk1_tim: apb1_tim_freq,
pclk2_tim: apb2_tim_freq,
rtc,
});
}
fn msirange_to_hertz(range: MSIRange) -> Hertz {
match range {
MSIRange::RANGE100K => Hertz(100_000),
MSIRange::RANGE200K => Hertz(200_000),
MSIRange::RANGE400K => Hertz(400_000),
MSIRange::RANGE800K => Hertz(800_000),
MSIRange::RANGE1M => Hertz(1_000_000),
MSIRange::RANGE2M => Hertz(2_000_000),
MSIRange::RANGE4M => Hertz(4_000_000),
MSIRange::RANGE8M => Hertz(8_000_000),
MSIRange::RANGE16M => Hertz(16_000_000),
MSIRange::RANGE24M => Hertz(24_000_000),
MSIRange::RANGE32M => Hertz(32_000_000),
MSIRange::RANGE48M => Hertz(48_000_000),
_ => unreachable!(),
}
}
fn msirange_to_vos(range: MSIRange) -> VoltageScale {
if range.to_bits() > MSIRange::RANGE16M.to_bits() {
VoltageScale::RANGE1
} else {
VoltageScale::RANGE2
}
}

View File

@@ -4,8 +4,60 @@ use core::convert::From;
#[cfg(feature = "chrono")] #[cfg(feature = "chrono")]
use chrono::{self, Datelike, NaiveDate, Timelike, Weekday}; use chrono::{self, Datelike, NaiveDate, Timelike, Weekday};
use super::byte_to_bcd2; #[cfg(any(feature = "defmt", feature = "time"))]
use crate::pac::rtc::Rtc; use crate::peripherals::RTC;
#[cfg(any(feature = "defmt", feature = "time"))]
use crate::rtc::sealed::Instance;
/// Represents an instant in time that can be substracted to compute a duration
pub struct RtcInstant {
/// 0..59
pub second: u8,
/// 0..256
pub subsecond: u16,
}
impl RtcInstant {
#[allow(dead_code)]
pub(super) fn from(second: u8, subsecond: u16) -> Result<Self, super::RtcError> {
Ok(Self { second, subsecond })
}
}
#[cfg(feature = "defmt")]
impl defmt::Format for RtcInstant {
fn format(&self, fmt: defmt::Formatter) {
defmt::write!(
fmt,
"{}:{}",
self.second,
RTC::regs().prer().read().prediv_s() - self.subsecond,
)
}
}
#[cfg(feature = "time")]
impl core::ops::Sub for RtcInstant {
type Output = embassy_time::Duration;
fn sub(self, rhs: Self) -> Self::Output {
use embassy_time::{Duration, TICK_HZ};
let second = if self.second < rhs.second {
self.second + 60
} else {
self.second
};
let psc = RTC::regs().prer().read().prediv_s() as u32;
let self_ticks = second as u32 * (psc + 1) + (psc - self.subsecond as u32);
let other_ticks = rhs.second as u32 * (psc + 1) + (psc - rhs.subsecond as u32);
let rtc_ticks = self_ticks - other_ticks;
Duration::from_ticks(((rtc_ticks * TICK_HZ as u32) / (psc + 1)) as u64)
}
}
/// Errors regarding the [`DateTime`] struct. /// Errors regarding the [`DateTime`] struct.
#[derive(Clone, Debug, PartialEq, Eq)] #[derive(Clone, Debug, PartialEq, Eq)]
@@ -32,19 +84,85 @@ pub enum Error {
/// Structure containing date and time information /// Structure containing date and time information
pub struct DateTime { pub struct DateTime {
/// 0..4095 /// 0..4095
pub year: u16, year: u16,
/// 1..12, 1 is January /// 1..12, 1 is January
pub month: u8, month: u8,
/// 1..28,29,30,31 depending on month /// 1..28,29,30,31 depending on month
pub day: u8, day: u8,
/// ///
pub day_of_week: DayOfWeek, day_of_week: DayOfWeek,
/// 0..23 /// 0..23
pub hour: u8, hour: u8,
/// 0..59 /// 0..59
pub minute: u8, minute: u8,
/// 0..59 /// 0..59
pub second: u8, second: u8,
}
impl DateTime {
pub const fn year(&self) -> u16 {
self.year
}
pub const fn month(&self) -> u8 {
self.month
}
pub const fn day(&self) -> u8 {
self.day
}
pub const fn day_of_week(&self) -> DayOfWeek {
self.day_of_week
}
pub const fn hour(&self) -> u8 {
self.hour
}
pub const fn minute(&self) -> u8 {
self.minute
}
pub const fn second(&self) -> u8 {
self.second
}
pub fn from(
year: u16,
month: u8,
day: u8,
day_of_week: u8,
hour: u8,
minute: u8,
second: u8,
) -> Result<Self, Error> {
let day_of_week = day_of_week_from_u8(day_of_week)?;
if year > 4095 {
Err(Error::InvalidYear)
} else if month < 1 || month > 12 {
Err(Error::InvalidMonth)
} else if day < 1 || day > 31 {
Err(Error::InvalidDay)
} else if hour > 23 {
Err(Error::InvalidHour)
} else if minute > 59 {
Err(Error::InvalidMinute)
} else if second > 59 {
Err(Error::InvalidSecond)
} else {
Ok(Self {
year,
month,
day,
day_of_week,
hour,
minute,
second,
})
}
}
} }
#[cfg(feature = "chrono")] #[cfg(feature = "chrono")]
@@ -142,58 +260,3 @@ pub(super) fn validate_datetime(dt: &DateTime) -> Result<(), Error> {
Ok(()) Ok(())
} }
} }
pub(super) fn write_date_time(rtc: &Rtc, t: DateTime) {
let (ht, hu) = byte_to_bcd2(t.hour as u8);
let (mnt, mnu) = byte_to_bcd2(t.minute as u8);
let (st, su) = byte_to_bcd2(t.second as u8);
let (dt, du) = byte_to_bcd2(t.day as u8);
let (mt, mu) = byte_to_bcd2(t.month as u8);
let yr = t.year as u16;
let yr_offset = (yr - 1970_u16) as u8;
let (yt, yu) = byte_to_bcd2(yr_offset);
use crate::pac::rtc::vals::Ampm;
rtc.tr().write(|w| {
w.set_ht(ht);
w.set_hu(hu);
w.set_mnt(mnt);
w.set_mnu(mnu);
w.set_st(st);
w.set_su(su);
w.set_pm(Ampm::AM);
});
rtc.dr().write(|w| {
w.set_dt(dt);
w.set_du(du);
w.set_mt(mt > 0);
w.set_mu(mu);
w.set_yt(yt);
w.set_yu(yu);
w.set_wdu(day_of_week_to_u8(t.day_of_week));
});
}
pub(super) fn datetime(
year: u16,
month: u8,
day: u8,
day_of_week: u8,
hour: u8,
minute: u8,
second: u8,
) -> Result<DateTime, Error> {
let day_of_week = day_of_week_from_u8(day_of_week)?;
Ok(DateTime {
year,
month,
day,
day_of_week,
hour,
minute,
second,
})
}

View File

@@ -9,7 +9,8 @@ use embassy_sync::blocking_mutex::raw::CriticalSectionRawMutex;
#[cfg(feature = "low-power")] #[cfg(feature = "low-power")]
use embassy_sync::blocking_mutex::Mutex; use embassy_sync::blocking_mutex::Mutex;
pub use self::datetime::{DateTime, DayOfWeek, Error as DateTimeError}; pub use self::datetime::{DateTime, DayOfWeek, Error as DateTimeError, RtcInstant};
use crate::rtc::datetime::day_of_week_to_u8;
use crate::time::Hertz; use crate::time::Hertz;
/// refer to AN4759 to compare features of RTC2 and RTC3 /// refer to AN4759 to compare features of RTC2 and RTC3
@@ -39,48 +40,6 @@ pub enum RtcError {
NotRunning, NotRunning,
} }
#[cfg(feature = "low-power")]
/// Represents an instant in time that can be substracted to compute a duration
struct RtcInstant {
second: u8,
subsecond: u16,
}
#[cfg(all(feature = "low-power", feature = "defmt"))]
impl defmt::Format for RtcInstant {
fn format(&self, fmt: defmt::Formatter) {
defmt::write!(
fmt,
"{}:{}",
self.second,
RTC::regs().prer().read().prediv_s() - self.subsecond,
)
}
}
#[cfg(feature = "low-power")]
impl core::ops::Sub for RtcInstant {
type Output = embassy_time::Duration;
fn sub(self, rhs: Self) -> Self::Output {
use embassy_time::{Duration, TICK_HZ};
let second = if self.second < rhs.second {
self.second + 60
} else {
self.second
};
let psc = RTC::regs().prer().read().prediv_s() as u32;
let self_ticks = second as u32 * (psc + 1) + (psc - self.subsecond as u32);
let other_ticks = rhs.second as u32 * (psc + 1) + (psc - rhs.subsecond as u32);
let rtc_ticks = self_ticks - other_ticks;
Duration::from_ticks(((rtc_ticks * TICK_HZ as u32) / (psc + 1)) as u64)
}
}
pub struct RtcTimeProvider { pub struct RtcTimeProvider {
_private: (), _private: (),
} }
@@ -113,7 +72,7 @@ impl RtcTimeProvider {
let month = bcd2_to_byte((dr.mt() as u8, dr.mu())); let month = bcd2_to_byte((dr.mt() as u8, dr.mu()));
let year = bcd2_to_byte((dr.yt(), dr.yu())) as u16 + 1970_u16; let year = bcd2_to_byte((dr.yt(), dr.yu())) as u16 + 1970_u16;
return self::datetime::datetime(year, month, day, weekday, hour, minute, second) return DateTime::from(year, month, day, weekday, hour, minute, second)
.map_err(RtcError::InvalidDateTime); .map_err(RtcError::InvalidDateTime);
} }
} }
@@ -134,7 +93,7 @@ impl RtcTimeProvider {
let month = bcd2_to_byte((dr.mt() as u8, dr.mu())); let month = bcd2_to_byte((dr.mt() as u8, dr.mu()));
let year = bcd2_to_byte((dr.yt(), dr.yu())) as u16 + 1970_u16; let year = bcd2_to_byte((dr.yt(), dr.yu())) as u16 + 1970_u16;
self::datetime::datetime(year, month, day, weekday, hour, minute, second).map_err(RtcError::InvalidDateTime) DateTime::from(year, month, day, weekday, hour, minute, second).map_err(RtcError::InvalidDateTime)
} }
} }
} }
@@ -184,7 +143,13 @@ impl Default for RtcCalibrationCyclePeriod {
impl Rtc { impl Rtc {
pub fn new(_rtc: impl Peripheral<P = RTC>, rtc_config: RtcConfig) -> Self { pub fn new(_rtc: impl Peripheral<P = RTC>, rtc_config: RtcConfig) -> Self {
#[cfg(not(any(stm32l0, stm32f3, stm32l1, stm32f0, stm32f2)))] #[cfg(not(any(stm32l0, stm32f3, stm32l1, stm32f0, stm32f2)))]
<RTC as crate::rcc::sealed::RccPeripheral>::enable_and_reset(); critical_section::with(|cs| {
<RTC as crate::rcc::sealed::RccPeripheral>::enable_and_reset_with_cs(cs);
#[cfg(feature = "low-power")]
unsafe {
crate::rcc::REFCOUNT_STOP2 -= 1
};
});
let mut this = Self { let mut this = Self {
#[cfg(feature = "low-power")] #[cfg(feature = "low-power")]
@@ -219,14 +184,46 @@ impl Rtc {
/// Will return `RtcError::InvalidDateTime` if the datetime is not a valid range. /// Will return `RtcError::InvalidDateTime` if the datetime is not a valid range.
pub fn set_datetime(&mut self, t: DateTime) -> Result<(), RtcError> { pub fn set_datetime(&mut self, t: DateTime) -> Result<(), RtcError> {
self::datetime::validate_datetime(&t).map_err(RtcError::InvalidDateTime)?; self::datetime::validate_datetime(&t).map_err(RtcError::InvalidDateTime)?;
self.write(true, |rtc| self::datetime::write_date_time(rtc, t)); self.write(true, |rtc| {
let (ht, hu) = byte_to_bcd2(t.hour() as u8);
let (mnt, mnu) = byte_to_bcd2(t.minute() as u8);
let (st, su) = byte_to_bcd2(t.second() as u8);
let (dt, du) = byte_to_bcd2(t.day() as u8);
let (mt, mu) = byte_to_bcd2(t.month() as u8);
let yr = t.year() as u16;
let yr_offset = (yr - 1970_u16) as u8;
let (yt, yu) = byte_to_bcd2(yr_offset);
use crate::pac::rtc::vals::Ampm;
rtc.tr().write(|w| {
w.set_ht(ht);
w.set_hu(hu);
w.set_mnt(mnt);
w.set_mnu(mnu);
w.set_st(st);
w.set_su(su);
w.set_pm(Ampm::AM);
});
rtc.dr().write(|w| {
w.set_dt(dt);
w.set_du(du);
w.set_mt(mt > 0);
w.set_mu(mu);
w.set_yt(yt);
w.set_yu(yu);
w.set_wdu(day_of_week_to_u8(t.day_of_week()));
});
});
Ok(()) Ok(())
} }
#[cfg(feature = "low-power")] #[cfg(not(rtc_v2f2))]
/// Return the current instant. /// Return the current instant.
fn instant(&self) -> RtcInstant { pub fn instant(&self) -> Result<RtcInstant, RtcError> {
let r = RTC::regs(); let r = RTC::regs();
let tr = r.tr().read(); let tr = r.tr().read();
let subsecond = r.ssr().read().ss(); let subsecond = r.ssr().read().ss();
@@ -235,7 +232,7 @@ impl Rtc {
// Unlock the registers // Unlock the registers
r.dr().read(); r.dr().read();
RtcInstant { second, subsecond } RtcInstant::from(second, subsecond.try_into().unwrap())
} }
/// Return the current datetime. /// Return the current datetime.

View File

@@ -95,15 +95,16 @@ impl super::Rtc {
regs.cr().modify(|w| w.set_wutie(true)); regs.cr().modify(|w| w.set_wutie(true));
}); });
let instant = self.instant().unwrap();
trace!( trace!(
"rtc: start wakeup alarm for {} ms (psc: {}, ticks: {}) at {}", "rtc: start wakeup alarm for {} ms (psc: {}, ticks: {}) at {}",
Duration::from_ticks(rtc_ticks as u64 * TICK_HZ * prescaler as u64 / rtc_hz).as_millis(), Duration::from_ticks(rtc_ticks as u64 * TICK_HZ * prescaler as u64 / rtc_hz).as_millis(),
prescaler as u32, prescaler as u32,
rtc_ticks, rtc_ticks,
self.instant(), instant,
); );
assert!(self.stop_time.borrow(cs).replace(Some(self.instant())).is_none()) assert!(self.stop_time.borrow(cs).replace(Some(instant)).is_none())
} }
#[cfg(feature = "low-power")] #[cfg(feature = "low-power")]
@@ -112,8 +113,9 @@ impl super::Rtc {
pub(crate) fn stop_wakeup_alarm(&self, cs: critical_section::CriticalSection) -> Option<embassy_time::Duration> { pub(crate) fn stop_wakeup_alarm(&self, cs: critical_section::CriticalSection) -> Option<embassy_time::Duration> {
use crate::interrupt::typelevel::Interrupt; use crate::interrupt::typelevel::Interrupt;
let instant = self.instant().unwrap();
if RTC::regs().cr().read().wute() { if RTC::regs().cr().read().wute() {
trace!("rtc: stop wakeup alarm at {}", self.instant()); trace!("rtc: stop wakeup alarm at {}", instant);
self.write(false, |regs| { self.write(false, |regs| {
regs.cr().modify(|w| w.set_wutie(false)); regs.cr().modify(|w| w.set_wutie(false));
@@ -128,10 +130,7 @@ impl super::Rtc {
}); });
} }
self.stop_time self.stop_time.borrow(cs).take().map(|stop_time| instant - stop_time)
.borrow(cs)
.take()
.map(|stop_time| self.instant() - stop_time)
} }
#[cfg(feature = "low-power")] #[cfg(feature = "low-power")]

View File

@@ -1466,7 +1466,7 @@ cfg_if::cfg_if! {
(SDMMC1) => { (SDMMC1) => {
critical_section::with(|_| unsafe { critical_section::with(|_| unsafe {
let sdmmcsel = crate::pac::RCC.dckcfgr2().read().sdmmc1sel(); let sdmmcsel = crate::pac::RCC.dckcfgr2().read().sdmmc1sel();
if sdmmcsel == crate::pac::rcc::vals::Sdmmcsel::SYSCLK { if sdmmcsel == crate::pac::rcc::vals::Sdmmcsel::SYS {
crate::rcc::get_freqs().sys crate::rcc::get_freqs().sys
} else { } else {
crate::rcc::get_freqs().pll1_q.expect("PLL48 is required for SDMMC") crate::rcc::get_freqs().pll1_q.expect("PLL48 is required for SDMMC")
@@ -1476,7 +1476,7 @@ cfg_if::cfg_if! {
(SDMMC2) => { (SDMMC2) => {
critical_section::with(|_| unsafe { critical_section::with(|_| unsafe {
let sdmmcsel = crate::pac::RCC.dckcfgr2().read().sdmmc2sel(); let sdmmcsel = crate::pac::RCC.dckcfgr2().read().sdmmc2sel();
if sdmmcsel == crate::pac::rcc::vals::Sdmmcsel::SYSCLK { if sdmmcsel == crate::pac::rcc::vals::Sdmmcsel::SYS {
crate::rcc::get_freqs().sys crate::rcc::get_freqs().sys
} else { } else {
crate::rcc::get_freqs().pll1_q.expect("PLL48 is required for SDMMC") crate::rcc::get_freqs().pll1_q.expect("PLL48 is required for SDMMC")

View File

@@ -57,18 +57,20 @@ impl<'d, T: ComplementaryCaptureCompare16bitInstance> ComplementaryPwm<'d, T> {
_ch4: Option<PwmPin<'d, T, Ch4>>, _ch4: Option<PwmPin<'d, T, Ch4>>,
_ch4n: Option<ComplementaryPwmPin<'d, T, Ch4>>, _ch4n: Option<ComplementaryPwmPin<'d, T, Ch4>>,
freq: Hertz, freq: Hertz,
counting_mode: CountingMode,
) -> Self { ) -> Self {
Self::new_inner(tim, freq) Self::new_inner(tim, freq, counting_mode)
} }
fn new_inner(tim: impl Peripheral<P = T> + 'd, freq: Hertz) -> Self { fn new_inner(tim: impl Peripheral<P = T> + 'd, freq: Hertz, counting_mode: CountingMode) -> Self {
into_ref!(tim); into_ref!(tim);
T::enable_and_reset(); T::enable_and_reset();
let mut this = Self { inner: tim }; let mut this = Self { inner: tim };
this.inner.set_frequency(freq); this.inner.set_counting_mode(counting_mode);
this.set_freq(freq);
this.inner.start(); this.inner.start();
this.inner.enable_outputs(); this.inner.enable_outputs();
@@ -95,7 +97,12 @@ impl<'d, T: ComplementaryCaptureCompare16bitInstance> ComplementaryPwm<'d, T> {
} }
pub fn set_freq(&mut self, freq: Hertz) { pub fn set_freq(&mut self, freq: Hertz) {
self.inner.set_frequency(freq); let multiplier = if self.inner.get_counting_mode().is_center_aligned() {
2u8
} else {
1u8
};
self.inner.set_frequency(freq * multiplier);
} }
pub fn get_max_duty(&self) -> u16 { pub fn get_max_duty(&self) -> u16 {

View File

@@ -29,10 +29,17 @@ pub(crate) mod sealed {
Self::regs().cr1().modify(|r| r.set_cen(false)); Self::regs().cr1().modify(|r| r.set_cen(false));
} }
/// Reset the counter value to 0
fn reset(&mut self) { fn reset(&mut self) {
Self::regs().cnt().write(|r| r.set_cnt(0)); Self::regs().cnt().write(|r| r.set_cnt(0));
} }
/// Set the frequency of how many times per second the timer counts up to the max value or down to 0.
///
/// This means that in the default edge-aligned mode,
/// the timer counter will wrap around at the same frequency as is being set.
/// In center-aligned mode (which not all timers support), the wrap-around frequency is effectively halved
/// because it needs to count up and down.
fn set_frequency(&mut self, frequency: Hertz) { fn set_frequency(&mut self, frequency: Hertz) {
let f = frequency.0; let f = frequency.0;
let timer_f = Self::frequency().0; let timer_f = Self::frequency().0;
@@ -85,8 +92,21 @@ pub(crate) mod sealed {
pub trait GeneralPurpose16bitInstance: Basic16bitInstance { pub trait GeneralPurpose16bitInstance: Basic16bitInstance {
fn regs_gp16() -> crate::pac::timer::TimGp16; fn regs_gp16() -> crate::pac::timer::TimGp16;
fn set_count_direction(&mut self, direction: vals::Dir) { fn set_counting_mode(&mut self, mode: CountingMode) {
Self::regs_gp16().cr1().modify(|r| r.set_dir(direction)); let (cms, dir) = mode.into();
let timer_enabled = Self::regs().cr1().read().cen();
// Changing from edge aligned to center aligned (and vice versa) is not allowed while the timer is running.
// Changing direction is discouraged while the timer is running.
assert!(!timer_enabled);
Self::regs_gp16().cr1().modify(|r| r.set_dir(dir));
Self::regs_gp16().cr1().modify(|r| r.set_cms(cms))
}
fn get_counting_mode(&self) -> CountingMode {
let cr1 = Self::regs_gp16().cr1().read();
(cr1.cms(), cr1.dir()).into()
} }
fn set_clock_division(&mut self, ckd: vals::Ckd) { fn set_clock_division(&mut self, ckd: vals::Ckd) {
@@ -293,6 +313,73 @@ impl From<InputTISelection> for stm32_metapac::timer::vals::CcmrInputCcs {
} }
} }
#[repr(u8)]
#[derive(Debug, Clone, Copy, PartialEq, Eq, Default)]
pub enum CountingMode {
#[default]
/// The timer counts up to the reload value and then resets back to 0.
EdgeAlignedUp,
/// The timer counts down to 0 and then resets back to the reload value.
EdgeAlignedDown,
/// The timer counts up to the reload value and then counts back to 0.
///
/// The output compare interrupt flags of channels configured in output are
/// set when the counter is counting down.
CenterAlignedDownInterrupts,
/// The timer counts up to the reload value and then counts back to 0.
///
/// The output compare interrupt flags of channels configured in output are
/// set when the counter is counting up.
CenterAlignedUpInterrupts,
/// The timer counts up to the reload value and then counts back to 0.
///
/// The output compare interrupt flags of channels configured in output are
/// set when the counter is counting both up or down.
CenterAlignedBothInterrupts,
}
impl CountingMode {
pub fn is_edge_aligned(&self) -> bool {
match self {
CountingMode::EdgeAlignedUp | CountingMode::EdgeAlignedDown => true,
_ => false,
}
}
pub fn is_center_aligned(&self) -> bool {
match self {
CountingMode::CenterAlignedDownInterrupts
| CountingMode::CenterAlignedUpInterrupts
| CountingMode::CenterAlignedBothInterrupts => true,
_ => false,
}
}
}
impl From<CountingMode> for (vals::Cms, vals::Dir) {
fn from(value: CountingMode) -> Self {
match value {
CountingMode::EdgeAlignedUp => (vals::Cms::EDGEALIGNED, vals::Dir::UP),
CountingMode::EdgeAlignedDown => (vals::Cms::EDGEALIGNED, vals::Dir::DOWN),
CountingMode::CenterAlignedDownInterrupts => (vals::Cms::CENTERALIGNED1, vals::Dir::UP),
CountingMode::CenterAlignedUpInterrupts => (vals::Cms::CENTERALIGNED2, vals::Dir::UP),
CountingMode::CenterAlignedBothInterrupts => (vals::Cms::CENTERALIGNED3, vals::Dir::UP),
}
}
}
impl From<(vals::Cms, vals::Dir)> for CountingMode {
fn from(value: (vals::Cms, vals::Dir)) -> Self {
match value {
(vals::Cms::EDGEALIGNED, vals::Dir::UP) => CountingMode::EdgeAlignedUp,
(vals::Cms::EDGEALIGNED, vals::Dir::DOWN) => CountingMode::EdgeAlignedDown,
(vals::Cms::CENTERALIGNED1, _) => CountingMode::CenterAlignedDownInterrupts,
(vals::Cms::CENTERALIGNED2, _) => CountingMode::CenterAlignedUpInterrupts,
(vals::Cms::CENTERALIGNED3, _) => CountingMode::CenterAlignedBothInterrupts,
}
}
}
#[derive(Clone, Copy)] #[derive(Clone, Copy)]
pub enum OutputCompareMode { pub enum OutputCompareMode {
Frozen, Frozen,
@@ -471,9 +558,5 @@ foreach_interrupt! {
crate::pac::$inst crate::pac::$inst
} }
} }
}; };
} }

View File

@@ -56,18 +56,20 @@ impl<'d, T: CaptureCompare16bitInstance> SimplePwm<'d, T> {
_ch3: Option<PwmPin<'d, T, Ch3>>, _ch3: Option<PwmPin<'d, T, Ch3>>,
_ch4: Option<PwmPin<'d, T, Ch4>>, _ch4: Option<PwmPin<'d, T, Ch4>>,
freq: Hertz, freq: Hertz,
counting_mode: CountingMode,
) -> Self { ) -> Self {
Self::new_inner(tim, freq) Self::new_inner(tim, freq, counting_mode)
} }
fn new_inner(tim: impl Peripheral<P = T> + 'd, freq: Hertz) -> Self { fn new_inner(tim: impl Peripheral<P = T> + 'd, freq: Hertz, counting_mode: CountingMode) -> Self {
into_ref!(tim); into_ref!(tim);
T::enable_and_reset(); T::enable_and_reset();
let mut this = Self { inner: tim }; let mut this = Self { inner: tim };
this.inner.set_frequency(freq); this.inner.set_counting_mode(counting_mode);
this.set_freq(freq);
this.inner.start(); this.inner.start();
this.inner.enable_outputs(); this.inner.enable_outputs();
@@ -92,7 +94,12 @@ impl<'d, T: CaptureCompare16bitInstance> SimplePwm<'d, T> {
} }
pub fn set_freq(&mut self, freq: Hertz) { pub fn set_freq(&mut self, freq: Hertz) {
self.inner.set_frequency(freq); let multiplier = if self.inner.get_counting_mode().is_center_aligned() {
2u8
} else {
1u8
};
self.inner.set_frequency(freq * multiplier);
} }
pub fn get_max_duty(&self) -> u16 { pub fn get_max_duty(&self) -> u16 {

View File

@@ -116,28 +116,28 @@ pub struct BufferedUartRx<'d, T: BasicInstance> {
impl<'d, T: BasicInstance> SetConfig for BufferedUart<'d, T> { impl<'d, T: BasicInstance> SetConfig for BufferedUart<'d, T> {
type Config = Config; type Config = Config;
type ConfigError = (); type ConfigError = ConfigError;
fn set_config(&mut self, config: &Self::Config) -> Result<(), ()> { fn set_config(&mut self, config: &Self::Config) -> Result<(), Self::ConfigError> {
self.set_config(config).map_err(|_| ()) self.set_config(config)
} }
} }
impl<'d, T: BasicInstance> SetConfig for BufferedUartRx<'d, T> { impl<'d, T: BasicInstance> SetConfig for BufferedUartRx<'d, T> {
type Config = Config; type Config = Config;
type ConfigError = (); type ConfigError = ConfigError;
fn set_config(&mut self, config: &Self::Config) -> Result<(), ()> { fn set_config(&mut self, config: &Self::Config) -> Result<(), Self::ConfigError> {
self.set_config(config).map_err(|_| ()) self.set_config(config)
} }
} }
impl<'d, T: BasicInstance> SetConfig for BufferedUartTx<'d, T> { impl<'d, T: BasicInstance> SetConfig for BufferedUartTx<'d, T> {
type Config = Config; type Config = Config;
type ConfigError = (); type ConfigError = ConfigError;
fn set_config(&mut self, config: &Self::Config) -> Result<(), ()> { fn set_config(&mut self, config: &Self::Config) -> Result<(), Self::ConfigError> {
self.set_config(config).map_err(|_| ()) self.set_config(config)
} }
} }
@@ -233,9 +233,6 @@ impl<'d, T: BasicInstance> BufferedUart<'d, T> {
configure(r, &config, T::frequency(), T::KIND, true, true)?; configure(r, &config, T::frequency(), T::KIND, true, true)?;
r.cr1().modify(|w| { r.cr1().modify(|w| {
#[cfg(lpuart_v2)]
w.set_fifoen(true);
w.set_rxneie(true); w.set_rxneie(true);
w.set_idleie(true); w.set_idleie(true);
}); });
@@ -254,7 +251,14 @@ impl<'d, T: BasicInstance> BufferedUart<'d, T> {
} }
pub fn set_config(&mut self, config: &Config) -> Result<(), ConfigError> { pub fn set_config(&mut self, config: &Config) -> Result<(), ConfigError> {
reconfigure::<T>(config) reconfigure::<T>(config)?;
T::regs().cr1().modify(|w| {
w.set_rxneie(true);
w.set_idleie(true);
});
Ok(())
} }
} }
@@ -334,7 +338,14 @@ impl<'d, T: BasicInstance> BufferedUartRx<'d, T> {
} }
pub fn set_config(&mut self, config: &Config) -> Result<(), ConfigError> { pub fn set_config(&mut self, config: &Config) -> Result<(), ConfigError> {
reconfigure::<T>(config) reconfigure::<T>(config)?;
T::regs().cr1().modify(|w| {
w.set_rxneie(true);
w.set_idleie(true);
});
Ok(())
} }
} }
@@ -408,7 +419,14 @@ impl<'d, T: BasicInstance> BufferedUartTx<'d, T> {
} }
pub fn set_config(&mut self, config: &Config) -> Result<(), ConfigError> { pub fn set_config(&mut self, config: &Config) -> Result<(), ConfigError> {
reconfigure::<T>(config) reconfigure::<T>(config)?;
T::regs().cr1().modify(|w| {
w.set_rxneie(true);
w.set_idleie(true);
});
Ok(())
} }
} }

View File

@@ -108,6 +108,7 @@ pub enum StopBits {
pub enum ConfigError { pub enum ConfigError {
BaudrateTooLow, BaudrateTooLow,
BaudrateTooHigh, BaudrateTooHigh,
RxOrTxNotEnabled,
} }
#[non_exhaustive] #[non_exhaustive]
@@ -181,11 +182,11 @@ pub struct Uart<'d, T: BasicInstance, TxDma = NoDma, RxDma = NoDma> {
impl<'d, T: BasicInstance, TxDma, RxDma> SetConfig for Uart<'d, T, TxDma, RxDma> { impl<'d, T: BasicInstance, TxDma, RxDma> SetConfig for Uart<'d, T, TxDma, RxDma> {
type Config = Config; type Config = Config;
type ConfigError = (); type ConfigError = ConfigError;
fn set_config(&mut self, config: &Self::Config) -> Result<(), ()> { fn set_config(&mut self, config: &Self::Config) -> Result<(), Self::ConfigError> {
self.tx.set_config(config).map_err(|_| ())?; self.tx.set_config(config)?;
self.rx.set_config(config).map_err(|_| ()) self.rx.set_config(config)
} }
} }
@@ -196,10 +197,10 @@ pub struct UartTx<'d, T: BasicInstance, TxDma = NoDma> {
impl<'d, T: BasicInstance, TxDma> SetConfig for UartTx<'d, T, TxDma> { impl<'d, T: BasicInstance, TxDma> SetConfig for UartTx<'d, T, TxDma> {
type Config = Config; type Config = Config;
type ConfigError = (); type ConfigError = ConfigError;
fn set_config(&mut self, config: &Self::Config) -> Result<(), ()> { fn set_config(&mut self, config: &Self::Config) -> Result<(), Self::ConfigError> {
self.set_config(config).map_err(|_| ()) self.set_config(config)
} }
} }
@@ -213,10 +214,10 @@ pub struct UartRx<'d, T: BasicInstance, RxDma = NoDma> {
impl<'d, T: BasicInstance, RxDma> SetConfig for UartRx<'d, T, RxDma> { impl<'d, T: BasicInstance, RxDma> SetConfig for UartRx<'d, T, RxDma> {
type Config = Config; type Config = Config;
type ConfigError = (); type ConfigError = ConfigError;
fn set_config(&mut self, config: &Self::Config) -> Result<(), ()> { fn set_config(&mut self, config: &Self::Config) -> Result<(), Self::ConfigError> {
self.set_config(config).map_err(|_| ()) self.set_config(config)
} }
} }
@@ -866,7 +867,7 @@ fn configure(
enable_tx: bool, enable_tx: bool,
) -> Result<(), ConfigError> { ) -> Result<(), ConfigError> {
if !enable_rx && !enable_tx { if !enable_rx && !enable_tx {
panic!("USART: At least one of RX or TX should be enabled"); return Err(ConfigError::RxOrTxNotEnabled);
} }
#[cfg(not(usart_v4))] #[cfg(not(usart_v4))]
@@ -909,6 +910,11 @@ fn configure(
brr + rounding brr + rounding
} }
// UART must be disabled during configuration.
r.cr1().modify(|w| {
w.set_ue(false);
});
#[cfg(not(usart_v1))] #[cfg(not(usart_v1))]
let mut over8 = false; let mut over8 = false;
let mut found_brr = None; let mut found_brr = None;
@@ -968,6 +974,12 @@ fn configure(
#[cfg(any(usart_v3, usart_v4))] #[cfg(any(usart_v3, usart_v4))]
w.set_swap(config.swap_rx_tx); w.set_swap(config.swap_rx_tx);
}); });
#[cfg(not(usart_v1))]
r.cr3().modify(|w| {
w.set_onebit(config.assume_noise_free);
});
r.cr1().write(|w| { r.cr1().write(|w| {
// enable uart // enable uart
w.set_ue(true); w.set_ue(true);
@@ -976,6 +988,7 @@ fn configure(
// enable receiver // enable receiver
w.set_re(enable_rx); w.set_re(enable_rx);
// configure word size // configure word size
// if using odd or even parity it must be configured to 9bits
w.set_m0(if config.parity != Parity::ParityNone { w.set_m0(if config.parity != Parity::ParityNone {
vals::M0::BIT9 vals::M0::BIT9
} else { } else {
@@ -994,11 +1007,6 @@ fn configure(
w.set_fifoen(true); w.set_fifoen(true);
}); });
#[cfg(not(usart_v1))]
r.cr3().modify(|w| {
w.set_onebit(config.assume_noise_free);
});
Ok(()) Ok(())
} }

View File

@@ -18,10 +18,10 @@ pub struct RingBufferedUartRx<'d, T: BasicInstance, RxDma: super::RxDma<T>> {
impl<'d, T: BasicInstance, RxDma: super::RxDma<T>> SetConfig for RingBufferedUartRx<'d, T, RxDma> { impl<'d, T: BasicInstance, RxDma: super::RxDma<T>> SetConfig for RingBufferedUartRx<'d, T, RxDma> {
type Config = Config; type Config = Config;
type ConfigError = (); type ConfigError = ConfigError;
fn set_config(&mut self, config: &Self::Config) -> Result<(), ()> { fn set_config(&mut self, config: &Self::Config) -> Result<(), Self::ConfigError> {
self.set_config(config).map_err(|_| ()) self.set_config(config)
} }
} }

View File

@@ -5,6 +5,10 @@ All notable changes to this project will be documented in this file.
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/), The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html). and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
## 0.1.6 - ???
- Added tick rates in multiples of 10 kHz
## 0.1.5 - 2023-10-16 ## 0.1.5 - 2023-10-16
- Added `links` key to Cargo.toml, to prevent multiple copies of this crate in the same binary. - Added `links` key to Cargo.toml, to prevent multiple copies of this crate in the same binary.

View File

@@ -126,6 +126,25 @@ tick-hz-65_536_000 = []
tick-hz-131_072_000 = [] tick-hz-131_072_000 = []
tick-hz-262_144_000 = [] tick-hz-262_144_000 = []
tick-hz-524_288_000 = [] tick-hz-524_288_000 = []
tick-hz-20_000 = []
tick-hz-40_000 = []
tick-hz-80_000 = []
tick-hz-160_000 = []
tick-hz-320_000 = []
tick-hz-640_000 = []
tick-hz-1_280_000 = []
tick-hz-2_560_000 = []
tick-hz-5_120_000 = []
tick-hz-10_240_000 = []
tick-hz-20_480_000 = []
tick-hz-40_960_000 = []
tick-hz-81_920_000 = []
tick-hz-163_840_000 = []
tick-hz-327_680_000 = []
tick-hz-655_360_000 = []
tick-hz-1_310_720_000 = []
tick-hz-2_621_440_000 = []
tick-hz-5_242_880_000 = []
tick-hz-2_000_000 = [] tick-hz-2_000_000 = []
tick-hz-3_000_000 = [] tick-hz-3_000_000 = []
tick-hz-4_000_000 = [] tick-hz-4_000_000 = []

View File

@@ -13,6 +13,8 @@ for i in range(1, 25):
ticks.append(2**i) ticks.append(2**i)
for i in range(1, 20): for i in range(1, 20):
ticks.append(2**i * 1000) ticks.append(2**i * 1000)
for i in range(1, 20):
ticks.append(2**i * 10000)
for i in range(1, 10): for i in range(1, 10):
ticks.append(2**i * 1000000) ticks.append(2**i * 1000000)
ticks.append(2**i * 9 // 8 * 1000000) ticks.append(2**i * 9 // 8 * 1000000)

View File

@@ -106,6 +106,44 @@ pub const TICK_HZ: u64 = 131_072_000;
pub const TICK_HZ: u64 = 262_144_000; pub const TICK_HZ: u64 = 262_144_000;
#[cfg(feature = "tick-hz-524_288_000")] #[cfg(feature = "tick-hz-524_288_000")]
pub const TICK_HZ: u64 = 524_288_000; pub const TICK_HZ: u64 = 524_288_000;
#[cfg(feature = "tick-hz-20_000")]
pub const TICK_HZ: u64 = 20_000;
#[cfg(feature = "tick-hz-40_000")]
pub const TICK_HZ: u64 = 40_000;
#[cfg(feature = "tick-hz-80_000")]
pub const TICK_HZ: u64 = 80_000;
#[cfg(feature = "tick-hz-160_000")]
pub const TICK_HZ: u64 = 160_000;
#[cfg(feature = "tick-hz-320_000")]
pub const TICK_HZ: u64 = 320_000;
#[cfg(feature = "tick-hz-640_000")]
pub const TICK_HZ: u64 = 640_000;
#[cfg(feature = "tick-hz-1_280_000")]
pub const TICK_HZ: u64 = 1_280_000;
#[cfg(feature = "tick-hz-2_560_000")]
pub const TICK_HZ: u64 = 2_560_000;
#[cfg(feature = "tick-hz-5_120_000")]
pub const TICK_HZ: u64 = 5_120_000;
#[cfg(feature = "tick-hz-10_240_000")]
pub const TICK_HZ: u64 = 10_240_000;
#[cfg(feature = "tick-hz-20_480_000")]
pub const TICK_HZ: u64 = 20_480_000;
#[cfg(feature = "tick-hz-40_960_000")]
pub const TICK_HZ: u64 = 40_960_000;
#[cfg(feature = "tick-hz-81_920_000")]
pub const TICK_HZ: u64 = 81_920_000;
#[cfg(feature = "tick-hz-163_840_000")]
pub const TICK_HZ: u64 = 163_840_000;
#[cfg(feature = "tick-hz-327_680_000")]
pub const TICK_HZ: u64 = 327_680_000;
#[cfg(feature = "tick-hz-655_360_000")]
pub const TICK_HZ: u64 = 655_360_000;
#[cfg(feature = "tick-hz-1_310_720_000")]
pub const TICK_HZ: u64 = 1_310_720_000;
#[cfg(feature = "tick-hz-2_621_440_000")]
pub const TICK_HZ: u64 = 2_621_440_000;
#[cfg(feature = "tick-hz-5_242_880_000")]
pub const TICK_HZ: u64 = 5_242_880_000;
#[cfg(feature = "tick-hz-2_000_000")] #[cfg(feature = "tick-hz-2_000_000")]
pub const TICK_HZ: u64 = 2_000_000; pub const TICK_HZ: u64 = 2_000_000;
#[cfg(feature = "tick-hz-3_000_000")] #[cfg(feature = "tick-hz-3_000_000")]
@@ -334,6 +372,25 @@ pub const TICK_HZ: u64 = 980_000_000;
feature = "tick-hz-131_072_000", feature = "tick-hz-131_072_000",
feature = "tick-hz-262_144_000", feature = "tick-hz-262_144_000",
feature = "tick-hz-524_288_000", feature = "tick-hz-524_288_000",
feature = "tick-hz-20_000",
feature = "tick-hz-40_000",
feature = "tick-hz-80_000",
feature = "tick-hz-160_000",
feature = "tick-hz-320_000",
feature = "tick-hz-640_000",
feature = "tick-hz-1_280_000",
feature = "tick-hz-2_560_000",
feature = "tick-hz-5_120_000",
feature = "tick-hz-10_240_000",
feature = "tick-hz-20_480_000",
feature = "tick-hz-40_960_000",
feature = "tick-hz-81_920_000",
feature = "tick-hz-163_840_000",
feature = "tick-hz-327_680_000",
feature = "tick-hz-655_360_000",
feature = "tick-hz-1_310_720_000",
feature = "tick-hz-2_621_440_000",
feature = "tick-hz-5_242_880_000",
feature = "tick-hz-2_000_000", feature = "tick-hz-2_000_000",
feature = "tick-hz-3_000_000", feature = "tick-hz-3_000_000",
feature = "tick-hz-4_000_000", feature = "tick-hz-4_000_000",

View File

@@ -42,7 +42,7 @@ max-handler-count-8 = []
embassy-futures = { version = "0.1.0", path = "../embassy-futures" } embassy-futures = { version = "0.1.0", path = "../embassy-futures" }
embassy-usb-driver = { version = "0.1.0", path = "../embassy-usb-driver" } embassy-usb-driver = { version = "0.1.0", path = "../embassy-usb-driver" }
embassy-sync = { version = "0.3.0", path = "../embassy-sync" } embassy-sync = { version = "0.3.0", path = "../embassy-sync" }
embassy-net-driver-channel = { version = "0.1.0", path = "../embassy-net-driver-channel" } embassy-net-driver-channel = { version = "0.2.0", path = "../embassy-net-driver-channel" }
defmt = { version = "0.3", optional = true } defmt = { version = "0.3", optional = true }
log = { version = "0.4.14", optional = true } log = { version = "0.4.14", optional = true }

View File

@@ -70,9 +70,11 @@ fn main() {
// envvars take priority. // envvars take priority.
if !cfg.seen_env { if !cfg.seen_env {
if cfg.seen_feature { assert!(
panic!("multiple values set for feature {}: {} and {}", name, cfg.value, value); !cfg.seen_feature,
} "multiple values set for feature {}: {} and {}",
name, cfg.value, value
);
cfg.value = value; cfg.value = value;
cfg.seen_feature = true; cfg.seen_feature = true;

View File

@@ -1,17 +1,17 @@
use heapless::Vec; use heapless::Vec;
use crate::config::*; use crate::config::MAX_HANDLER_COUNT;
use crate::descriptor::{BosWriter, DescriptorWriter}; use crate::descriptor::{BosWriter, DescriptorWriter};
use crate::driver::{Driver, Endpoint, EndpointType}; use crate::driver::{Driver, Endpoint, EndpointType};
#[cfg(feature = "msos-descriptor")] #[cfg(feature = "msos-descriptor")]
use crate::msos::{DeviceLevelDescriptor, FunctionLevelDescriptor, MsOsDescriptorWriter}; use crate::msos::{DeviceLevelDescriptor, FunctionLevelDescriptor, MsOsDescriptorWriter};
use crate::types::*; use crate::types::{InterfaceNumber, StringIndex};
use crate::{Handler, Interface, UsbDevice, MAX_INTERFACE_COUNT, STRING_INDEX_CUSTOM_START}; use crate::{Handler, Interface, UsbDevice, MAX_INTERFACE_COUNT, STRING_INDEX_CUSTOM_START};
#[derive(Debug, Copy, Clone)] #[derive(Debug, Copy, Clone)]
#[cfg_attr(feature = "defmt", derive(defmt::Format))] #[cfg_attr(feature = "defmt", derive(defmt::Format))]
#[non_exhaustive] #[non_exhaustive]
/// Configuration used when creating [UsbDevice]. /// Configuration used when creating [`UsbDevice`].
pub struct Config<'a> { pub struct Config<'a> {
pub(crate) vendor_id: u16, pub(crate) vendor_id: u16,
pub(crate) product_id: u16, pub(crate) product_id: u16,
@@ -99,7 +99,7 @@ pub struct Config<'a> {
impl<'a> Config<'a> { impl<'a> Config<'a> {
/// Create default configuration with the provided vid and pid values. /// Create default configuration with the provided vid and pid values.
pub fn new(vid: u16, pid: u16) -> Self { pub const fn new(vid: u16, pid: u16) -> Self {
Self { Self {
device_class: 0x00, device_class: 0x00,
device_sub_class: 0x00, device_sub_class: 0x00,
@@ -159,9 +159,10 @@ impl<'d, D: Driver<'d>> Builder<'d, D> {
panic!("if composite_with_iads is set, you must set device_class = 0xEF, device_sub_class = 0x02, device_protocol = 0x01"); panic!("if composite_with_iads is set, you must set device_class = 0xEF, device_sub_class = 0x02, device_protocol = 0x01");
} }
if config.max_power > 500 { assert!(
panic!("The maximum allowed value for `max_power` is 500mA"); config.max_power <= 500,
} "The maximum allowed value for `max_power` is 500mA"
);
match config.max_packet_size_0 { match config.max_packet_size_0 {
8 | 16 | 32 | 64 => {} 8 | 16 | 32 | 64 => {}
@@ -260,12 +261,11 @@ impl<'d, D: Driver<'d>> Builder<'d, D> {
/// The Handler is called on some USB bus events, and to handle all control requests not already /// The Handler is called on some USB bus events, and to handle all control requests not already
/// handled by the USB stack. /// handled by the USB stack.
pub fn handler(&mut self, handler: &'d mut dyn Handler) { pub fn handler(&mut self, handler: &'d mut dyn Handler) {
if self.handlers.push(handler).is_err() { assert!(
panic!( self.handlers.push(handler).is_ok(),
"embassy-usb: handler list full. Increase the `max_handler_count` compile-time setting. Current value: {}", "embassy-usb: handler list full. Increase the `max_handler_count` compile-time setting. Current value: {}",
MAX_HANDLER_COUNT MAX_HANDLER_COUNT
) );
}
} }
/// Allocates a new string index. /// Allocates a new string index.
@@ -332,12 +332,10 @@ impl<'a, 'd, D: Driver<'d>> FunctionBuilder<'a, 'd, D> {
num_alt_settings: 0, num_alt_settings: 0,
}; };
if self.builder.interfaces.push(iface).is_err() { assert!(self.builder.interfaces.push(iface).is_ok(),
panic!( "embassy-usb: interface list full. Increase the `max_interface_count` compile-time setting. Current value: {}",
"embassy-usb: interface list full. Increase the `max_interface_count` compile-time setting. Current value: {}", MAX_INTERFACE_COUNT
MAX_INTERFACE_COUNT );
)
}
InterfaceBuilder { InterfaceBuilder {
builder: self.builder, builder: self.builder,
@@ -371,7 +369,7 @@ pub struct InterfaceBuilder<'a, 'd, D: Driver<'d>> {
impl<'a, 'd, D: Driver<'d>> InterfaceBuilder<'a, 'd, D> { impl<'a, 'd, D: Driver<'d>> InterfaceBuilder<'a, 'd, D> {
/// Get the interface number. /// Get the interface number.
pub fn interface_number(&self) -> InterfaceNumber { pub const fn interface_number(&self) -> InterfaceNumber {
self.interface_number self.interface_number
} }
@@ -422,12 +420,12 @@ pub struct InterfaceAltBuilder<'a, 'd, D: Driver<'d>> {
impl<'a, 'd, D: Driver<'d>> InterfaceAltBuilder<'a, 'd, D> { impl<'a, 'd, D: Driver<'d>> InterfaceAltBuilder<'a, 'd, D> {
/// Get the interface number. /// Get the interface number.
pub fn interface_number(&self) -> InterfaceNumber { pub const fn interface_number(&self) -> InterfaceNumber {
self.interface_number self.interface_number
} }
/// Get the alternate setting number. /// Get the alternate setting number.
pub fn alt_setting_number(&self) -> u8 { pub const fn alt_setting_number(&self) -> u8 {
self.alt_setting_number self.alt_setting_number
} }
@@ -436,7 +434,7 @@ impl<'a, 'd, D: Driver<'d>> InterfaceAltBuilder<'a, 'd, D> {
/// Descriptors are written in the order builder functions are called. Note that some /// Descriptors are written in the order builder functions are called. Note that some
/// classes care about the order. /// classes care about the order.
pub fn descriptor(&mut self, descriptor_type: u8, descriptor: &[u8]) { pub fn descriptor(&mut self, descriptor_type: u8, descriptor: &[u8]) {
self.builder.config_descriptor.write(descriptor_type, descriptor) self.builder.config_descriptor.write(descriptor_type, descriptor);
} }
fn endpoint_in(&mut self, ep_type: EndpointType, max_packet_size: u16, interval_ms: u8) -> D::EndpointIn { fn endpoint_in(&mut self, ep_type: EndpointType, max_packet_size: u16, interval_ms: u8) -> D::EndpointIn {

View File

@@ -11,7 +11,7 @@ use embassy_sync::waitqueue::WakerRegistration;
use crate::control::{self, InResponse, OutResponse, Recipient, Request, RequestType}; use crate::control::{self, InResponse, OutResponse, Recipient, Request, RequestType};
use crate::driver::{Driver, Endpoint, EndpointError, EndpointIn, EndpointOut}; use crate::driver::{Driver, Endpoint, EndpointError, EndpointIn, EndpointOut};
use crate::types::*; use crate::types::InterfaceNumber;
use crate::{Builder, Handler}; use crate::{Builder, Handler};
/// This should be used as `device_class` when building the `UsbDevice`. /// This should be used as `device_class` when building the `UsbDevice`.
@@ -39,12 +39,18 @@ pub struct State<'a> {
shared: ControlShared, shared: ControlShared,
} }
impl<'a> Default for State<'a> {
fn default() -> Self {
Self::new()
}
}
impl<'a> State<'a> { impl<'a> State<'a> {
/// Create a new `State`. /// Create a new `State`.
pub fn new() -> Self { pub fn new() -> Self {
Self { Self {
control: MaybeUninit::uninit(), control: MaybeUninit::uninit(),
shared: Default::default(), shared: ControlShared::default(),
} }
} }
} }
@@ -55,9 +61,9 @@ impl<'a> State<'a> {
/// writing USB packets with no intermediate buffers, but it will not act like a stream-like serial /// writing USB packets with no intermediate buffers, but it will not act like a stream-like serial
/// port. The following constraints must be followed if you use this class directly: /// port. The following constraints must be followed if you use this class directly:
/// ///
/// - `read_packet` must be called with a buffer large enough to hold max_packet_size bytes. /// - `read_packet` must be called with a buffer large enough to hold `max_packet_size` bytes.
/// - `write_packet` must not be called with a buffer larger than max_packet_size bytes. /// - `write_packet` must not be called with a buffer larger than `max_packet_size` bytes.
/// - If you write a packet that is exactly max_packet_size bytes long, it won't be processed by the /// - If you write a packet that is exactly `max_packet_size` bytes long, it won't be processed by the
/// host operating system until a subsequent shorter packet is sent. A zero-length packet (ZLP) /// host operating system until a subsequent shorter packet is sent. A zero-length packet (ZLP)
/// can be sent if there is no other data to send. This is because USB bulk transactions must be /// can be sent if there is no other data to send. This is because USB bulk transactions must be
/// terminated with a short packet, even if the bulk endpoint is used for stream-like data. /// terminated with a short packet, even if the bulk endpoint is used for stream-like data.
@@ -103,17 +109,16 @@ impl Default for ControlShared {
impl ControlShared { impl ControlShared {
async fn changed(&self) { async fn changed(&self) {
poll_fn(|cx| match self.changed.load(Ordering::Relaxed) { poll_fn(|cx| {
true => { if self.changed.load(Ordering::Relaxed) {
self.changed.store(false, Ordering::Relaxed); self.changed.store(false, Ordering::Relaxed);
Poll::Ready(()) Poll::Ready(())
} } else {
false => {
self.waker.borrow_mut().register(cx.waker()); self.waker.borrow_mut().register(cx.waker());
Poll::Pending Poll::Pending
} }
}) })
.await .await;
} }
} }
@@ -192,7 +197,7 @@ impl<'d> Handler for Control<'d> {
// REQ_GET_ENCAPSULATED_COMMAND is not really supported - it will be rejected below. // REQ_GET_ENCAPSULATED_COMMAND is not really supported - it will be rejected below.
REQ_GET_LINE_CODING if req.length == 7 => { REQ_GET_LINE_CODING if req.length == 7 => {
debug!("Sending line coding"); debug!("Sending line coding");
let coding = self.shared().line_coding.lock(|x| x.get()); let coding = self.shared().line_coding.lock(Cell::get);
assert!(buf.len() >= 7); assert!(buf.len() >= 7);
buf[0..4].copy_from_slice(&coding.data_rate.to_le_bytes()); buf[0..4].copy_from_slice(&coding.data_rate.to_le_bytes());
buf[4] = coding.stop_bits as u8; buf[4] = coding.stop_bits as u8;
@@ -206,8 +211,8 @@ impl<'d> Handler for Control<'d> {
} }
impl<'d, D: Driver<'d>> CdcAcmClass<'d, D> { impl<'d, D: Driver<'d>> CdcAcmClass<'d, D> {
/// Creates a new CdcAcmClass with the provided UsbBus and max_packet_size in bytes. For /// Creates a new CdcAcmClass with the provided UsbBus and `max_packet_size` in bytes. For
/// full-speed devices, max_packet_size has to be one of 8, 16, 32 or 64. /// full-speed devices, `max_packet_size` has to be one of 8, 16, 32 or 64.
pub fn new(builder: &mut Builder<'d, D>, state: &'d mut State<'d>, max_packet_size: u16) -> Self { pub fn new(builder: &mut Builder<'d, D>, state: &'d mut State<'d>, max_packet_size: u16) -> Self {
assert!(builder.control_buf_len() >= 7); assert!(builder.control_buf_len() >= 7);
@@ -242,7 +247,7 @@ impl<'d, D: Driver<'d>> CdcAcmClass<'d, D> {
&[ &[
CDC_TYPE_UNION, // bDescriptorSubtype CDC_TYPE_UNION, // bDescriptorSubtype
comm_if.into(), // bControlInterface comm_if.into(), // bControlInterface
data_if.into(), // bSubordinateInterface data_if, // bSubordinateInterface
], ],
); );
@@ -283,7 +288,7 @@ impl<'d, D: Driver<'d>> CdcAcmClass<'d, D> {
/// Gets the current line coding. The line coding contains information that's mainly relevant /// Gets the current line coding. The line coding contains information that's mainly relevant
/// for USB to UART serial port emulators, and can be ignored if not relevant. /// for USB to UART serial port emulators, and can be ignored if not relevant.
pub fn line_coding(&self) -> LineCoding { pub fn line_coding(&self) -> LineCoding {
self.control.line_coding.lock(|x| x.get()) self.control.line_coding.lock(Cell::get)
} }
/// Gets the DTR (data terminal ready) state /// Gets the DTR (data terminal ready) state
@@ -308,7 +313,7 @@ impl<'d, D: Driver<'d>> CdcAcmClass<'d, D> {
/// Waits for the USB host to enable this interface /// Waits for the USB host to enable this interface
pub async fn wait_connection(&mut self) { pub async fn wait_connection(&mut self) {
self.read_ep.wait_enabled().await self.read_ep.wait_enabled().await;
} }
/// Split the class into a sender and receiver. /// Split the class into a sender and receiver.
@@ -356,7 +361,7 @@ pub struct ControlChanged<'d> {
impl<'d> ControlChanged<'d> { impl<'d> ControlChanged<'d> {
/// Return a future for when the control settings change /// Return a future for when the control settings change
pub async fn control_changed(&self) { pub async fn control_changed(&self) {
self.control.changed().await self.control.changed().await;
} }
} }
@@ -378,7 +383,7 @@ impl<'d, D: Driver<'d>> Sender<'d, D> {
/// Gets the current line coding. The line coding contains information that's mainly relevant /// Gets the current line coding. The line coding contains information that's mainly relevant
/// for USB to UART serial port emulators, and can be ignored if not relevant. /// for USB to UART serial port emulators, and can be ignored if not relevant.
pub fn line_coding(&self) -> LineCoding { pub fn line_coding(&self) -> LineCoding {
self.control.line_coding.lock(|x| x.get()) self.control.line_coding.lock(Cell::get)
} }
/// Gets the DTR (data terminal ready) state /// Gets the DTR (data terminal ready) state
@@ -398,7 +403,7 @@ impl<'d, D: Driver<'d>> Sender<'d, D> {
/// Waits for the USB host to enable this interface /// Waits for the USB host to enable this interface
pub async fn wait_connection(&mut self) { pub async fn wait_connection(&mut self) {
self.write_ep.wait_enabled().await self.write_ep.wait_enabled().await;
} }
} }
@@ -420,7 +425,7 @@ impl<'d, D: Driver<'d>> Receiver<'d, D> {
/// Gets the current line coding. The line coding contains information that's mainly relevant /// Gets the current line coding. The line coding contains information that's mainly relevant
/// for USB to UART serial port emulators, and can be ignored if not relevant. /// for USB to UART serial port emulators, and can be ignored if not relevant.
pub fn line_coding(&self) -> LineCoding { pub fn line_coding(&self) -> LineCoding {
self.control.line_coding.lock(|x| x.get()) self.control.line_coding.lock(Cell::get)
} }
/// Gets the DTR (data terminal ready) state /// Gets the DTR (data terminal ready) state
@@ -440,7 +445,7 @@ impl<'d, D: Driver<'d>> Receiver<'d, D> {
/// Waits for the USB host to enable this interface /// Waits for the USB host to enable this interface
pub async fn wait_connection(&mut self) { pub async fn wait_connection(&mut self) {
self.read_ep.wait_enabled().await self.read_ep.wait_enabled().await;
} }
} }
@@ -514,17 +519,17 @@ impl LineCoding {
} }
/// Gets the number of data bits for UART communication. /// Gets the number of data bits for UART communication.
pub fn data_bits(&self) -> u8 { pub const fn data_bits(&self) -> u8 {
self.data_bits self.data_bits
} }
/// Gets the parity type for UART communication. /// Gets the parity type for UART communication.
pub fn parity_type(&self) -> ParityType { pub const fn parity_type(&self) -> ParityType {
self.parity_type self.parity_type
} }
/// Gets the data rate in bits per second for UART communication. /// Gets the data rate in bits per second for UART communication.
pub fn data_rate(&self) -> u32 { pub const fn data_rate(&self) -> u32 {
self.data_rate self.data_rate
} }
} }

View File

@@ -16,10 +16,11 @@
use core::intrinsics::copy_nonoverlapping; use core::intrinsics::copy_nonoverlapping;
use core::mem::{size_of, MaybeUninit}; use core::mem::{size_of, MaybeUninit};
use core::ptr::addr_of;
use crate::control::{self, InResponse, OutResponse, Recipient, Request, RequestType}; use crate::control::{self, InResponse, OutResponse, Recipient, Request, RequestType};
use crate::driver::{Driver, Endpoint, EndpointError, EndpointIn, EndpointOut}; use crate::driver::{Driver, Endpoint, EndpointError, EndpointIn, EndpointOut};
use crate::types::*; use crate::types::{InterfaceNumber, StringIndex};
use crate::{Builder, Handler}; use crate::{Builder, Handler};
pub mod embassy_net; pub mod embassy_net;
@@ -62,9 +63,9 @@ const REQ_SET_NTB_INPUT_SIZE: u8 = 0x86;
//const NOTIF_POLL_INTERVAL: u8 = 20; //const NOTIF_POLL_INTERVAL: u8 = 20;
const NTB_MAX_SIZE: usize = 2048; const NTB_MAX_SIZE: usize = 2048;
const SIG_NTH: u32 = 0x484d434e; const SIG_NTH: u32 = 0x484d_434e;
const SIG_NDP_NO_FCS: u32 = 0x304d434e; const SIG_NDP_NO_FCS: u32 = 0x304d_434e;
const SIG_NDP_WITH_FCS: u32 = 0x314d434e; const SIG_NDP_WITH_FCS: u32 = 0x314d_434e;
const ALTERNATE_SETTING_DISABLED: u8 = 0x00; const ALTERNATE_SETTING_DISABLED: u8 = 0x00;
const ALTERNATE_SETTING_ENABLED: u8 = 0x01; const ALTERNATE_SETTING_ENABLED: u8 = 0x01;
@@ -111,7 +112,7 @@ struct NtbParametersDir {
fn byteify<T>(buf: &mut [u8], data: T) -> &[u8] { fn byteify<T>(buf: &mut [u8], data: T) -> &[u8] {
let len = size_of::<T>(); let len = size_of::<T>();
unsafe { copy_nonoverlapping(&data as *const _ as *const u8, buf.as_mut_ptr(), len) } unsafe { copy_nonoverlapping(addr_of!(data).cast(), buf.as_mut_ptr(), len) }
&buf[..len] &buf[..len]
} }
@@ -121,27 +122,28 @@ pub struct State<'a> {
shared: ControlShared, shared: ControlShared,
} }
impl<'a> Default for State<'a> {
fn default() -> Self {
Self::new()
}
}
impl<'a> State<'a> { impl<'a> State<'a> {
/// Create a new `State`. /// Create a new `State`.
pub fn new() -> Self { pub fn new() -> Self {
Self { Self {
control: MaybeUninit::uninit(), control: MaybeUninit::uninit(),
shared: Default::default(), shared: ControlShared::default(),
} }
} }
} }
/// Shared data between Control and CdcAcmClass /// Shared data between Control and `CdcAcmClass`
#[derive(Default)]
struct ControlShared { struct ControlShared {
mac_addr: [u8; 6], mac_addr: [u8; 6],
} }
impl Default for ControlShared {
fn default() -> Self {
ControlShared { mac_addr: [0; 6] }
}
}
struct Control<'a> { struct Control<'a> {
mac_addr_string: StringIndex, mac_addr_string: StringIndex,
shared: &'a ControlShared, shared: &'a ControlShared,
@@ -377,12 +379,12 @@ impl<'d, D: Driver<'d>> Sender<'d, D> {
/// ///
/// This waits until the packet is successfully stored in the CDC-NCM endpoint buffers. /// This waits until the packet is successfully stored in the CDC-NCM endpoint buffers.
pub async fn write_packet(&mut self, data: &[u8]) -> Result<(), EndpointError> { pub async fn write_packet(&mut self, data: &[u8]) -> Result<(), EndpointError> {
let seq = self.seq;
self.seq = self.seq.wrapping_add(1);
const OUT_HEADER_LEN: usize = 28; const OUT_HEADER_LEN: usize = 28;
const ABS_MAX_PACKET_SIZE: usize = 512; const ABS_MAX_PACKET_SIZE: usize = 512;
let seq = self.seq;
self.seq = self.seq.wrapping_add(1);
let header = NtbOutHeader { let header = NtbOutHeader {
nth_sig: SIG_NTH, nth_sig: SIG_NTH,
nth_len: 0x0c, nth_len: 0x0c,
@@ -416,7 +418,7 @@ impl<'d, D: Driver<'d>> Sender<'d, D> {
self.write_ep.write(&buf[..self.max_packet_size]).await?; self.write_ep.write(&buf[..self.max_packet_size]).await?;
for chunk in d2.chunks(self.max_packet_size) { for chunk in d2.chunks(self.max_packet_size) {
self.write_ep.write(&chunk).await?; self.write_ep.write(chunk).await?;
} }
// Send ZLP if needed. // Send ZLP if needed.
@@ -459,12 +461,9 @@ impl<'d, D: Driver<'d>> Receiver<'d, D> {
let ntb = &ntb[..pos]; let ntb = &ntb[..pos];
// Process NTB header (NTH) // Process NTB header (NTH)
let nth = match ntb.get(..12) { let Some(nth) = ntb.get(..12) else {
Some(x) => x, warn!("Received too short NTB");
None => { continue;
warn!("Received too short NTB");
continue;
}
}; };
let sig = u32::from_le_bytes(nth[0..4].try_into().unwrap()); let sig = u32::from_le_bytes(nth[0..4].try_into().unwrap());
if sig != SIG_NTH { if sig != SIG_NTH {
@@ -474,12 +473,9 @@ impl<'d, D: Driver<'d>> Receiver<'d, D> {
let ndp_idx = u16::from_le_bytes(nth[10..12].try_into().unwrap()) as usize; let ndp_idx = u16::from_le_bytes(nth[10..12].try_into().unwrap()) as usize;
// Process NTB Datagram Pointer (NDP) // Process NTB Datagram Pointer (NDP)
let ndp = match ntb.get(ndp_idx..ndp_idx + 12) { let Some(ndp) = ntb.get(ndp_idx..ndp_idx + 12) else {
Some(x) => x, warn!("NTH has an NDP pointer out of range.");
None => { continue;
warn!("NTH has an NDP pointer out of range.");
continue;
}
}; };
let sig = u32::from_le_bytes(ndp[0..4].try_into().unwrap()); let sig = u32::from_le_bytes(ndp[0..4].try_into().unwrap());
if sig != SIG_NDP_NO_FCS && sig != SIG_NDP_WITH_FCS { if sig != SIG_NDP_NO_FCS && sig != SIG_NDP_WITH_FCS {
@@ -495,12 +491,9 @@ impl<'d, D: Driver<'d>> Receiver<'d, D> {
} }
// Process actual datagram, finally. // Process actual datagram, finally.
let datagram = match ntb.get(datagram_index..datagram_index + datagram_len) { let Some(datagram) = ntb.get(datagram_index..datagram_index + datagram_len) else {
Some(x) => x, warn!("NDP has a datagram pointer out of range.");
None => { continue;
warn!("NDP has a datagram pointer out of range.");
continue;
}
}; };
buf[..datagram_len].copy_from_slice(datagram); buf[..datagram_len].copy_from_slice(datagram);

View File

@@ -63,7 +63,7 @@ pub enum ReportId {
} }
impl ReportId { impl ReportId {
fn try_from(value: u16) -> Result<Self, ()> { const fn try_from(value: u16) -> Result<Self, ()> {
match value >> 8 { match value >> 8 {
1 => Ok(ReportId::In(value as u8)), 1 => Ok(ReportId::In(value as u8)),
2 => Ok(ReportId::Out(value as u8)), 2 => Ok(ReportId::Out(value as u8)),
@@ -79,9 +79,15 @@ pub struct State<'d> {
out_report_offset: AtomicUsize, out_report_offset: AtomicUsize,
} }
impl<'d> Default for State<'d> {
fn default() -> Self {
Self::new()
}
}
impl<'d> State<'d> { impl<'d> State<'d> {
/// Create a new `State`. /// Create a new `State`.
pub fn new() -> Self { pub const fn new() -> Self {
State { State {
control: MaybeUninit::uninit(), control: MaybeUninit::uninit(),
out_report_offset: AtomicUsize::new(0), out_report_offset: AtomicUsize::new(0),
@@ -148,7 +154,7 @@ fn build<'d, D: Driver<'d>>(
} }
impl<'d, D: Driver<'d>, const READ_N: usize, const WRITE_N: usize> HidReaderWriter<'d, D, READ_N, WRITE_N> { impl<'d, D: Driver<'d>, const READ_N: usize, const WRITE_N: usize> HidReaderWriter<'d, D, READ_N, WRITE_N> {
/// Creates a new HidReaderWriter. /// Creates a new `HidReaderWriter`.
/// ///
/// This will allocate one IN and one OUT endpoints. If you only need writing (sending) /// This will allocate one IN and one OUT endpoints. If you only need writing (sending)
/// HID reports, consider using [`HidWriter::new`] instead, which allocates an IN endpoint only. /// HID reports, consider using [`HidWriter::new`] instead, which allocates an IN endpoint only.
@@ -171,7 +177,7 @@ impl<'d, D: Driver<'d>, const READ_N: usize, const WRITE_N: usize> HidReaderWrit
} }
/// Waits for both IN and OUT endpoints to be enabled. /// Waits for both IN and OUT endpoints to be enabled.
pub async fn ready(&mut self) -> () { pub async fn ready(&mut self) {
self.reader.ready().await; self.reader.ready().await;
self.writer.ready().await; self.writer.ready().await;
} }
@@ -224,7 +230,7 @@ pub enum ReadError {
impl From<EndpointError> for ReadError { impl From<EndpointError> for ReadError {
fn from(val: EndpointError) -> Self { fn from(val: EndpointError) -> Self {
use EndpointError::*; use EndpointError::{BufferOverflow, Disabled};
match val { match val {
BufferOverflow => ReadError::BufferOverflow, BufferOverflow => ReadError::BufferOverflow,
Disabled => ReadError::Disabled, Disabled => ReadError::Disabled,
@@ -251,17 +257,16 @@ impl<'d, D: Driver<'d>, const N: usize> HidWriter<'d, D, N> {
} }
/// Waits for the interrupt in endpoint to be enabled. /// Waits for the interrupt in endpoint to be enabled.
pub async fn ready(&mut self) -> () { pub async fn ready(&mut self) {
self.ep_in.wait_enabled().await self.ep_in.wait_enabled().await;
} }
/// Writes an input report by serializing the given report structure. /// Writes an input report by serializing the given report structure.
#[cfg(feature = "usbd-hid")] #[cfg(feature = "usbd-hid")]
pub async fn write_serialize<IR: AsInputReport>(&mut self, r: &IR) -> Result<(), EndpointError> { pub async fn write_serialize<IR: AsInputReport>(&mut self, r: &IR) -> Result<(), EndpointError> {
let mut buf: [u8; N] = [0; N]; let mut buf: [u8; N] = [0; N];
let size = match serialize(&mut buf, r) { let Ok(size) = serialize(&mut buf, r) else {
Ok(size) => size, return Err(EndpointError::BufferOverflow);
Err(_) => return Err(EndpointError::BufferOverflow),
}; };
self.write(&buf[0..size]).await self.write(&buf[0..size]).await
} }
@@ -286,8 +291,8 @@ impl<'d, D: Driver<'d>, const N: usize> HidWriter<'d, D, N> {
impl<'d, D: Driver<'d>, const N: usize> HidReader<'d, D, N> { impl<'d, D: Driver<'d>, const N: usize> HidReader<'d, D, N> {
/// Waits for the interrupt out endpoint to be enabled. /// Waits for the interrupt out endpoint to be enabled.
pub async fn ready(&mut self) -> () { pub async fn ready(&mut self) {
self.ep_out.wait_enabled().await self.ep_out.wait_enabled().await;
} }
/// Delivers output reports from the Interrupt Out pipe to `handler`. /// Delivers output reports from the Interrupt Out pipe to `handler`.
@@ -344,9 +349,8 @@ impl<'d, D: Driver<'d>, const N: usize> HidReader<'d, D, N> {
if size < max_packet_size || total == N { if size < max_packet_size || total == N {
self.offset.store(0, Ordering::Release); self.offset.store(0, Ordering::Release);
break; break;
} else {
self.offset.store(total, Ordering::Release);
} }
self.offset.store(total, Ordering::Release);
} }
Err(err) => { Err(err) => {
self.offset.store(0, Ordering::Release); self.offset.store(0, Ordering::Release);
@@ -466,7 +470,7 @@ impl<'d> Handler for Control<'d> {
HID_REQ_SET_IDLE => { HID_REQ_SET_IDLE => {
if let Some(handler) = self.request_handler { if let Some(handler) = self.request_handler {
let id = req.value as u8; let id = req.value as u8;
let id = (id != 0).then(|| ReportId::In(id)); let id = (id != 0).then_some(ReportId::In(id));
let dur = u32::from(req.value >> 8); let dur = u32::from(req.value >> 8);
let dur = if dur == 0 { u32::MAX } else { 4 * dur }; let dur = if dur == 0 { u32::MAX } else { 4 * dur };
handler.set_idle_ms(id, dur); handler.set_idle_ms(id, dur);
@@ -522,7 +526,7 @@ impl<'d> Handler for Control<'d> {
HID_REQ_GET_IDLE => { HID_REQ_GET_IDLE => {
if let Some(handler) = self.request_handler { if let Some(handler) = self.request_handler {
let id = req.value as u8; let id = req.value as u8;
let id = (id != 0).then(|| ReportId::In(id)); let id = (id != 0).then_some(ReportId::In(id));
if let Some(dur) = handler.get_idle_ms(id) { if let Some(dur) = handler.get_idle_ms(id) {
let dur = u8::try_from(dur / 4).unwrap_or(0); let dur = u8::try_from(dur / 4).unwrap_or(0);
buf[0] = dur; buf[0] = dur;

View File

@@ -27,9 +27,9 @@ const MIDI_OUT_SIZE: u8 = 0x09;
/// writing USB packets with no intermediate buffers, but it will not act like a stream-like port. /// writing USB packets with no intermediate buffers, but it will not act like a stream-like port.
/// The following constraints must be followed if you use this class directly: /// The following constraints must be followed if you use this class directly:
/// ///
/// - `read_packet` must be called with a buffer large enough to hold max_packet_size bytes. /// - `read_packet` must be called with a buffer large enough to hold `max_packet_size` bytes.
/// - `write_packet` must not be called with a buffer larger than max_packet_size bytes. /// - `write_packet` must not be called with a buffer larger than `max_packet_size` bytes.
/// - If you write a packet that is exactly max_packet_size bytes long, it won't be processed by the /// - If you write a packet that is exactly `max_packet_size` bytes long, it won't be processed by the
/// host operating system until a subsequent shorter packet is sent. A zero-length packet (ZLP) /// host operating system until a subsequent shorter packet is sent. A zero-length packet (ZLP)
/// can be sent if there is no other data to send. This is because USB bulk transactions must be /// can be sent if there is no other data to send. This is because USB bulk transactions must be
/// terminated with a short packet, even if the bulk endpoint is used for stream-like data. /// terminated with a short packet, even if the bulk endpoint is used for stream-like data.
@@ -39,8 +39,8 @@ pub struct MidiClass<'d, D: Driver<'d>> {
} }
impl<'d, D: Driver<'d>> MidiClass<'d, D> { impl<'d, D: Driver<'d>> MidiClass<'d, D> {
/// Creates a new MidiClass with the provided UsbBus, number of input and output jacks and max_packet_size in bytes. /// Creates a new `MidiClass` with the provided UsbBus, number of input and output jacks and `max_packet_size` in bytes.
/// For full-speed devices, max_packet_size has to be one of 8, 16, 32 or 64. /// For full-speed devices, `max_packet_size` has to be one of 8, 16, 32 or 64.
pub fn new(builder: &mut Builder<'d, D>, n_in_jacks: u8, n_out_jacks: u8, max_packet_size: u16) -> Self { pub fn new(builder: &mut Builder<'d, D>, n_in_jacks: u8, n_out_jacks: u8, max_packet_size: u16) -> Self {
let mut func = builder.function(USB_AUDIO_CLASS, USB_AUDIOCONTROL_SUBCLASS, PROTOCOL_NONE); let mut func = builder.function(USB_AUDIO_CLASS, USB_AUDIOCONTROL_SUBCLASS, PROTOCOL_NONE);
@@ -160,7 +160,7 @@ impl<'d, D: Driver<'d>> MidiClass<'d, D> {
/// Waits for the USB host to enable this interface /// Waits for the USB host to enable this interface
pub async fn wait_connection(&mut self) { pub async fn wait_connection(&mut self) {
self.read_ep.wait_enabled().await self.read_ep.wait_enabled().await;
} }
/// Split the class into a sender and receiver. /// Split the class into a sender and receiver.
@@ -197,7 +197,7 @@ impl<'d, D: Driver<'d>> Sender<'d, D> {
/// Waits for the USB host to enable this interface /// Waits for the USB host to enable this interface
pub async fn wait_connection(&mut self) { pub async fn wait_connection(&mut self) {
self.write_ep.wait_enabled().await self.write_ep.wait_enabled().await;
} }
} }
@@ -222,6 +222,6 @@ impl<'d, D: Driver<'d>> Receiver<'d, D> {
/// Waits for the USB host to enable this interface /// Waits for the USB host to enable this interface
pub async fn wait_connection(&mut self) { pub async fn wait_connection(&mut self) {
self.read_ep.wait_enabled().await self.read_ep.wait_enabled().await;
} }
} }

View File

@@ -120,7 +120,7 @@ impl Request {
} }
/// Gets the descriptor type and index from the value field of a GET_DESCRIPTOR request. /// Gets the descriptor type and index from the value field of a GET_DESCRIPTOR request.
pub fn descriptor_type_index(&self) -> (u8, u8) { pub const fn descriptor_type_index(&self) -> (u8, u8) {
((self.value >> 8) as u8, self.value as u8) ((self.value >> 8) as u8, self.value as u8)
} }
} }

View File

@@ -2,7 +2,7 @@
use crate::builder::Config; use crate::builder::Config;
use crate::driver::EndpointInfo; use crate::driver::EndpointInfo;
use crate::types::*; use crate::types::{InterfaceNumber, StringIndex};
use crate::CONFIGURATION_VALUE; use crate::CONFIGURATION_VALUE;
/// Standard descriptor types /// Standard descriptor types
@@ -59,7 +59,7 @@ impl<'a> DescriptorWriter<'a> {
} }
/// Gets the current position in the buffer, i.e. the number of bytes written so far. /// Gets the current position in the buffer, i.e. the number of bytes written so far.
pub fn position(&self) -> usize { pub const fn position(&self) -> usize {
self.position self.position
} }
@@ -67,9 +67,10 @@ impl<'a> DescriptorWriter<'a> {
pub fn write(&mut self, descriptor_type: u8, descriptor: &[u8]) { pub fn write(&mut self, descriptor_type: u8, descriptor: &[u8]) {
let length = descriptor.len(); let length = descriptor.len();
if (self.position + 2 + length) > self.buf.len() || (length + 2) > 255 { assert!(
panic!("Descriptor buffer full"); (self.position + 2 + length) <= self.buf.len() && (length + 2) <= 255,
} "Descriptor buffer full"
);
self.buf[self.position] = (length + 2) as u8; self.buf[self.position] = (length + 2) as u8;
self.buf[self.position + 1] = descriptor_type; self.buf[self.position + 1] = descriptor_type;
@@ -102,7 +103,7 @@ impl<'a> DescriptorWriter<'a> {
config.serial_number.map_or(0, |_| 3), // iSerialNumber config.serial_number.map_or(0, |_| 3), // iSerialNumber
1, // bNumConfigurations 1, // bNumConfigurations
], ],
) );
} }
pub(crate) fn configuration(&mut self, config: &Config) { pub(crate) fn configuration(&mut self, config: &Config) {
@@ -120,7 +121,7 @@ impl<'a> DescriptorWriter<'a> {
| if config.supports_remote_wakeup { 0x20 } else { 0x00 }, // bmAttributes | if config.supports_remote_wakeup { 0x20 } else { 0x00 }, // bmAttributes
(config.max_power / 2) as u8, // bMaxPower (config.max_power / 2) as u8, // bMaxPower
], ],
) );
} }
#[allow(unused)] #[allow(unused)]
@@ -248,9 +249,7 @@ impl<'a> DescriptorWriter<'a> {
pub(crate) fn string(&mut self, string: &str) { pub(crate) fn string(&mut self, string: &str) {
let mut pos = self.position; let mut pos = self.position;
if pos + 2 > self.buf.len() { assert!(pos + 2 <= self.buf.len(), "Descriptor buffer full");
panic!("Descriptor buffer full");
}
self.buf[pos] = 0; // length placeholder self.buf[pos] = 0; // length placeholder
self.buf[pos + 1] = descriptor_type::STRING; self.buf[pos + 1] = descriptor_type::STRING;
@@ -258,9 +257,7 @@ impl<'a> DescriptorWriter<'a> {
pos += 2; pos += 2;
for c in string.encode_utf16() { for c in string.encode_utf16() {
if pos >= self.buf.len() { assert!(pos < self.buf.len(), "Descriptor buffer full");
panic!("Descriptor buffer full");
}
self.buf[pos..pos + 2].copy_from_slice(&c.to_le_bytes()); self.buf[pos..pos + 2].copy_from_slice(&c.to_le_bytes());
pos += 2; pos += 2;
@@ -279,9 +276,9 @@ pub struct BosWriter<'a> {
} }
impl<'a> BosWriter<'a> { impl<'a> BosWriter<'a> {
pub(crate) fn new(writer: DescriptorWriter<'a>) -> Self { pub(crate) const fn new(writer: DescriptorWriter<'a>) -> Self {
Self { Self {
writer: writer, writer,
num_caps_mark: None, num_caps_mark: None,
} }
} }
@@ -314,9 +311,10 @@ impl<'a> BosWriter<'a> {
let mut start = self.writer.position; let mut start = self.writer.position;
let blen = data.len(); let blen = data.len();
if (start + blen + 3) > self.writer.buf.len() || (blen + 3) > 255 { assert!(
panic!("Descriptor buffer full"); (start + blen + 3) <= self.writer.buf.len() && (blen + 3) <= 255,
} "Descriptor buffer full"
);
self.writer.buf[start] = (blen + 3) as u8; self.writer.buf[start] = (blen + 3) as u8;
self.writer.buf[start + 1] = descriptor_type::CAPABILITY; self.writer.buf[start + 1] = descriptor_type::CAPABILITY;

View File

@@ -11,11 +11,11 @@ pub struct Reader<'a> {
} }
impl<'a> Reader<'a> { impl<'a> Reader<'a> {
pub fn new(data: &'a [u8]) -> Self { pub const fn new(data: &'a [u8]) -> Self {
Self { data } Self { data }
} }
pub fn eof(&self) -> bool { pub const fn eof(&self) -> bool {
self.data.is_empty() self.data.is_empty()
} }
@@ -102,7 +102,7 @@ pub fn foreach_endpoint(data: &[u8], mut f: impl FnMut(EndpointInfo)) -> Result<
} }
descriptor_type::ENDPOINT => { descriptor_type::ENDPOINT => {
ep.ep_address = EndpointAddress::from(r.read_u8()?); ep.ep_address = EndpointAddress::from(r.read_u8()?);
f(ep) f(ep);
} }
_ => {} _ => {}
} }

View File

@@ -24,12 +24,12 @@ use embassy_futures::select::{select, Either};
use heapless::Vec; use heapless::Vec;
pub use crate::builder::{Builder, Config, FunctionBuilder, InterfaceAltBuilder, InterfaceBuilder}; pub use crate::builder::{Builder, Config, FunctionBuilder, InterfaceAltBuilder, InterfaceBuilder};
use crate::config::*; use crate::config::{MAX_HANDLER_COUNT, MAX_INTERFACE_COUNT};
use crate::control::*; use crate::control::{InResponse, OutResponse, Recipient, Request, RequestType};
use crate::descriptor::*; use crate::descriptor::{descriptor_type, lang_id};
use crate::descriptor_reader::foreach_endpoint; use crate::descriptor_reader::foreach_endpoint;
use crate::driver::{Bus, ControlPipe, Direction, Driver, EndpointAddress, Event}; use crate::driver::{Bus, ControlPipe, Direction, Driver, EndpointAddress, Event};
use crate::types::*; use crate::types::{InterfaceNumber, StringIndex};
/// The global state of the USB device. /// The global state of the USB device.
/// ///
@@ -294,7 +294,7 @@ impl<'d, D: Driver<'d>> UsbDevice<'d, D> {
/// After dropping the future, [`UsbDevice::disable()`] should be called /// After dropping the future, [`UsbDevice::disable()`] should be called
/// before calling any other `UsbDevice` methods to fully reset the /// before calling any other `UsbDevice` methods to fully reset the
/// peripheral. /// peripheral.
pub async fn run_until_suspend(&mut self) -> () { pub async fn run_until_suspend(&mut self) {
while !self.inner.suspended { while !self.inner.suspended {
let control_fut = self.control.setup(); let control_fut = self.control.setup();
let bus_fut = self.inner.bus.poll(); let bus_fut = self.inner.bus.poll();
@@ -364,6 +364,8 @@ impl<'d, D: Driver<'d>> UsbDevice<'d, D> {
} }
async fn handle_control_in(&mut self, req: Request) { async fn handle_control_in(&mut self, req: Request) {
const DEVICE_DESCRIPTOR_LEN: usize = 18;
let mut resp_length = req.length as usize; let mut resp_length = req.length as usize;
let max_packet_size = self.control.max_packet_size(); let max_packet_size = self.control.max_packet_size();
@@ -371,19 +373,15 @@ impl<'d, D: Driver<'d>> UsbDevice<'d, D> {
// The host doesn't know our EP0 max packet size yet, and might assume // The host doesn't know our EP0 max packet size yet, and might assume
// a full-length packet is a short packet, thinking we're done sending data. // a full-length packet is a short packet, thinking we're done sending data.
// See https://github.com/hathach/tinyusb/issues/184 // See https://github.com/hathach/tinyusb/issues/184
const DEVICE_DESCRIPTOR_LEN: usize = 18; if self.inner.address == 0 && max_packet_size < DEVICE_DESCRIPTOR_LEN && max_packet_size < resp_length {
if self.inner.address == 0
&& max_packet_size < DEVICE_DESCRIPTOR_LEN
&& (max_packet_size as usize) < resp_length
{
trace!("received control req while not addressed: capping response to 1 packet."); trace!("received control req while not addressed: capping response to 1 packet.");
resp_length = max_packet_size; resp_length = max_packet_size;
} }
match self.inner.handle_control_in(req, &mut self.control_buf) { match self.inner.handle_control_in(req, self.control_buf) {
InResponse::Accepted(data) => { InResponse::Accepted(data) => {
let len = data.len().min(resp_length); let len = data.len().min(resp_length);
let need_zlp = len != resp_length && (len % usize::from(max_packet_size)) == 0; let need_zlp = len != resp_length && (len % max_packet_size) == 0;
let chunks = data[0..len] let chunks = data[0..len]
.chunks(max_packet_size) .chunks(max_packet_size)
@@ -435,7 +433,7 @@ impl<'d, D: Driver<'d>> UsbDevice<'d, D> {
self.control.accept_set_address(self.inner.address).await; self.control.accept_set_address(self.inner.address).await;
self.inner.set_address_pending = false; self.inner.set_address_pending = false;
} else { } else {
self.control.accept().await self.control.accept().await;
} }
} }
OutResponse::Rejected => self.control.reject().await, OutResponse::Rejected => self.control.reject().await,
@@ -548,9 +546,8 @@ impl<'d, D: Driver<'d>> Inner<'d, D> {
OutResponse::Accepted OutResponse::Accepted
} }
(Request::SET_CONFIGURATION, CONFIGURATION_NONE_U16) => match self.device_state { (Request::SET_CONFIGURATION, CONFIGURATION_NONE_U16) => {
UsbDeviceState::Default => OutResponse::Accepted, if self.device_state != UsbDeviceState::Default {
_ => {
debug!("SET_CONFIGURATION: unconfigured"); debug!("SET_CONFIGURATION: unconfigured");
self.device_state = UsbDeviceState::Addressed; self.device_state = UsbDeviceState::Addressed;
@@ -564,17 +561,15 @@ impl<'d, D: Driver<'d>> Inner<'d, D> {
for h in &mut self.handlers { for h in &mut self.handlers {
h.configured(false); h.configured(false);
} }
OutResponse::Accepted
} }
}, OutResponse::Accepted
}
_ => OutResponse::Rejected, _ => OutResponse::Rejected,
}, },
(RequestType::Standard, Recipient::Interface) => { (RequestType::Standard, Recipient::Interface) => {
let iface_num = InterfaceNumber::new(req.index as _); let iface_num = InterfaceNumber::new(req.index as _);
let iface = match self.interfaces.get_mut(iface_num.0 as usize) { let Some(iface) = self.interfaces.get_mut(iface_num.0 as usize) else {
Some(iface) => iface, return OutResponse::Rejected;
None => return OutResponse::Rejected,
}; };
match req.request { match req.request {
@@ -650,9 +645,8 @@ impl<'d, D: Driver<'d>> Inner<'d, D> {
_ => InResponse::Rejected, _ => InResponse::Rejected,
}, },
(RequestType::Standard, Recipient::Interface) => { (RequestType::Standard, Recipient::Interface) => {
let iface = match self.interfaces.get_mut(req.index as usize) { let Some(iface) = self.interfaces.get_mut(req.index as usize) else {
Some(iface) => iface, return InResponse::Rejected;
None => return InResponse::Rejected,
}; };
match req.request { match req.request {
@@ -706,7 +700,7 @@ impl<'d, D: Driver<'d>> Inner<'d, D> {
} }
fn handle_control_in_delegated<'a>(&'a mut self, req: Request, buf: &'a mut [u8]) -> InResponse<'a> { fn handle_control_in_delegated<'a>(&'a mut self, req: Request, buf: &'a mut [u8]) -> InResponse<'a> {
unsafe fn extend_lifetime<'x, 'y>(r: InResponse<'x>) -> InResponse<'y> { unsafe fn extend_lifetime<'y>(r: InResponse<'_>) -> InResponse<'y> {
core::mem::transmute(r) core::mem::transmute(r)
} }
@@ -756,16 +750,12 @@ impl<'d, D: Driver<'d>> Inner<'d, D> {
}; };
if let Some(s) = s { if let Some(s) = s {
if buf.len() < 2 { assert!(buf.len() >= 2, "control buffer too small");
panic!("control buffer too small");
}
buf[1] = descriptor_type::STRING; buf[1] = descriptor_type::STRING;
let mut pos = 2; let mut pos = 2;
for c in s.encode_utf16() { for c in s.encode_utf16() {
if pos + 2 >= buf.len() { assert!(pos + 2 < buf.len(), "control buffer too small");
panic!("control buffer too small");
}
buf[pos..pos + 2].copy_from_slice(&c.to_le_bytes()); buf[pos..pos + 2].copy_from_slice(&c.to_le_bytes());
pos += 2; pos += 2;

View File

@@ -6,7 +6,7 @@
use core::mem::size_of; use core::mem::size_of;
use super::{capability_type, BosWriter}; use crate::descriptor::{capability_type, BosWriter};
use crate::types::InterfaceNumber; use crate::types::InterfaceNumber;
/// A serialized Microsoft OS 2.0 Descriptor set. /// A serialized Microsoft OS 2.0 Descriptor set.

View File

@@ -7,7 +7,7 @@
pub struct InterfaceNumber(pub u8); pub struct InterfaceNumber(pub u8);
impl InterfaceNumber { impl InterfaceNumber {
pub(crate) fn new(index: u8) -> InterfaceNumber { pub(crate) const fn new(index: u8) -> InterfaceNumber {
InterfaceNumber(index) InterfaceNumber(index)
} }
} }
@@ -25,7 +25,7 @@ impl From<InterfaceNumber> for u8 {
pub struct StringIndex(pub u8); pub struct StringIndex(pub u8);
impl StringIndex { impl StringIndex {
pub(crate) fn new(index: u8) -> StringIndex { pub(crate) const fn new(index: u8) -> StringIndex {
StringIndex(index) StringIndex(index)
} }
} }

View File

@@ -1,7 +1,12 @@
MEMORY MEMORY
{ {
/* NOTE 1 K = 1 KiBi = 1024 bytes */ /* NOTE 1 K = 1 KiBi = 1024 bytes */
/* These values correspond to the NRF52840 with Softdevices S140 7.0.1 */
FLASH : ORIGIN = 0x00000000, LENGTH = 1024K FLASH : ORIGIN = 0x00000000, LENGTH = 1024K
RAM : ORIGIN = 0x20000000, LENGTH = 256K RAM : ORIGIN = 0x20000000, LENGTH = 256K
/* These values correspond to the NRF52840 with Softdevices S140 7.3.0 */
/*
FLASH : ORIGIN = 0x00027000, LENGTH = 868K
RAM : ORIGIN = 0x20020000, LENGTH = 128K
*/
} }

View File

@@ -33,7 +33,7 @@ embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["de
embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "executor-interrupt", "defmt", "integrated-timers"] } embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "executor-interrupt", "defmt", "integrated-timers"] }
embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime"] } embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime"] }
embassy-nrf = { version = "0.1.0", path = "../../embassy-nrf", features = ["defmt", "nrf52840", "time-driver-rtc1", "gpiote", "unstable-pac", "time"] } embassy-nrf = { version = "0.1.0", path = "../../embassy-nrf", features = ["defmt", "nrf52840", "time-driver-rtc1", "gpiote", "unstable-pac", "time"] }
embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "tcp", "dhcpv4", "medium-ethernet"], optional = true } embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "tcp", "dhcpv4", "medium-ethernet"], optional = true }
embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt", "msos-descriptor",], optional = true } embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt", "msos-descriptor",], optional = true }
embedded-io = { version = "0.6.0", features = ["defmt-03"] } embedded-io = { version = "0.6.0", features = ["defmt-03"] }
embedded-io-async = { version = "0.6.0", optional = true, features = ["defmt-03"] } embedded-io-async = { version = "0.6.0", optional = true, features = ["defmt-03"] }

View File

@@ -1,7 +1,12 @@
MEMORY MEMORY
{ {
/* NOTE 1 K = 1 KiBi = 1024 bytes */ /* NOTE 1 K = 1 KiBi = 1024 bytes */
/* These values correspond to the NRF52840 with Softdevices S140 7.0.1 */
FLASH : ORIGIN = 0x00000000, LENGTH = 1024K FLASH : ORIGIN = 0x00000000, LENGTH = 1024K
RAM : ORIGIN = 0x20000000, LENGTH = 256K RAM : ORIGIN = 0x20000000, LENGTH = 256K
/* These values correspond to the NRF52840 with Softdevices S140 7.3.0 */
/*
FLASH : ORIGIN = 0x00027000, LENGTH = 868K
RAM : ORIGIN = 0x20020000, LENGTH = 128K
*/
} }

View File

@@ -27,7 +27,7 @@ embassy-nrf = { version = "0.1.0", path = "../../embassy-nrf", features = [
"gpiote", "gpiote",
"unstable-pac", "unstable-pac",
] } ] }
embassy-net = { version = "0.1.0", path = "../../embassy-net", features = [ embassy-net = { version = "0.2.0", path = "../../embassy-net", features = [
"nightly", "nightly",
"defmt", "defmt",
"tcp", "tcp",

View File

@@ -12,7 +12,7 @@ embassy-executor = { version = "0.3.0", path = "../../embassy-executor", feature
embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["nightly", "unstable-traits", "defmt", "defmt-timestamp-uptime"] } embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["nightly", "unstable-traits", "defmt", "defmt-timestamp-uptime"] }
embassy-rp = { version = "0.1.0", path = "../../embassy-rp", features = ["defmt", "unstable-traits", "nightly", "unstable-pac", "time-driver", "critical-section-impl"] } embassy-rp = { version = "0.1.0", path = "../../embassy-rp", features = ["defmt", "unstable-traits", "nightly", "unstable-pac", "time-driver", "critical-section-impl"] }
embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] }
embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "udp", "dhcpv4", "medium-ethernet"] } embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "udp", "dhcpv4", "medium-ethernet"] }
embassy-net-wiznet = { version = "0.1.0", path = "../../embassy-net-wiznet", features = ["defmt"] } embassy-net-wiznet = { version = "0.1.0", path = "../../embassy-net-wiznet", features = ["defmt"] }
embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } embassy-futures = { version = "0.1.0", path = "../../embassy-futures" }
embassy-usb-logger = { version = "0.1.0", path = "../../embassy-usb-logger" } embassy-usb-logger = { version = "0.1.0", path = "../../embassy-usb-logger" }

View File

@@ -0,0 +1,32 @@
//! This example test the RP Pico on board LED.
//!
//! It does not work with the RP Pico W board. See wifi_blinky.rs.
#![no_std]
#![no_main]
#![feature(type_alias_impl_trait)]
use defmt::*;
use embassy_executor::Spawner;
use embassy_rp::{clocks, gpio};
use embassy_time::Timer;
use gpio::{Level, Output};
use {defmt_rtt as _, panic_probe as _};
#[embassy_executor::main]
async fn main(_spawner: Spawner) {
let mut config = embassy_rp::config::Config::default();
config.clocks = clocks::ClockConfig::rosc();
let p = embassy_rp::init(config);
let mut led = Output::new(p.PIN_25, Level::Low);
loop {
info!("led on!");
led.set_high();
Timer::after_secs(1).await;
info!("led off!");
led.set_low();
Timer::after_secs(1).await;
}
}

View File

@@ -8,7 +8,7 @@ license = "MIT OR Apache-2.0"
embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["log"] } embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["log"] }
embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["arch-std", "executor-thread", "log", "nightly", "integrated-timers"] } embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["arch-std", "executor-thread", "log", "nightly", "integrated-timers"] }
embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["log", "std", "nightly"] } embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["log", "std", "nightly"] }
embassy-net = { version = "0.1.0", path = "../../embassy-net", features=[ "std", "nightly", "log", "medium-ethernet", "medium-ip", "tcp", "udp", "dns", "dhcpv4", "proto-ipv6"] } embassy-net = { version = "0.2.0", path = "../../embassy-net", features=[ "std", "nightly", "log", "medium-ethernet", "medium-ip", "tcp", "udp", "dns", "dhcpv4", "proto-ipv6"] }
embassy-net-tuntap = { version = "0.1.0", path = "../../embassy-net-tuntap" } embassy-net-tuntap = { version = "0.1.0", path = "../../embassy-net-tuntap" }
embassy-net-ppp = { version = "0.1.0", path = "../../embassy-net-ppp", features = ["log"]} embassy-net-ppp = { version = "0.1.0", path = "../../embassy-net-ppp", features = ["log"]}
embedded-io-async = { version = "0.6.0" } embedded-io-async = { version = "0.6.0" }

View File

@@ -11,7 +11,7 @@ embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["de
embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "executor-interrupt", "defmt", "integrated-timers"] } embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "executor-interrupt", "defmt", "integrated-timers"] }
embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "unstable-traits", "tick-hz-32_768"] } embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "unstable-traits", "tick-hz-32_768"] }
embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] }
embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "tcp", "dhcpv4", "medium-ethernet", "nightly"] } embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "tcp", "dhcpv4", "medium-ethernet", "nightly"] }
defmt = "0.3" defmt = "0.3"
defmt-rtt = "0.4" defmt-rtt = "0.4"

View File

@@ -10,7 +10,7 @@ use embassy_stm32::eth::generic_smi::GenericSMI;
use embassy_stm32::eth::{Ethernet, PacketQueue}; use embassy_stm32::eth::{Ethernet, PacketQueue};
use embassy_stm32::peripherals::ETH; use embassy_stm32::peripherals::ETH;
use embassy_stm32::rng::Rng; use embassy_stm32::rng::Rng;
use embassy_stm32::time::mhz; use embassy_stm32::time::Hertz;
use embassy_stm32::{bind_interrupts, eth, peripherals, rng, Config}; use embassy_stm32::{bind_interrupts, eth, peripherals, rng, Config};
use embassy_time::Timer; use embassy_time::Timer;
use embedded_io_async::Write; use embedded_io_async::Write;
@@ -32,7 +32,25 @@ async fn net_task(stack: &'static Stack<Device>) -> ! {
#[embassy_executor::main] #[embassy_executor::main]
async fn main(spawner: Spawner) -> ! { async fn main(spawner: Spawner) -> ! {
let mut config = Config::default(); let mut config = Config::default();
config.rcc.sys_ck = Some(mhz(200)); {
use embassy_stm32::rcc::*;
config.rcc.hse = Some(Hse {
freq: Hertz(8_000_000),
mode: HseMode::Bypass,
});
config.rcc.pll_src = PllSource::HSE;
config.rcc.pll = Some(Pll {
prediv: PllPreDiv::DIV4,
mul: PllMul::MUL180,
divp: Some(Pllp::DIV2), // 8mhz / 4 * 180 / 2 = 180Mhz.
divq: None,
divr: None,
});
config.rcc.ahb_pre = AHBPrescaler::DIV1;
config.rcc.apb1_pre = APBPrescaler::DIV4;
config.rcc.apb2_pre = APBPrescaler::DIV2;
config.rcc.sys = Sysclk::PLL1_P;
}
let p = embassy_stm32::init(config); let p = embassy_stm32::init(config);
info!("Hello World!"); info!("Hello World!");

View File

@@ -4,15 +4,13 @@
use defmt::info; use defmt::info;
use embassy_executor::Spawner; use embassy_executor::Spawner;
use embassy_stm32::time::Hertz;
use embassy_stm32::Config; use embassy_stm32::Config;
use embassy_time::Timer; use embassy_time::Timer;
use {defmt_rtt as _, panic_probe as _}; use {defmt_rtt as _, panic_probe as _};
#[embassy_executor::main] #[embassy_executor::main]
async fn main(_spawner: Spawner) -> ! { async fn main(_spawner: Spawner) -> ! {
let mut config = Config::default(); let config = Config::default();
config.rcc.sys_ck = Some(Hertz(84_000_000));
let _p = embassy_stm32::init(config); let _p = embassy_stm32::init(config);
loop { loop {

View File

@@ -17,7 +17,7 @@ async fn main(_spawner: Spawner) {
info!("Hello World!"); info!("Hello World!");
let ch1 = PwmPin::new_ch1(p.PE9, OutputType::PushPull); let ch1 = PwmPin::new_ch1(p.PE9, OutputType::PushPull);
let mut pwm = SimplePwm::new(p.TIM1, Some(ch1), None, None, None, khz(10)); let mut pwm = SimplePwm::new(p.TIM1, Some(ch1), None, None, None, khz(10), Default::default());
let max = pwm.get_max_duty(); let max = pwm.get_max_duty();
pwm.enable(Channel::Ch1); pwm.enable(Channel::Ch1);

View File

@@ -30,6 +30,7 @@ async fn main(_spawner: Spawner) {
None, None,
None, None,
khz(10), khz(10),
Default::default(),
); );
let max = pwm.get_max_duty(); let max = pwm.get_max_duty();

View File

@@ -5,7 +5,7 @@
use defmt::*; use defmt::*;
use embassy_executor::Spawner; use embassy_executor::Spawner;
use embassy_stm32::sdmmc::{DataBlock, Sdmmc}; use embassy_stm32::sdmmc::{DataBlock, Sdmmc};
use embassy_stm32::time::mhz; use embassy_stm32::time::{mhz, Hertz};
use embassy_stm32::{bind_interrupts, peripherals, sdmmc, Config}; use embassy_stm32::{bind_interrupts, peripherals, sdmmc, Config};
use {defmt_rtt as _, panic_probe as _}; use {defmt_rtt as _, panic_probe as _};
@@ -20,8 +20,25 @@ bind_interrupts!(struct Irqs {
#[embassy_executor::main] #[embassy_executor::main]
async fn main(_spawner: Spawner) { async fn main(_spawner: Spawner) {
let mut config = Config::default(); let mut config = Config::default();
config.rcc.sys_ck = Some(mhz(48)); {
config.rcc.pll48 = true; use embassy_stm32::rcc::*;
config.rcc.hse = Some(Hse {
freq: Hertz(8_000_000),
mode: HseMode::Bypass,
});
config.rcc.pll_src = PllSource::HSE;
config.rcc.pll = Some(Pll {
prediv: PllPreDiv::DIV4,
mul: PllMul::MUL168,
divp: Some(Pllp::DIV2), // 8mhz / 4 * 168 / 2 = 168Mhz.
divq: Some(Pllq::DIV7), // 8mhz / 4 * 168 / 7 = 48Mhz.
divr: None,
});
config.rcc.ahb_pre = AHBPrescaler::DIV1;
config.rcc.apb1_pre = APBPrescaler::DIV4;
config.rcc.apb2_pre = APBPrescaler::DIV2;
config.rcc.sys = Sysclk::PLL1_P;
}
let p = embassy_stm32::init(config); let p = embassy_stm32::init(config);
info!("Hello World!"); info!("Hello World!");

View File

@@ -7,7 +7,7 @@ use embassy_executor::Spawner;
use embassy_net::tcp::TcpSocket; use embassy_net::tcp::TcpSocket;
use embassy_net::{Stack, StackResources}; use embassy_net::{Stack, StackResources};
use embassy_stm32::rng::{self, Rng}; use embassy_stm32::rng::{self, Rng};
use embassy_stm32::time::mhz; use embassy_stm32::time::Hertz;
use embassy_stm32::usb_otg::Driver; use embassy_stm32::usb_otg::Driver;
use embassy_stm32::{bind_interrupts, peripherals, usb_otg, Config}; use embassy_stm32::{bind_interrupts, peripherals, usb_otg, Config};
use embassy_usb::class::cdc_ncm::embassy_net::{Device, Runner, State as NetState}; use embassy_usb::class::cdc_ncm::embassy_net::{Device, Runner, State as NetState};
@@ -46,9 +46,25 @@ async fn main(spawner: Spawner) {
info!("Hello World!"); info!("Hello World!");
let mut config = Config::default(); let mut config = Config::default();
config.rcc.pll48 = true; {
config.rcc.sys_ck = Some(mhz(48)); use embassy_stm32::rcc::*;
config.rcc.hse = Some(Hse {
freq: Hertz(8_000_000),
mode: HseMode::Bypass,
});
config.rcc.pll_src = PllSource::HSE;
config.rcc.pll = Some(Pll {
prediv: PllPreDiv::DIV4,
mul: PllMul::MUL168,
divp: Some(Pllp::DIV2), // 8mhz / 4 * 168 / 2 = 168Mhz.
divq: Some(Pllq::DIV7), // 8mhz / 4 * 168 / 7 = 48Mhz.
divr: None,
});
config.rcc.ahb_pre = AHBPrescaler::DIV1;
config.rcc.apb1_pre = APBPrescaler::DIV4;
config.rcc.apb2_pre = APBPrescaler::DIV2;
config.rcc.sys = Sysclk::PLL1_P;
}
let p = embassy_stm32::init(config); let p = embassy_stm32::init(config);
// Create the driver, from the HAL. // Create the driver, from the HAL.

View File

@@ -4,7 +4,7 @@
use defmt::{panic, *}; use defmt::{panic, *};
use embassy_executor::Spawner; use embassy_executor::Spawner;
use embassy_stm32::time::mhz; use embassy_stm32::time::Hertz;
use embassy_stm32::usb_otg::{Driver, Instance}; use embassy_stm32::usb_otg::{Driver, Instance};
use embassy_stm32::{bind_interrupts, peripherals, usb_otg, Config}; use embassy_stm32::{bind_interrupts, peripherals, usb_otg, Config};
use embassy_usb::class::cdc_acm::{CdcAcmClass, State}; use embassy_usb::class::cdc_acm::{CdcAcmClass, State};
@@ -22,9 +22,25 @@ async fn main(_spawner: Spawner) {
info!("Hello World!"); info!("Hello World!");
let mut config = Config::default(); let mut config = Config::default();
config.rcc.pll48 = true; {
config.rcc.sys_ck = Some(mhz(48)); use embassy_stm32::rcc::*;
config.rcc.hse = Some(Hse {
freq: Hertz(8_000_000),
mode: HseMode::Bypass,
});
config.rcc.pll_src = PllSource::HSE;
config.rcc.pll = Some(Pll {
prediv: PllPreDiv::DIV4,
mul: PllMul::MUL168,
divp: Some(Pllp::DIV2), // 8mhz / 4 * 168 / 2 = 168Mhz.
divq: Some(Pllq::DIV7), // 8mhz / 4 * 168 / 7 = 48Mhz.
divr: None,
});
config.rcc.ahb_pre = AHBPrescaler::DIV1;
config.rcc.apb1_pre = APBPrescaler::DIV4;
config.rcc.apb2_pre = APBPrescaler::DIV2;
config.rcc.sys = Sysclk::PLL1_P;
}
let p = embassy_stm32::init(config); let p = embassy_stm32::init(config);
// Create the driver, from the HAL. // Create the driver, from the HAL.

View File

@@ -10,7 +10,7 @@ embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["
embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] }
embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] }
embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] }
embassy-net = { path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "dhcpv4", "medium-ethernet"] } embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "dhcpv4", "medium-ethernet"] }
embedded-io-async = { version = "0.6.0" } embedded-io-async = { version = "0.6.0" }
embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] }

View File

@@ -10,7 +10,7 @@ use embassy_stm32::eth::generic_smi::GenericSMI;
use embassy_stm32::eth::{Ethernet, PacketQueue}; use embassy_stm32::eth::{Ethernet, PacketQueue};
use embassy_stm32::peripherals::ETH; use embassy_stm32::peripherals::ETH;
use embassy_stm32::rng::Rng; use embassy_stm32::rng::Rng;
use embassy_stm32::time::mhz; use embassy_stm32::time::Hertz;
use embassy_stm32::{bind_interrupts, eth, peripherals, rng, Config}; use embassy_stm32::{bind_interrupts, eth, peripherals, rng, Config};
use embassy_time::Timer; use embassy_time::Timer;
use embedded_io_async::Write; use embedded_io_async::Write;
@@ -33,7 +33,25 @@ async fn net_task(stack: &'static Stack<Device>) -> ! {
#[embassy_executor::main] #[embassy_executor::main]
async fn main(spawner: Spawner) -> ! { async fn main(spawner: Spawner) -> ! {
let mut config = Config::default(); let mut config = Config::default();
config.rcc.sys_ck = Some(mhz(200)); {
use embassy_stm32::rcc::*;
config.rcc.hse = Some(Hse {
freq: Hertz(8_000_000),
mode: HseMode::Bypass,
});
config.rcc.pll_src = PllSource::HSE;
config.rcc.pll = Some(Pll {
prediv: PllPreDiv::DIV4,
mul: PllMul::MUL216,
divp: Some(Pllp::DIV2), // 8mhz / 4 * 216 / 2 = 216Mhz
divq: None,
divr: None,
});
config.rcc.ahb_pre = AHBPrescaler::DIV1;
config.rcc.apb1_pre = APBPrescaler::DIV4;
config.rcc.apb2_pre = APBPrescaler::DIV2;
config.rcc.sys = Sysclk::PLL1_P;
}
let p = embassy_stm32::init(config); let p = embassy_stm32::init(config);
info!("Hello World!"); info!("Hello World!");

Some files were not shown because too many files have changed in this diff Show More